SLM Class Reference

#include <ERF_SLM.H>

Inheritance diagram for SLM:

Collaboration diagram for SLM:

Public Member Functions
	SLM ()
virtual	~SLM ()=default
void	Define (SolverChoice &sc) override
void	Init (const int &, const amrex::MultiFab &cons_in, const amrex::MultiFab &u_in, const amrex::MultiFab &v_in, const amrex::Geometry &geom, const amrex::Geometry &geom0, amrex::Vector< amrex::BCRec > &domain_bcs_type, amrex::IntVect &refRatio, const amrex::Real &dt, std::unique_ptr< amrex::MultiFab > &z_phys_nd_in, amrex::Vector< amrex::Vector< std::string >> &nc_init_file) override
void	Lsm_Regrid_Level (const int &lev, const amrex::MultiFab &cons_in, const amrex::MultiFab &u_in, const amrex::MultiFab &v_in, const amrex::Geometry &geom, const amrex::Geometry &geom0, amrex::Vector< amrex::BCRec > &domain_bcs_type, amrex::IntVect &refRatio, const amrex::Real &dt, std::unique_ptr< amrex::MultiFab > &z_phys_nd_in, amrex::Vector< amrex::Vector< std::string >> &nc_init_file, const amrex::Geometry &source_geom, const amrex::Geometry &source_lsm_geom, const amrex::IntVect &source_ref_ratio, const bool has_source) override
void	Advance (const double &dt) override
void	Advance (const amrex::Real &dt, const amrex::Real &t_new, const amrex::Real &t_start) override
void	AdvanceSLM ()
amrex::MultiFab *	Lsm_Data_Ptr (const int &varIdx) override
amrex::MultiFab *	Lsm_Flux_Ptr (const int &varIdx) override
amrex::Geometry	Lsm_Geom () override
amrex::Geometry	Lsm_Atmos_Geom () override
void	Lsm_Set_Source_Data_Ptr (const int &varIdx, amrex::MultiFab *source_data_ptr) override
void	Lsm_Set_Source_Flux_Ptr (const int &varIdx, amrex::MultiFab *source_flux_ptr) override
int	Lsm_Unmapped_Size () override
amrex::MultiFab *	Lsm_Unmapped_Ptr (const int &varIdx) override
void	Lsm_Set_Source_Unmapped_Ptr (const int &varIdx, amrex::MultiFab *source_data_ptr) override
void	Lsm_Interpolate_From_Source (const amrex::Geometry &source_geom, const amrex::Geometry &source_lsm_geom, const amrex::IntVect &ref_ratio, LSMTransferMode mode) override
int	Lsm_Data_Size () override
int	Lsm_Flux_Size () override
std::string	Lsm_DataName (const int &varIdx) override
int	Lsm_DataIndex (const std::string &varname) override
std::string	Lsm_FluxName (const int &varIdx) override
int	Lsm_FluxIndex (const std::string &varname) override
std::unordered_map< std::string, std::string > &	Lsm_WRFInputNames () override
void	Copy_State_to_Lsm (const amrex::MultiFab &cons_in, const amrex::MultiFab &u_in, const amrex::MultiFab &v_in) override
void	Copy_Lsm_to_State (amrex::MultiFab &cons_in) override
void	Update_Lsm_Vars (amrex::MultiFab &cons_in, amrex::MultiFab &u_in, amrex::MultiFab &v_in) override
bool	Get_Update_Status () override
void	Update_State_Vars (amrex::MultiFab &cons_in) override
void	set_precip_input (const amrex::MultiFab *precip_in) override
void	set_terrain_inputs (const amrex::Vector< std::unique_ptr< amrex::MultiFab >> &sst_in, const amrex::Vector< std::unique_ptr< amrex::iMultiFab >> &lmask_in) override
int	Lsm_Type () override
void	writeSLM_Data (const PlotFileType plotfile_type, const amrex::Real cur_time, const std::string plot_prefix, const int level_step, const int lev, const int finest_lev, amrex::MultiFab &fab, amrex::Geometry &geom, amrex::Vector< std::string > &varnames)
void	init_from_inputs ()
void	slm_init ()
void	init_layer_depths ()
void	init_soil_vars ()
void	init_landtype ()
void	init_soil_tw ()
void	init_slm_vars ()
void	init_wrfinput_vars ()
void	initialize_surface_outputs ()
void	rebuild_restart_fields ()
SLMParameterTable	ReadParameterFile (const std::string &filename, amrex::Vector< std::string > &veg_categories, amrex::Vector< std::string > &soil_categories)
void	validate_parameter_tables ()
void	init_from_params ()
void	load_builtin_radiation_parameters ()
void	UpdateLAI (const amrex::MFIter &mfi)
void	UpdateLAIParameters (const amrex::MFIter &mfi)
void	radiation_noahmp (const amrex::MFIter &mfi)
void	albedo_noahmp (const amrex::MFIter &mfi, int i, int j, amrex::Real dt, amrex::Real cosz, amrex::Real snowh, amrex::Real fsno, amrex::Real fwet, amrex::Real sneqvo, amrex::Real sneqv, amrex::Real qsnow, amrex::Real tg, amrex::Real tv, amrex::Real elai, amrex::Real esai, const amrex::Real *smc, int nsoil, amrex::Real fveg, amrex::Real &albold, amrex::Real &tauss, amrex::Real *albgrd, amrex::Real *albgri, amrex::Real *albd, amrex::Real *albi, amrex::Real *fabd, amrex::Real *fabi, amrex::Real *ftdd, amrex::Real *ftid, amrex::Real *ftii, amrex::Real &fsun, amrex::Real *frevd, amrex::Real *frevi, amrex::Real *fregd, amrex::Real *fregi, amrex::Real &bgap, amrex::Real &wgap, amrex::Real *albsnd, amrex::Real *albsni)
void	transfer_coeff (const amrex::MFIter &mfi)
void	resistances (const amrex::MFIter &mfi)
void	fluxes_canopy (const amrex::MFIter &mfi)
void	solve_ground_skin_temperature (const amrex::MFIter &mfi)
void	soil_water (const amrex::MFIter &mfi)
void	soil_temperature (const amrex::MFIter &mfi)
void	soil_nudging (const amrex::MFIter &mfi3d)
void	set_dt (const amrex::Real &dt)
const amrex::Vector< const amrex::MultiFab * > &	export_to_RRTMGP ()
std::unordered_map< std::string, std::string > &	get_rad_output_map ()
void	WriteCheckpoint (const int &lev, const std::string &checkpointname) const override
void	ReadCheckpoint (const int &lev, const std::string &checkpointname) override
void	initialize_zrefxy ()
void	initialize_processed_state (const bool preserve_checkpoint_fields=false)
virtual void	Init (const int &, const amrex::MultiFab &, const amrex::Geometry &, const amrex::Geometry &, amrex::Vector< amrex::BCRec > &, amrex::IntVect &, const amrex::Real &, amrex::Vector< amrex::Vector< std::string >> &)
virtual void	Init (const int &lev, const amrex::MultiFab &cons_in, const amrex::MultiFab &, const amrex::MultiFab &, const amrex::Geometry &geom, const amrex::Geometry &geom0, amrex::Vector< amrex::BCRec > &domain_bcs_type, amrex::IntVect &refRatio, const amrex::Real &dt_advance, std::unique_ptr< amrex::MultiFab > &, amrex::Vector< amrex::Vector< std::string >> &nc_init_file)
Public Member Functions inherited from NullSurf
	NullSurf ()
virtual	~NullSurf ()=default
virtual void	Init (const int &, const amrex::MultiFab &, const amrex::Geometry &, const amrex::Geometry &, amrex::Vector< amrex::BCRec > &, amrex::IntVect &, const amrex::Real &, amrex::Vector< amrex::Vector< std::string >> &)
virtual void	Advance_With_State (const int &, amrex::MultiFab &, amrex::MultiFab &, amrex::MultiFab &, amrex::MultiFab *, amrex::MultiFab *, const SurfacePrecipAccumulationSources &, const amrex::Real &, const amrex::Real &, const int &, const bool, amrex::MultiFab *)
virtual void	Plot_Landfile (const int &)
virtual void	Update_Micro_Vars (amrex::MultiFab &)
virtual void	Copy_State_to_Micro (const amrex::MultiFab &)
virtual void	Copy_Micro_to_State (amrex::MultiFab &)
virtual void	Lsm_Set_Lev0_Data_Ptr (const int &, amrex::MultiFab *)
virtual void	Lsm_Set_Lev0_Flux_Ptr (const int &, amrex::MultiFab *)
virtual bool	Runs_Own_Land_Driver () const
virtual int	Get_LSM_Step () const
virtual void	Set_LSM_Step (int)
virtual void	Write_Lsm_Restart (const std::string &) const
virtual void	Read_Lsm_Restart (const std::string &)

Static Public Member Functions
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE void	surrad_noahmp (amrex::Real mpe, amrex::Real fsun, amrex::Real fsha, amrex::Real elai, amrex::Real vai, amrex::Real laisun, amrex::Real laisha, const amrex::Real *solad, const amrex::Real *solai, const amrex::Real *fabd, const amrex::Real *fabi, const amrex::Real *ftdd, const amrex::Real *ftid, const amrex::Real *ftii, const amrex::Real *albgrd, const amrex::Real *albgri, const amrex::Real *albd, const amrex::Real *albi, const amrex::Real *frevd, const amrex::Real *frevi, const amrex::Real *fregd, const amrex::Real *fregi, amrex::Real &parsun, amrex::Real &parsha, amrex::Real &sav, amrex::Real &sag, amrex::Real &fsa, amrex::Real &fsr, amrex::Real &fsrv, amrex::Real &fsrg)
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE void	snow_age_noahmp (amrex::Real dt, amrex::Real tg, amrex::Real sneqvo, amrex::Real sneqv, amrex::Real tau0, amrex::Real grain_growth, amrex::Real extra_growth, amrex::Real dirt_soot, amrex::Real swemx, amrex::Real &tauss, amrex::Real &fage)
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE void	snowalb_bats_noahmp (int nband, amrex::Real fsno, amrex::Real cosz, amrex::Real fage, amrex::Real bats_cosz, amrex::Real bats_vis_new, amrex::Real bats_nir_new, amrex::Real bats_vis_age, amrex::Real bats_nir_age, amrex::Real bats_vis_dir, amrex::Real bats_nir_dir, amrex::Real *albsnd, amrex::Real *albsni)
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE void	groundalb_noahmp (int nsoil, int nband, int ice, int ist, amrex::Real fsno, const amrex::Real *smc, const amrex::Real *albsnd, const amrex::Real *albsni, amrex::Real cosz, amrex::Real tg, const amrex::Real *albsat, const amrex::Real *albdry, const amrex::Real *alblak, amrex::Real *albgrd, amrex::Real *albgri)
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE void	twostream_noahmp (int ib, int ic, int vegtyp, amrex::Real cosz, amrex::Real vai, amrex::Real fwet, amrex::Real t, const amrex::Real *albgrd, const amrex::Real *albgri, const amrex::Real *rho, const amrex::Real *tau, amrex::Real fveg, int ist, amrex::Real xl, amrex::Real omegas_param, amrex::Real betads, amrex::Real betais, int opt_rad, amrex::Real rc, amrex::Real hvt, amrex::Real hvb, amrex::Real den, amrex::Real *fab, amrex::Real *fre, amrex::Real *ftd, amrex::Real *fti, amrex::Real &gdir, amrex::Real *frev, amrex::Real *freg, amrex::Real &bgap, amrex::Real &wgap, amrex::Real &xl_out, amrex::Real &chil_out, amrex::Real &phi1_out, amrex::Real &phi2_out)
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE amrex::Real	fh_calc (const amrex::Real &t, const amrex::Real &mps, const amrex::Real &sw, const amrex::Real &B)
AMREX_GPU_HOST_DEVICE static AMREX_FORCE_INLINE amrex::Real	linear_interp (const amrex::Real t0, const amrex::Real t1, const amrex::Real t, const amrex::Real x, const amrex::Real y)
static void	GotoNextLine (std::istream &is)

Private Types
using	FabPtr = std::shared_ptr< amrex::MultiFab >

Private Attributes
int	m_lsm_data_size = 44
int	m_lsm_flux_size = 5
amrex::Vector< int >	LsmDataMap
amrex::Vector< int >	LsmFluxMap
amrex::Vector< std::string >	LsmDataName
amrex::Vector< std::string >	LsmFluxName
amrex::Geometry	m_geom
amrex::Geometry	m_geom0
amrex::Geometry	m_lsm_geom
amrex::Geometry	m_lsm_geom0
amrex::Vector< amrex::BCRec >	m_domain_bcs_type
amrex::BoxArray	ba_lsm_2d
amrex::Real	m_dt
int	khi_lsm
int	klo_lsm
amrex::Array< FabPtr, LsmVar_SLM::NumVars >	lsm_fab_vars
amrex::Array< FabPtr, LsmFlux_SLM::NumVars >	lsm_fab_flux
amrex::Vector< amrex::MultiFab * >	source_data
amrex::Vector< amrex::MultiFab * >	source_flux
amrex::Vector< amrex::MultiFab * >	source_unmapped
int	m_nz_lsm = 7
std::vector< amrex::Real >	m_dz_lsm
std::string	rad_input_file
int	landtype0 = 16
amrex::Real	LAI0 = zero
amrex::Vector< amrex::Real >	clay0
amrex::Vector< amrex::Real >	sand0
amrex::Vector< amrex::Real >	sw0
amrex::Vector< amrex::Real >	st0
amrex::Vector< amrex::Real >	relax_hgt
amrex::Real	tabs_s = zero
amrex::Real	t00 = 300.0
bool	use_terrain = false
bool	dosoilwnudging = false
bool	dosoiltnudging = false
amrex::Real	tausoil = 86400.0
amrex::Real	z0_soil = 0.01
amrex::Real	mws_mx0 = 50.0
amrex::Real	Rc_max = 5000.0
amrex::Real	T_opt = 298.0
amrex::Real	zref = myhalf
amrex::MultiFab	zrefxy
amrex::MultiFab	t_canop
amrex::MultiFab	mw
amrex::MultiFab	mws
amrex::MultiFab	t_skin
amrex::MultiFab	t_ground_skin
amrex::MultiFab	t_sfc
amrex::MultiFab	q_sfc
amrex::MultiFab	t_cas
amrex::MultiFab	q_cas
amrex::MultiFab	q_gr
amrex::MultiFab	sdew
amrex::iMultiFab	landmask
amrex::iMultiFab	landtype
amrex::iMultiFab	nroot
amrex::MultiFab	LAI
amrex::MultiFab	SAI
amrex::MultiFab	sstxy
amrex::iMultiFab	vegetype
amrex::MultiFab	vege_YES
amrex::MultiFab	cp_vege
amrex::MultiFab	cbiom
amrex::MultiFab	dleaf
amrex::MultiFab	z0_sfc
amrex::MultiFab	Khai_L
amrex::MultiFab	phi_1
amrex::MultiFab	phi_2
amrex::MultiFab	IR_emis_vege
amrex::MultiFab	IR_emis_soil
amrex::MultiFab	IR_emis_grnd
amrex::MultiFab	ztop
amrex::MultiFab	disp_hgt
amrex::MultiFab	Rgl
amrex::MultiFab	Rc_min
amrex::MultiFab	hs_rc
amrex::MultiFab	precip_extinc
amrex::MultiFab	precip_sfc
amrex::MultiFab	mw_mx
amrex::MultiFab	mws_mx
amrex::MultiFab	BAI
amrex::MultiFab	IMPERV
amrex::MultiFab	soilt_vars
amrex::MultiFab	soilw_vars
amrex::MultiFab	mw_inc
amrex::MultiFab	evapo_dry
amrex::MultiFab	evapo_wet
amrex::MultiFab	shf_canop
amrex::MultiFab	shf_soil
amrex::MultiFab	shf_air
amrex::MultiFab	lhf_canop
amrex::MultiFab	lhf_soil
amrex::MultiFab	lhf_air
amrex::MultiFab	evp_canop
amrex::MultiFab	evp_soil
amrex::MultiFab	evp_air
amrex::MultiFab	albedovis_v
amrex::MultiFab	albedonir_v
amrex::MultiFab	albedovis_s
amrex::MultiFab	albedonir_s
amrex::MultiFab	r_a
amrex::MultiFab	r_b
amrex::MultiFab	r_c
amrex::MultiFab	r_d
amrex::MultiFab	r_soil
amrex::MultiFab	net_rad
amrex::MultiFab	wet_canop
amrex::Real	time = zero
amrex::Real	start_time = -1.0
bool	first_step = true
bool	m_updated = false
std::string	parameter_file = "NoahmpTable.TBL"
std::string	veg_dataset = "modis"
std::string	soil_dataset = "stas"
int	num_landtypes = -1
int	num_veg_params = -1
int	num_soil_params = -1
SLMParameterTable	full_params
amrex::Vector< std::string >	param_veg_categories
amrex::Vector< std::string >	param_soil_categories
std::unordered_map< std::string, std::unique_ptr< amrex::Gpu::DeviceVector< amrex::Real > > >	d_soil_params
std::unordered_map< std::string, std::unique_ptr< amrex::Gpu::DeviceVector< amrex::Real > > >	d_veg_params
std::unordered_map< std::string, std::unique_ptr< amrex::Gpu::DeviceVector< amrex::Real > > >	d_rad_params
std::vector< std::vector< amrex::Real > >	sai_table
std::vector< std::vector< amrex::Real > >	lai_table
amrex::Gpu::DeviceVector< amrex::Real >	d_lai_curr
amrex::Gpu::DeviceVector< amrex::Real >	d_lai_next
amrex::Gpu::DeviceVector< amrex::Real >	d_sai_curr
amrex::Gpu::DeviceVector< amrex::Real >	d_sai_next
bool	use_param_file = false
bool	interpolate_lai = false
bool	use_wrf_lai = false
bool	params_updated = false
int	opt_rad = 1
int	opt_alb = 1
amrex::Real	betads_rad = myhalf
amrex::Real	betais_rad = myhalf
amrex::Real	tau0_rad = 1.0e6
amrex::Real	grain_growth_rad = 5000.
amrex::Real	extra_growth_rad = 10.
amrex::Real	dirt_soot_rad = 0.3
amrex::Real	rsurf_exp = 5.0
amrex::Real	bats_cosz_rad = two
amrex::Real	bats_vis_new_rad = 0.95
amrex::Real	bats_nir_new_rad = 0.65
amrex::Real	bats_vis_age_rad = 0.2
amrex::Real	bats_nir_age_rad = myhalf
amrex::Real	bats_vis_dir_rad = 0.4
amrex::Real	bats_nir_dir_rad = 0.4
amrex::Real	swemx_rad = one
amrex::Real	snow_emis_rad = 0.95
amrex::Real	eg_soil_rad = 0.97
amrex::Real	eg_lake_rad = 0.98
amrex::MultiFab	albold_noahmp
amrex::MultiFab	tauss_noahmp
std::vector< std::vector< amrex::Real > >	param_table
amrex::TableData< amrex::Real, 2 >	d_param_table
amrex::Real	m_calday = -1.0
int	m_orbital_year = -1
int	m_orbital_mon = -1
int	m_orbital_day = -1
int	m_orbital_sec = -1
amrex::MultiFab *	z_phys_nd
amrex::MultiFab	slm_diag
amrex::Vector< const amrex::MultiFab * >	slm_to_rad_vars
bool	use_wrfinput = false
bool	wrfinput_initialized = false
amrex::Vector< int >	unmapped_fields

Static Private Attributes
static constexpr amrex::Real	t_canop_max = 343.
static constexpr amrex::Real	tfriz = 273.15
static constexpr amrex::Real	epsv = 0.61
static constexpr amrex::Real	cp = 1004.0
static constexpr amrex::Real	cp_water = 4.1796e6
static constexpr amrex::Real	sigma = 5.67e-8
static constexpr amrex::Real	IR_emis_urban = 0.9
static constexpr amrex::Real	r_litter = zero
static std::unordered_map< std::string, std::string >	wrfinput_map
static std::unordered_map< std::string, std::string >	rad_output_map
static const std::unordered_set< int >	surf_vars
static constexpr const char *	LsmVarName_Full []
static const std::vector< std::string >	diag_names

Detailed Description

The Simplified Land-surface Model (SLM) supplies lower-boundary sensible-heat, latent-heat, and momentum fluxes for land cells.

The original formulation and evaluation of SLM are documented in Lee and Khairoutdinov (2015), "A Simplified Land Model (SLM) for use in cloud-resolving models: Formulation and evaluation," Journal of Advances in Modeling Earth Systems, 7, 1368–1392, https://doi.org/10.1002/2014MS000419.

SLM includes selected formulations adapted from NoahMP, updates inherited from gSAM-SLM, and SLM-specific corrections to the surface energy and water budgets. It remains a simplified land model and is not a complete implementation of NoahMP.

Member Typedef Documentation

FabPtr

using SLM::FabPtr = std::shared_ptr<amrex::MultiFab>

private

Constructor & Destructor Documentation

SLM()

SLM::SLM ( )

inline

{}

~SLM()

virtual SLM::~SLM ( )

virtualdefault

Member Function Documentation

Advance() [1/2]

void SLM::Advance ( const amrex::Real &  dt, const amrex::Real &  t_new, const amrex::Real &  t_start  )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        m_updated = false;
        m_dt = dt;
        time = t_new;
        start_time = t_start;
 
        if (first_step)
        {
            first_step = false;
 
            if (use_wrfinput && !wrfinput_initialized) {
                this->init_wrfinput_vars();
            }
 
            initialize_zrefxy();
        }
 
        this->AdvanceSLM();
        m_updated = true;
 
    }

Here is the call graph for this function:

Advance() [2/2]

void SLM::Advance ( const double &  dt )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        Advance(static_cast<amrex::Real>(dt), time + static_cast<amrex::Real>(dt), start_time);
    }

AdvanceSLM()

void SLM::AdvanceSLM

(

)

{
    // Expose for GPU copy
    Real dt = m_dt;
    const int d_khi_lsm = khi_lsm;
 
    net_rad.setVal(0.0, SLM_NetRad::net_sw1, 1, 0);
    net_rad.setVal(0.0, SLM_NetRad::net_sw2, 1, 0);
    net_rad.setVal(0.0, SLM_NetRad::net_rad1, 1, 0);
    net_rad.setVal(0.0, SLM_NetRad::net_rad2, 1, 0);
    mw_inc.setVal(zero);
 
    // Soil temperature and moisture nudging
    for ( MFIter mfi(*lsm_fab_vars[LsmVar_SLM::tsurf], TileNoZ()); mfi.isValid(); ++mfi) {
        soil_nudging(mfi);
    }
 
    for ( MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        auto box = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
 
        auto LAI_arr = LAI.const_array(mfi);
        auto precip_extinc_arr = precip_extinc.const_array(mfi);
 
        auto mw_arr = mw.array(mfi);
        auto mws_arr = mws.const_array(mfi);
        auto mw_mx_arr = mw_mx.const_array(mfi);
 
        auto mw_inc_arr = mw_inc.array(mfi);
 
        auto t_cas_arr = t_cas.array(mfi);
        auto q_cas_arr = q_cas.array(mfi);
 
        auto t_sfc_arr = t_sfc.array(mfi);
        auto q_sfc_arr = q_sfc.array(mfi);
 
        auto q_gr_arr = q_gr.array(mfi);
 
        auto t_canop_arr = t_canop.array(mfi);
        auto t_skin_arr = t_skin.const_array(mfi);
        auto t_ground_skin_arr = t_ground_skin.const_array(mfi);
 
        auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->const_array(mfi);
        auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
 
        auto m_pot_sat_arr = lsm_fab_vars[LsmVar_SLM::m_pot_sat]->const_array(mfi);
        auto Bconst_arr = lsm_fab_vars[LsmVar_SLM::Bconst]->const_array(mfi);
 
        auto ustar_arr = lsm_fab_vars[LsmVar_SLM::ustar]->const_array(mfi);
        auto qstar_arr = lsm_fab_vars[LsmVar_SLM::qstar]->array(mfi);
 
        auto SAI_arr = SAI.const_array(mfi);
        auto cbiom_arr = cbiom.const_array(mfi);
 
        auto shf_air_arr = shf_air.array(mfi);
 
        auto evp_air_arr = evp_air.array(mfi);
 
        auto vegetype_arr = vegetype.const_array(mfi);
        auto vege_YES_arr = vege_YES.const_array(mfi);
 
        auto cp_vege_arr = cp_vege.array(mfi);
 
        auto sdew_arr = sdew.array(mfi);
 
        auto tref_arr  = lsm_fab_vars[LsmVar_SLM::tref]->const_array(mfi);
        auto dref_arr  = lsm_fab_vars[LsmVar_SLM::dref]->const_array(mfi);
        auto qref_arr  = lsm_fab_vars[LsmVar_SLM::qref]->const_array(mfi);
        auto pref_arr  = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
        auto precip_array  = lsm_fab_vars[LsmVar_SLM::precipref]->const_array(mfi);
 
        auto tsurf_arr = lsm_fab_vars[LsmVar_SLM::tsurf]->array(mfi);
        auto tveg_arr = lsm_fab_vars[LsmVar_SLM::tv]->array(mfi);
        auto mveg_arr = lsm_fab_vars[LsmVar_SLM::mv]->array(mfi);
 
        auto r_a_arr = r_a.const_array(mfi);
        auto r_b_arr = r_b.const_array(mfi);
        auto r_c_arr = r_c.const_array(mfi);
        auto r_d_arr = r_d.const_array(mfi);
        auto r_soil_arr = r_soil.const_array(mfi);
 
        auto flbu_arr  = lsm_fab_vars[LsmVar_SLM::flbu]->array(mfi);
        auto flbv_arr  = lsm_fab_vars[LsmVar_SLM::flbv]->array(mfi);
        auto flbq_arr  = lsm_fab_vars[LsmVar_SLM::flbq]->array(mfi);
        auto flbt_arr  = lsm_fab_vars[LsmVar_SLM::flbt]->array(mfi);
        auto prsfc_arr  = lsm_fab_vars[LsmVar_SLM::prsfc]->array(mfi);
 
        auto wet_canop_arr = wet_canop.const_array(mfi);
 
        // TODO: Copies for MOST
        auto fluxq_arr = lsm_fab_flux[LsmFlux_SLM::q_flux]->array(mfi);
        auto fluxt_arr = lsm_fab_flux[LsmFlux_SLM::t_flux]->array(mfi);
        auto tau13_arr = lsm_fab_flux[LsmFlux_SLM::tau13]->array(mfi);
        auto tau23_arr = lsm_fab_flux[LsmFlux_SLM::tau23]->array(mfi);
        auto olen_arr  = lsm_fab_flux[LsmFlux_SLM::olen]->array(mfi);
 
        auto slm_diag_arr = slm_diag.array(mfi);
 
        // Update LAI and SAI based on current month
        UpdateLAI(mfi);
 
        // NOAHMP radiation calculation
        radiation_noahmp(mfi);
 
        ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            if (landmask_arr(i, j, 0) != 1) {
                return;
            }
 
            amrex::Real precip = zero;
            amrex::Real drain = zero;
            amrex::Real cp_vege_tot, fh;
            // precipitation interception rate at canoppy
            // For baresoil, precip = 0, as LAI = 0
            precip = precip_array(i, j, 0) * (one - std::exp(-precip_extinc_arr(i, j, 0) * LAI_arr(i, j, 0)));
 
            if (mw_arr(i, j, 0) < mw_mx_arr(i, j, 0))
            {
                drain = zero;
            }
            else if(mw_arr(i, j, 0) > mw_mx_arr(i, j, 0))
            {
                // when water holding storage exceeds its maximum, no precipitation is intercepted
                drain = precip;
 
                // excess water storage gets drained from mw [kg/m^2]
                drain += std::max(mw_arr(i, j, 0) - mw_mx_arr(i, j, 0), amrex::Real(zero)) / dt; // mm/s
            }
 
            prsfc_arr(i, j, 0) = precip_array(i, j, 0) - precip + drain;
 
            // Update output variables
            slm_diag_arr(i, j, 0, SLM_Diag::precip) = precip;
 
            // Original SLM formula:
            // cp_vege_arr(i, j, 0) =
            //     (LAI_arr(i, j, 0) * leaf_thickness * 0.001
            //      + ztop_arr(i, j, 0) * BAI_arr(i, j, 0) / 43560.) * 900. * 2800.;
 
            // NoahMP dry canopy heat capacity: CBIOM * effective VAI * volumetric water heat capacity.
            const amrex::Real vai = std::min(amrex::Real(6.0), LAI_arr(i, j, 0) + SAI_arr(i, j, 0));
            cp_vege_arr(i, j, 0) = cbiom_arr(i, j, 0) * vai * cp_water * vege_YES_arr(i, j, 0);
            cp_vege_tot = cp_vege_arr(i, j, 0) + mw_arr(i, j, 0) * 1.e-3 * cp_water;
 
            // Add to vegetiation moisture increment from SLM::vapor_fluxes()
            mw_inc_arr(i, j, 0) += dt * (precip - drain);
 
            // Update vegetation moisture storage
            mw_arr(i, j, 0) += mw_inc_arr(i, j, 0);
 
            // from gSAM-SLM
            // intercepted precip cools the canopy:
            // temperature of intercepted rain is the same as reference level
            // note it cools even when water storage is full as old water on leaves is replaced by new rain water
            if (vegetype_arr(i, j, 0) == 1)
            {
                t_canop_arr(i, j, 0) = (cp_vege_tot * t_canop_arr(i, j, 0) + tref_arr(i, j, 0) * precip * dt * 1.e-3 * cp_water) / (cp_vege_tot + precip * dt * 1.e-3 * cp_water);
            }
 
            // Note:
            // Assign appropriate "surface level" values for each land type, for the calculation
            //of surface turbulent fluxes
            //For baresoil,   surface level = soil surface
            //For vegetation, surface level = canopy level
            if (vegetype_arr(i, j, 0) == 1)
            {
                t_sfc_arr(i, j, 0) = t_cas_arr(i, j, 0);
                q_sfc_arr(i, j, 0) = q_cas_arr(i, j, 0);
            }
            else
            {
                t_sfc_arr(i, j, 0) = soilt_arr(i, j, d_khi_lsm);
                // Specific humidity at top soil
                if (soilt_arr(i, j, d_khi_lsm) > tfriz)
                {
                    erf_qsatw(soilt_arr(i, j, d_khi_lsm), pref_arr(i, j, 0), q_gr_arr(i, j, 0));
                    sdew_arr(i, j, 0) = one;
                    if (mws_arr(i, j, 0) == zero)
                    {
                        fh = fh_calc(soilt_arr(i, j, d_khi_lsm), m_pot_sat_arr(i, j, d_khi_lsm), soilw_arr(i, j, d_khi_lsm), Bconst_arr(i, j, d_khi_lsm));
                        if ( fh > 0.99)
                        {
                            sdew_arr(i, j, 0) = one;
                        }
                        else
                        {
                            sdew_arr(i, j, 0) = zero;
                        }
                        q_gr_arr(i, j, 0) *= fh;
                    }
                }
                else
                {
                    erf_qsati(soilt_arr(i, j, d_khi_lsm), pref_arr(i, j, 0), q_gr_arr(i, j, 0));
                    sdew_arr(i, j, 0) = one;
                }
                q_sfc_arr(i, j, 0) = q_gr_arr(i, j, 0);
            }
        });
 
        // Calculate turbulent transfer coeff between reference level and surface
        transfer_coeff(mfi);
 
        // Calculate aerodynamic resistances + stomatal resistance
        resistances(mfi);
 
        //Subcycle in time to avoid swings of canopy temperature
        // because of small heat capacity of vegetation in curtain places and seasons
        // Of course, the best would be to use implicit scheme, but for now,
        // subcycling seems like a good fix.
        //from gSAM-SLM
        fluxes_canopy(mfi); // compute both sHF and LHF of canopy
 
        solve_ground_skin_temperature(mfi);
 
        // Calculate soil moisture increment
        soil_water(mfi);
 
        // Advance the finite-volume soil using only the final skin-to-soil flux.
        soil_temperature(mfi);
 
        ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            if (landmask_arr(i, j, 0) != 1) {
                return;
            }
 
            amrex::Real q_gr_loc;
 
            // SAM rhow[nz] = air density at vertical velocity levels, kg/m^3
            amrex::Real rhow = dref_arr(i, j, 0); // TODO: double check this
            amrex::Real cond_heat, cond_href, cond_hcnp, cond_hundercnp;
            amrex::Real cond_vapor, cond_vref, cond_vcnp, cond_vundercnp;
            amrex::Real cvh = 2 * LAI_arr(i, j, 0) / r_b_arr(i, j, 0);
            if (vegetype_arr(i, j, 0) == 1) {
                // Compute diagnostic variables at canopy air space level
                //   Calculate heat conductances - non-zero only for canopy land type
                cond_heat = 1.0 / r_a_arr(i, j, 0) + cvh + 1.0 / r_d_arr(i, j, 0);
                cond_href = 1.0 / r_a_arr(i, j, 0) / cond_heat;
                cond_hcnp = cvh / cond_heat;
                cond_hundercnp = 1.0 / r_d_arr(i, j, 0) / cond_heat;
 
                //  Calculate vapor conductances
                cond_vapor = 1.0 / r_a_arr(i, j, 0) + wet_canop_arr(i, j, 0) * LAI_arr(i, j, 0) / r_b_arr(i, j, 0) + (1.0 - wet_canop_arr(i, j, 0)) * LAI_arr(i, j, 0) /(r_b_arr(i, j, 0) + r_c_arr(i, j, 0)) + 1.0 / (r_d_arr(i, j, 0) + r_soil_arr(i, j, 0) + r_litter);
                cond_vref = 1.0 / r_a_arr(i, j, 0) / cond_vapor;
                cond_vcnp = (wet_canop_arr(i, j, 0) * LAI_arr(i, j, 0) / r_b_arr(i, j, 0) / cond_vapor + (1.0 - wet_canop_arr(i, j, 0)) * LAI_arr(i, j, 0) / (r_b_arr(i, j, 0) + r_c_arr(i, j, 0)) / cond_vapor);
                cond_vundercnp = 1.0 / (r_d_arr(i, j, 0) + r_soil_arr(i, j, 0) + r_litter) / cond_vapor;
            }
            else
            {
                cond_heat = 1./r_a_arr(i, j, 0);
                cond_href = one;
                cond_hcnp = zero;
                cond_hundercnp = zero;
 
                cond_vapor = 1./(r_a_arr(i, j, 0) + r_soil_arr(i, j, 0));
                cond_vref = one;
                cond_vcnp = zero;
                cond_vundercnp = zero;
            }
 
            t_cas_arr(i, j, 0) = tref_arr(i, j, 0)*cond_href + t_canop_arr(i, j, 0)*cond_hcnp + t_ground_skin_arr(i, j, 0)*cond_hundercnp;
 
            amrex::Real qsat_canop;
            if (t_canop_arr(i, j, 0) >= tfriz)
            {
                erf_qsatw(t_canop_arr(i, j, 0), pref_arr(i, j, 0), qsat_canop);
            }
            else
            {
                erf_qsati(t_canop_arr(i, j, 0), pref_arr(i, j, 0), qsat_canop);
            }
 
            q_gr_loc = q_gr_arr(i, j, 0);
            q_cas_arr(i, j, 0) = qref_arr(i, j, 0) * cond_vref + qsat_canop*cond_vcnp + q_gr_loc*cond_vundercnp;
 
            // Output variables
            tveg_arr(i, j, 0) = t_canop_arr(i, j, 0);
            tveg_arr(i, j, d_khi_lsm) = t_canop_arr(i, j, 0);
            mveg_arr(i, j, 0) = mw_arr(i, j, 0);
            mveg_arr(i, j, d_khi_lsm) = mw_arr(i, j, 0);
            tsurf_arr(i, j, d_khi_lsm) = t_skin_arr(i, j, 0); // TODO: ts in SLM is input and output - check how this should be coupled back to ERF
            tsurf_arr(i, j, 0) = tsurf_arr(i, j, d_khi_lsm); // make sure this is set at k=0 for radiation coupling
            flbq_arr(i, j, d_khi_lsm) = evp_air_arr(i, j, 0) / rhow; // kg/kg m/s
            flbt_arr(i, j, d_khi_lsm) = shf_air_arr(i, j, 0) / (Cp_d*rhow); // Km/s
 
            qstar_arr(i, j, 0) = -1.0 * flbq_arr(i, j, d_khi_lsm) / ustar_arr(i, j, 0);
            qstar_arr(i, j, d_khi_lsm) = qstar_arr(i, j, 0);
 
            // These terms are multiplied by rho in SurfaceLayer
            fluxq_arr(i,j,0) = flbq_arr(i, j, d_khi_lsm);
            fluxt_arr(i,j,0) = flbt_arr(i, j, d_khi_lsm);
            tau13_arr(i,j,0) = flbu_arr(i, j, d_khi_lsm) / rhow;
            tau23_arr(i,j,0) = flbv_arr(i, j, d_khi_lsm) / rhow;
 
            amrex::Real tvm = getThgivenRandT(rhow, tref_arr(i,j,0), R_d / Cp_d, qref_arr(i,j,0)) * (1.0 + 0.61 * qref_arr(i,j,0));
            olen_arr(i,j,0) = -ustar_arr(i,j,0) * ustar_arr(i,j,0) * ustar_arr(i,j,0) * tvm / (KAPPA * CONST_GRAV * flbt_arr(i,j,d_khi_lsm));
 
        });
    }
 
    lsm_fab_vars[LsmVar_SLM::tsurf]->FillBoundary(m_geom.periodicity());
    lsm_fab_vars[LsmVar_SLM::ustar]->FillBoundary(m_geom.periodicity());
    lsm_fab_vars[LsmVar_SLM::tstar]->FillBoundary(m_geom.periodicity());
    lsm_fab_vars[LsmVar_SLM::qstar]->FillBoundary(m_geom.periodicity());
    lsm_fab_vars[LsmVar_SLM::flbu]->FillBoundary(m_geom.periodicity());
    lsm_fab_vars[LsmVar_SLM::flbv]->FillBoundary(m_geom.periodicity());
 
    // TODO: fix;
    lsm_fab_flux[LsmFlux_SLM::q_flux]->FillBoundary(m_geom.periodicity());
    lsm_fab_flux[LsmFlux_SLM::t_flux]->FillBoundary(m_geom.periodicity());
    lsm_fab_flux[LsmFlux_SLM::tau13]->FillBoundary(m_geom.periodicity());
    lsm_fab_flux[LsmFlux_SLM::tau23]->FillBoundary(m_geom.periodicity());
    lsm_fab_flux[LsmFlux_SLM::olen]->FillBoundary(m_geom.periodicity());
}

Referenced by Advance().

Here is the call graph for this function:

Here is the caller graph for this function:

albedo_noahmp()

void SLM::albedo_noahmp	(	const amrex::MFIter &	mfi,
		int	i,
		int	j,
		amrex::Real	dt,
		amrex::Real	cosz,
		amrex::Real	snowh,
		amrex::Real	fsno,
		amrex::Real	fwet,
		amrex::Real	sneqvo,
		amrex::Real	sneqv,
		amrex::Real	qsnow,
		amrex::Real	tg,
		amrex::Real	tv,
		amrex::Real	elai,
		amrex::Real	esai,
		const amrex::Real *	smc,
		int	nsoil,
		amrex::Real	fveg,
		amrex::Real &	albold,
		amrex::Real &	tauss,
		amrex::Real *	albgrd,
		amrex::Real *	albgri,
		amrex::Real *	albd,
		amrex::Real *	albi,
		amrex::Real *	fabd,
		amrex::Real *	fabi,
		amrex::Real *	ftdd,
		amrex::Real *	ftid,
		amrex::Real *	ftii,
		amrex::Real &	fsun,
		amrex::Real *	frevd,
		amrex::Real *	frevi,
		amrex::Real *	fregd,
		amrex::Real *	fregi,
		amrex::Real &	bgap,
		amrex::Real &	wgap,
		amrex::Real *	albsnd,
		amrex::Real *	albsni
	)

Copy_Lsm_to_State()

void SLM::Copy_Lsm_to_State ( amrex::MultiFab &  cons_in )

overridevirtual

Reimplemented from NullSurf.

{
    for ( amrex::MFIter mfi(cons_in,amrex::TilingIfNotGPU()); mfi.isValid(); ++mfi) {
        const auto& box3d = mfi.tilebox();
 
        // get potential total density, temperature, qt, qp
        ParallelFor( box3d, [=] AMREX_GPU_DEVICE (int /*i*/, int /*j*/, int /*k*/)
        {
            // TODO
            /*
            states_arr(i,j,k,RhoTheta_comp) = rho_arr(i,j,k)*theta_arr(i,j,k);
            states_arr(i,j,k,RhoQ1_comp)    = rho_arr(i,j,k)*qv_arr(i,j,k);
            states_arr(i,j,k,RhoQ2_comp)    = rho_arr(i,j,k)*qc_arr(i,j,k);
            states_arr(i,j,k,RhoQ3_comp)    = rho_arr(i,j,k)*qp_arr(i,j,k);
            */
        });
    }
 
    // Fill interior ghost cells and periodic boundaries
    cons_in.FillBoundary(m_geom.periodicity());
}

Referenced by Update_State_Vars().

Here is the call graph for this function:

Here is the caller graph for this function:

Copy_State_to_Lsm()

void SLM::Copy_State_to_Lsm ( const amrex::MultiFab &  cons_in, const amrex::MultiFab &  u_in, const amrex::MultiFab &  v_in  )

overridevirtual

Reimplemented from NullSurf.

{
    int khi = khi_lsm;
 
    auto tsurf = lsm_fab_vars[LsmVar_SLM::tsurf];
 
    // Get the temperature, density, pressure at the reference level
    for ( MFIter mfi(*tsurf, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box3d = mfi.tilebox();
 
        // Create a box with the same i,j bounds, but only at z = 0
        amrex::Box b2d = box3d;
        b2d.setRange(2, 0);
 
        auto states_array = cons_in.array(mfi);
        auto u_array = u_in.array(mfi);
        auto v_array = v_in.array(mfi);
 
        auto tref_array  = lsm_fab_vars[LsmVar_SLM::tref]->array(mfi);
        auto rho_array   = lsm_fab_vars[LsmVar_SLM::dref]->array(mfi);
        auto pres_array  = lsm_fab_vars[LsmVar_SLM::pref]->array(mfi);
        auto qref_array  = lsm_fab_vars[LsmVar_SLM::qref]->array(mfi);
        auto slm_u       = lsm_fab_vars[LsmVar_SLM::uref]->array(mfi);
        auto slm_v       = lsm_fab_vars[LsmVar_SLM::vref]->array(mfi);
 
        auto slm_dir_sw_vis  = lsm_fab_vars[LsmVar_SLM::swdsvisxyref]->array(mfi);
        auto slm_dir_sw_nir  = lsm_fab_vars[LsmVar_SLM::swdsnirxyref]->array(mfi);
        auto slm_diff_sw_vis = lsm_fab_vars[LsmVar_SLM::swdsvisdxyref]->array(mfi);
        auto slm_diff_sw_nir = lsm_fab_vars[LsmVar_SLM::swdsnirdxyref]->array(mfi);
        auto slm_lw          = lsm_fab_vars[LsmVar_SLM::lwref]->array(mfi);
        auto slm_zenith      = lsm_fab_vars[LsmVar_SLM::coszrsxy]->array(mfi);
 
        ParallelFor(b2d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
        {
            const Real qv = states_array(i,j,k,RhoQ1_comp)/states_array(i,j,k,Rho_comp);
            rho_array(i,j,k)   = states_array(i,j,k,Rho_comp);
            pres_array(i,j,k)  = getPgivenRTh(states_array(i,j,k,RhoTheta_comp), qv)/100.;
            tref_array(i,j,k)  = getTgivenRandRTh(states_array(i,j,k,Rho_comp),
                                                  states_array(i,j,k,RhoTheta_comp),
                                                  qv);
 
            qref_array(i,j,k) = qv;
 
            amrex::Real u_cc = myhalf * (u_array(i, j, k) + u_array(i + 1, j, k));
            amrex::Real v_cc = myhalf * (v_array(i, j, k) + v_array(i, j + 1, k));
            slm_u(i, j, k) = u_cc;
            slm_v(i, j, k) = v_cc;
 
            // TODO: this is for plotting purposes.. state arrays are at k=0 which is ghost cell for SLM values
            //  SLM AMREX plotfile does not write ghost cells, but NetCDF does - fix?
            rho_array(i, j, khi) = rho_array(i, j, 0);
            pres_array(i, j, khi) = pres_array(i, j, 0);
            tref_array(i, j, khi) = tref_array(i, j, 0);
            qref_array(i, j, khi) = qref_array(i, j, 0);
            slm_u(i, j, khi) = slm_u(i, j, 0);
            slm_v(i, j, khi) = slm_v(i, j, 0);
 
            slm_dir_sw_vis(i, j, khi) = slm_dir_sw_vis(i, j, 0);
            slm_dir_sw_nir(i, j, khi) = slm_dir_sw_nir(i, j, 0);
            slm_diff_sw_vis(i, j, khi) = slm_diff_sw_vis(i, j, 0);
            slm_diff_sw_nir(i, j, khi) = slm_diff_sw_nir(i, j, 0);
            slm_lw(i, j, khi) = slm_lw(i, j, 0);
            slm_zenith(i, j, khi) = slm_zenith(i, j, 0);
        });
    }
 
#ifdef ERF_USE_NETCDF
    if (rad_input_file != "")
    {
        int tindex = 0;
        int tindex_next = 0;
        for (int k = 1; k < num_rad_times; k++)
        {
            if (time > rad_times[k])
            {
                tindex = k;
            }
        }
 
        if (tindex == num_rad_times - 1)
        {
            tindex_next = tindex;
        } else {
            tindex_next = tindex + 1;
        }
 
        const amrex::Real t0 = rad_times[tindex];
        const amrex::Real t1 = rad_times[tindex_next];
 
        amrex::Print() << " SLM: time = " << time << ", interpolating fluxes at index " << tindex << " (t0 = " << t0 << " t1 = " << t1 << ")" << std::endl;
 
        const amrex::Real d_time = time;
        for ( MFIter mfi(rad_input_data); mfi.isValid(); ++mfi) {
            const auto& box3d = mfi.tilebox();
 
            // Create a box with the same i,j bounds, but only at z = 0
            amrex::Box b2d = box3d;
            b2d.setRange(2, 0);
 
            auto rad_arr = rad_input_data.const_array(mfi);
 
            auto slm_dir_sw_vis  = lsm_fab_vars[LsmVar_SLM::swdsvisxyref]->array(mfi);
            auto slm_dir_sw_nir  = lsm_fab_vars[LsmVar_SLM::swdsnirxyref]->array(mfi);
            auto slm_diff_sw_vis = lsm_fab_vars[LsmVar_SLM::swdsvisdxyref]->array(mfi);
            auto slm_diff_sw_nir = lsm_fab_vars[LsmVar_SLM::swdsnirdxyref]->array(mfi);
 
            auto slm_lw          = lsm_fab_vars[LsmVar_SLM::lwref]->array(mfi);
            auto slm_zenith      = lsm_fab_vars[LsmVar_SLM::coszrsxy]->array(mfi);
 
            ParallelFor(b2d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
            {
                slm_dir_sw_vis(i, j, k) = linear_interp(t0, t1, d_time, rad_arr(i, j, tindex, 0), rad_arr(i, j, tindex_next, 0));
                slm_dir_sw_nir(i, j, k) = linear_interp(t0, t1, d_time, rad_arr(i, j, tindex, 1), rad_arr(i, j, tindex_next, 1));
 
                slm_diff_sw_vis(i, j, k) = linear_interp(t0, t1, d_time, rad_arr(i, j, tindex, 2), rad_arr(i, j, tindex_next, 2));
                slm_diff_sw_nir(i, j, k) = linear_interp(t0, t1, d_time, rad_arr(i, j, tindex, 3), rad_arr(i, j, tindex_next, 3));
 
                slm_zenith(i, j, k) = linear_interp(t0, t1, d_time, rad_arr(i, j, tindex, 4), rad_arr(i, j, tindex_next, 4));
                slm_lw(i, j, k) = linear_interp(t0, t1, d_time, rad_arr(i, j, tindex, 5), rad_arr(i, j, tindex_next, 5));
 
 
                // TODO: this is for plotting purposes.. state arrays are at k=0 which is ghost cell for SLM values
                //  SLM AMREX plotfile does not write ghost cells, but NetCDF does - fix?
                slm_dir_sw_vis(i, j, khi) = slm_dir_sw_vis(i, j, 0);
                slm_dir_sw_nir(i, j, khi) = slm_dir_sw_nir(i, j, 0);
                slm_diff_sw_vis(i, j, khi) = slm_diff_sw_vis(i, j, 0);
                slm_diff_sw_nir(i, j, khi) = slm_diff_sw_nir(i, j, 0);
                slm_lw(i, j, khi) = slm_lw(i, j, 0);
                slm_zenith(i, j, khi) = slm_zenith(i, j, 0);
            });
        }
        return;
    }
#endif
}

Referenced by Update_Lsm_Vars().

Here is the call graph for this function:

Here is the caller graph for this function:

Define()

void SLM::Define ( SolverChoice &  sc )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        // SLM exchanges water vapor with the atmosphere unconditionally: Copy_State_to_Lsm
        // reads RhoQ1_comp out of the state and Copy_Lsm_to_State writes it back.  Without a
        // moisture model that component is not part of the state, so those accesses run off
        // the end of the conserved-variable FAB.
        AMREX_ALWAYS_ASSERT_WITH_MESSAGE(
            sc.moisture_type != MoistureType::None,
            "The SLM land surface model requires a moisture model: it exchanges water vapor "
            "with the atmospheric state, which has no RhoQ1 component when "
            "erf.moisture_model = None.  Set erf.moisture_model, "
            "or choose a different erf.land_surface_model.");
 
        use_terrain = sc.terrain_type != TerrainType::None;
 
        // Check if initializing from WRFInput
        if (sc.init_type == InitType::WRFInput) {
            amrex::Print() << " SLM is initializing from WRFInput!" << std::endl;
            use_wrfinput = true;
        } else {
            use_wrfinput = false;
        }
    }

Here is the call graph for this function:

export_to_RRTMGP()

const amrex::Vector<const amrex::MultiFab*>& SLM::export_to_RRTMGP ( )

inline

    {
        return slm_to_rad_vars;
    }

fh_calc()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE amrex::Real SLM::fh_calc ( const amrex::Real &  t, const amrex::Real &  mps, const amrex::Real &  sw, const amrex::Real &  B  )

static

{
    amrex::Real moist_pot1 = std::max(amrex::Real(-100000.0), mps / (std::pow(std::max(amrex::Real(0.0001), sw), B)) / amrex::Real(1000.0));
    return std::min(amrex::Real(one), std::exp(moist_pot1*CONST_GRAV/amrex::Real(461.0)/t));
}

fluxes_canopy()

void SLM::fluxes_canopy

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const int d_nz_lsm = m_nz_lsm;
    const Real dt = m_dt;
    const int niter = std::max(1, static_cast<int>(std::round(dt)));
    const Real dt_iter = dt/niter;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
 
    auto LAI_arr = LAI.const_array(mfi);
 
    auto t_sfc_arr = t_sfc.const_array(mfi);
    auto q_sfc_arr = q_sfc.const_array(mfi);
 
    auto soilw_arr            = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
    auto poro_soil_arr        = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
    auto s_depth_arr          = lsm_fab_vars[LsmVar_SLM::s_depth]->const_array(mfi);
    auto soil_transp_frac_arr = lsm_fab_vars[LsmVar_SLM::soil_transp_frac]->const_array(mfi);
    auto w_s_WP_arr         = lsm_fab_vars[LsmVar_SLM::w_s_WP]->const_array(mfi);
    auto pref_arr             = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
 
    auto lhf_canop_arr = lhf_canop.array(mfi);
    auto evp_canop_arr = evp_canop.array(mfi);
    auto shf_canop_arr = shf_canop.array(mfi);
 
    auto vegetype_arr = vegetype.const_array(mfi);
    auto vege_YES_arr = vege_YES.const_array(mfi);
 
    auto mw_arr = mw.array(mfi);
    auto mw_mx_arr = mw_mx.const_array(mfi);
    auto mw_inc_arr = mw_inc.array(mfi);
    auto cp_vege_arr = cp_vege.const_array(mfi);
 
    auto dref_arr = lsm_fab_vars[LsmVar_SLM::dref]->const_array(mfi);
    auto tr_arr = lsm_fab_vars[LsmVar_SLM::tref]->const_array(mfi);
    auto t_canop_arr = t_canop.array(mfi);
 
    auto r_b_arr = r_b.const_array(mfi);
    auto r_c_arr = r_c.const_array(mfi);
 
    auto wet_canop_arr = wet_canop.array(mfi);
    auto evapo_dry_arr = evapo_dry.array(mfi);
 
    auto slm_diag_arr = slm_diag.array(mfi);
 
    auto net_rad_arr = net_rad.const_array(mfi);
 
    auto prsfc_arr  = lsm_fab_vars[LsmVar_SLM::prsfc]->array(mfi);
 
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
        amrex::Real evapo_wet_loc;
 
        if (vegetype_arr(i, j, 0) == 1)
        {
            amrex::Real shf0 = zero;
            amrex::Real lhf0 = zero;
            amrex::Real evp0 = zero;
            amrex::Real evapo_wet0 = zero;
            amrex::Real drain0 = zero;
            // SAM rhow[nz] = air density at vertical velocity levels, kg/m^3
            const amrex::Real rhow = dref_arr(i, j, 0); // TODO: double check this
            amrex::Real qsat_canop;
            amrex::Real cp_vege_tot, t_canop_inc;
 
            for (int iter = 0; iter < niter; iter++)
            {
                shf_canop_arr(i, j, 0) = (t_canop_arr(i, j, 0) - t_sfc_arr(i, j, 0)) * rhow * cp * two * LAI_arr(i, j, 0) / r_b_arr(i, j, 0);
                shf0 += shf_canop_arr(i, j, 0);
 
                // Evaporation from canopy
                // only treat the case where t_canop_arr > tfriz;
                AMREX_ALWAYS_ASSERT(t_canop_arr(i, j, 0) > tfriz);
 
                erf_qsatw(t_canop_arr(i, j, 0), pref_arr(i, j, 0), qsat_canop);
 
                // direct evaporation from the water held on canopy
                // evaporation/dew only possible if canopy temperature is above freezing
                evapo_wet_loc = std::min(mw_arr(i, j, 0)/dt_iter, ((qsat_canop - q_sfc_arr(i, j, 0)) * rhow * LAI_arr(i, j, 0) / (r_b_arr(i, j, 0))*vege_YES_arr(i, j, 0)));
 
                // increment/decrement of the water amount held on leaves following the direct evaporation/dew formation
                const amrex::Real mw_evap_inc = -dt_iter * evapo_wet_loc; // evapo_wet_loc [kg/m2s=mm/s]
                mw_inc_arr(i, j, 0) += mw_evap_inc;
                mw_arr(i, j, 0) += mw_evap_inc;
                wet_canop_arr(i, j, 0) = std::min(amrex::Real(one), mw_arr(i, j, 0)/mw_mx_arr(i, j, 0));
 
                // Transpiration - only occurs when qsat_canop > qsfc
                evapo_dry_arr(i, j, 0) = std::max(amrex::Real(zero),(qsat_canop - q_sfc_arr(i, j, 0))*rhow*(one - wet_canop_arr(i, j, 0))*LAI_arr(i, j, 0)/(r_b_arr(i, j, 0) + r_c_arr(i, j, 0))*vege_YES_arr(i, j, 0));
                if (evapo_dry_arr(i, j, 0) > zero) {
                    amrex::Real max_transpiration = 1.0e30;
                    bool has_transpiration_source = false;
                    for (int k = 0; k < d_nz_lsm; k++) {
                        const int lsm_k = d_khi_lsm - k;
                        const amrex::Real transp_frac = std::max(amrex::Real(zero), soil_transp_frac_arr(i, j, lsm_k));
                        if (transp_frac > zero) {
                            has_transpiration_source = true;
                            const amrex::Real available_water =
                                std::max(amrex::Real(zero), soilw_arr(i, j, lsm_k) - w_s_WP_arr(i, j, lsm_k)) *
                                poro_soil_arr(i, j, lsm_k) *
                                s_depth_arr(i, j, lsm_k) * 1.0e3;
                            max_transpiration = std::min(max_transpiration, available_water / (transp_frac * dt));
                        }
                    }
                    evapo_dry_arr(i, j, 0) = has_transpiration_source
                        ? std::min(evapo_dry_arr(i, j, 0), max_transpiration)
                        : 0.0;
                }
 
                // Convert evaporation (kg/m2/s) to latent heat flux (W/m2)
                lhf_canop_arr(i, j, 0) = lcond*(evapo_wet_loc+evapo_dry_arr(i, j, 0));
                evp_canop_arr(i, j, 0) = evapo_wet_loc + evapo_dry_arr(i, j, 0);
                lhf0 += lhf_canop_arr(i, j, 0);
                evp0 += evp_canop_arr(i, j, 0);
                evapo_wet0 += evapo_wet_loc;
 
                // Update vegetation moisture storage
                if (mw_arr(i, j, 0) > mw_mx_arr(i, j, 0))
                {
                    const amrex::Real canopy_drain = (mw_arr(i, j, 0) - mw_mx_arr(i, j, 0)) / dt_iter;
                    drain0 += canopy_drain; // dripping excess of dew
                    mw_inc_arr(i, j, 0) -= dt_iter * canopy_drain;
                    mw_arr(i, j, 0) = mw_mx_arr(i, j, 0);
                }
 
                // Update vegetation temperature
                cp_vege_tot = cp_vege_arr(i, j, 0) + mw_arr(i, j, 0) * 1.e-3 * cp_water;
                t_canop_inc = dt_iter / std::max(amrex::Real(1.0e-3), cp_vege_tot)*(net_rad_arr(i, j, 0, SLM_NetRad::net_rad1) - shf_canop_arr(i, j, 0) - lhf_canop_arr(i, j, 0)) * vege_YES_arr(i, j, 0);
                t_canop_arr(i, j, 0) = std::min(amrex::Real(t_canop_max), t_canop_arr(i, j, 0) + t_canop_inc);
            }
            shf_canop_arr(i, j, 0) = shf0 / static_cast<amrex::Real>(niter);
            lhf_canop_arr(i, j, 0) = lhf0 / static_cast<amrex::Real>(niter);
            evp_canop_arr(i, j, 0) = evp0 / static_cast<amrex::Real>(niter);
            prsfc_arr(i, j, 0) += (drain0 / static_cast<amrex::Real>(niter));
            slm_diag_arr(i, j, 0, SLM_Diag::precip_sfc) = prsfc_arr(i, j, 0);
            slm_diag_arr(i, j, 0, SLM_Diag::evapo_wet) = evapo_wet0 / static_cast<amrex::Real>(niter);
            slm_diag_arr(i, j, 0, SLM_Diag::drain) += (drain0/static_cast<amrex::Real>(niter));
        }
        else
        {
            shf_canop_arr(i, j, 0) = zero;
            lhf_canop_arr(i, j, 0) = zero;
            evp_canop_arr(i, j, 0) = zero;
            wet_canop_arr(i, j, 0) = zero;
            mw_arr(i, j, 0) = zero;
            evapo_wet_loc = zero;
            evapo_dry_arr(i, j, 0) = zero;
            t_canop_arr(i, j, 0) = tr_arr(i, j, 0);
        }
    });
}

Here is the call graph for this function:

get_rad_output_map()

std::unordered_map<std::string, std::string>& SLM::get_rad_output_map ( )

inline

    {
        return rad_output_map;
    }

Get_Update_Status()

bool SLM::Get_Update_Status ( )

inlineoverridevirtual

Reimplemented from NullSurf.

{ return m_updated; }

GotoNextLine()

void SLM::GotoNextLine ( std::istream &  is )

static

{
    constexpr std::streamsize bl_ignore_max { 100000 };
    is.ignore(bl_ignore_max, '\n');
}

groundalb_noahmp()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE void SLM::groundalb_noahmp ( int  nsoil, int  nband, int  ice, int  ist, amrex::Real  fsno, const amrex::Real *  smc, const amrex::Real *  albsnd, const amrex::Real *  albsni, amrex::Real  cosz, amrex::Real  tg, const amrex::Real *  albsat, const amrex::Real *  albdry, const amrex::Real *  alblak, amrex::Real *  albgrd, amrex::Real *  albgri  )

static

{
    // --------------------------------------------------------------------------------------------------
    //input
    //  ILOC   !grid index
    //  JLOC   !grid index
    //  NSOIL  !number of soil layers
    //  NBAND  !number of solar radiation waveband classes
    //  ICE    !value of ist for land ice
    //  IST    !surface type
    //  FSNO   !fraction of surface covered with snow (-)
    //  TG     !ground temperature (k)
    //  COSZ   !cosine solar zenith angle (0-1)
    //  SMC    !volumetric soil water content (m3/m3)
    //  ALBSND !direct beam snow albedo (vis, nir)
    //  ALBSNI !diffuse snow albedo (vis, nir)
 
    //output
    //  ALBGRD !ground albedo (direct beam: vis, nir)
    //  ALBGRI !ground albedo (diffuse: vis, nir)
 
    //local
    amrex::Real inc;    //soil water correction factor for soil albedo
    amrex::Real albsod; //soil albedo (direct)
    amrex::Real albsoi; //soil albedo (diffuse)
    // --------------------------------------------------------------------------------------------------
    constexpr amrex::Real TFRZ = 273.16; // freezing/melting point (k)
 
    for (int ib = 0; ib < nband; ib++) {
        inc = std::max(amrex::Real(0.11) - amrex::Real(0.40)*smc[0], amrex::Real(zero));
        if (ist == 1) {                     //soil
            albsod = std::min(albsat[ib]+inc, albdry[ib]);
            albsoi = albsod;
        } else if (tg > TFRZ) {               //unfrozen lake, wetland
            albsod = 0.06/(std::max(amrex::Real(0.01),cosz)*std::max(amrex::Real(0.01),cosz)*std::max(amrex::Real(0.01),cosz)*
                           std::max(amrex::Real(0.01),cosz)*std::max(amrex::Real(0.01),cosz)*std::max(amrex::Real(0.01),cosz)*
                           std::max(amrex::Real(0.01),cosz) + 0.15);
            albsoi = 0.06;
        } else {                                      //frozen lake, wetland
            albsod = alblak[ib];
            albsoi = albsod;
        }
 
        albgrd[ib] = albsod*(1.0-fsno) + albsnd[ib]*fsno;
        albgri[ib] = albsoi*(1.0-fsno) + albsni[ib]*fsno;
    }
}

Init() [1/3]

virtual void NullSurf::Init

inline

                                                       { }

Init() [2/3]

void SLM::Init ( const int &  , const amrex::MultiFab &  cons_in, const amrex::MultiFab &  u_in, const amrex::MultiFab &  v_in, const amrex::Geometry &  geom, const amrex::Geometry &  geom0, amrex::Vector< amrex::BCRec > &  domain_bcs_type, amrex::IntVect &  refRatio, const amrex::Real &  dt, std::unique_ptr< amrex::MultiFab > &  z_phys_nd_in, amrex::Vector< amrex::Vector< std::string >> &  nc_init_file  )

overridevirtual

Reimplemented from NullSurf.

{
    m_dt = dt;
    m_geom = geom;
    m_geom0 = geom0;
    m_domain_bcs_type = domain_bcs_type;
    z_phys_nd = z_phys_nd_in.get();
 
    ParmParse pp("slm");
    pp.query("nsoil", m_nz_lsm);
    if (m_nz_lsm < 2) {
        amrex::Abort("SLM: nsoil must be at least 2");
    }
    pp.queryarr("soil_dz", m_dz_lsm);
    AMREX_ALWAYS_ASSERT_WITH_MESSAGE(
      static_cast<int>(m_dz_lsm.size()) == m_nz_lsm,
      "Provided soil thicknesses most match number of soil layers");
    AMREX_ALWAYS_ASSERT(static_cast<int>(m_dz_lsm.size()) > 0);
    for (int k = 0; k < static_cast<int>(m_dz_lsm.size()); ++k) {
        if (!std::isfinite(m_dz_lsm[k]) || m_dz_lsm[k] <= zero) {
            amrex::Abort("SLM: soil_dz values must be finite and positive");
        }
    }
 
    Box domain = geom.Domain();
    khi_lsm    = domain.smallEnd(2) - 1; // index of z_r
    klo_lsm    = khi_lsm - m_nz_lsm + 1;
 
    LsmDataMap.resize(m_lsm_data_size);
    LsmDataMap = {
      LsmVar_SLM::tsurf,         LsmVar_SLM::ustar,        LsmVar_SLM::tstar,       LsmVar_SLM::qstar,
      LsmVar_SLM::tv,            LsmVar_SLM::mv,           LsmVar_SLM::soilt,       LsmVar_SLM::soilw,
      LsmVar_SLM::sand,          LsmVar_SLM::clay,         LsmVar_SLM::s_depth,
      LsmVar_SLM::flbu,          LsmVar_SLM::flbv,         LsmVar_SLM::flbq,
      LsmVar_SLM::flbt,          LsmVar_SLM::prsfc,        LsmVar_SLM::precipref,
      LsmVar_SLM::swdsvisxyref,  LsmVar_SLM::swdsnirxyref, LsmVar_SLM::swdsvisdxyref,
      LsmVar_SLM::swdsnirdxyref, LsmVar_SLM::lwref,        LsmVar_SLM::coszrsxy, LsmVar_SLM::tref,
      LsmVar_SLM::uref,          LsmVar_SLM::vref,         LsmVar_SLM::dref,
      LsmVar_SLM::qref,          LsmVar_SLM::pref,         LsmVar_SLM::node_z,
      LsmVar_SLM::soilt_nudge,   LsmVar_SLM::soilw_nudge,  LsmVar_SLM::lai,
      LsmVar_SLM::vegtype,       LsmVar_SLM::soiltype,     LsmVar_SLM::veg_frac, LsmVar_SLM::veg_frac_min, LsmVar_SLM::veg_frac_max,
      LsmVar_SLM::emis_sfc,      LsmVar_SLM::alb_nir_sfc,  LsmVar_SLM::alb_vis_sfc,
      LsmVar_SLM::alb_nir_sfc_diff, LsmVar_SLM::alb_vis_sfc_diff,
      LsmVar_SLM::soil_transp_frac};
 
    LsmDataName.resize(m_lsm_data_size);
    LsmDataName = {"tsurf",         "ustar",          "tstar",
                  "qstar",         "tveg",           "mv",
                  "tsoil",         "wsoil",          "sand",
                  "clay",          "soil_thickness", "surface_u",
                  "surface_v",     "surface_vapor",  "surface_heat",
                  "precip_soil",   "ref_precip",     "SW_dw_dir_vis",
                  "SW_dw_dir_nir", "SW_dw_dif_vis",  "SW_dw_dif_nir",
                  "LW_dw",         "cos_zenith",     "ref_t",          "ref_u",
                  "ref_v",         "ref_d",          "ref_q",
                  "ref_p",         "node_z",         "soilt_nudge",
                  "soilw_nudge",   "lai",            "vegtype",
                  "soiltype",      "veg_frac", "veg_frac_min", "veg_frac_max", "emis_sfc",
                  "alb_nir_sfc",   "alb_vis_sfc", "alb_nir_sfc_diff", "alb_vis_sfc_diff",
                  "soil_transp_frac"};
 
    AMREX_ALWAYS_ASSERT(LsmDataMap.size() == LsmDataName.size());
    AMREX_ALWAYS_ASSERT(static_cast<int>(LsmDataMap.size()) == m_lsm_data_size);
 
    LsmFluxMap.resize(m_lsm_flux_size);
    LsmFluxMap = {LsmFlux_SLM::t_flux, LsmFlux_SLM::q_flux, LsmFlux_SLM::tau13, LsmFlux_SLM::tau23, LsmFlux_SLM::olen};
 
    LsmFluxName.resize(m_lsm_flux_size);
    LsmFluxName = {"t_flux", "q_flux", "tau13", "tau23", "olen"};
 
    AMREX_ALWAYS_ASSERT(LsmFluxMap.size() == LsmFluxName.size());
    AMREX_ALWAYS_ASSERT(static_cast<int>(LsmFluxMap.size()) == m_lsm_flux_size);
 
    // NOTE: All boxes in ba extend from zlo to zhi, so this transform is valid.
    //       If that were to change, the dm and new ba are no longer valid and
    //       direct copying between lsm data/flux vars cannot be done in a parfor.
 
    // Set box array for lsm data
    IntVect ng(1,1,1);
    BoxArray ba = cons_in.boxArray();
    DistributionMapping dm = cons_in.DistributionMap();
    BoxList bl_lsm = ba.boxList();
    for (auto& b : bl_lsm) {
        b.setBig(2, khi_lsm);                  // First point below the surface
        b.setSmall(2, klo_lsm);                // Last point below the surface
    }
    BoxArray ba_lsm(std::move(bl_lsm));
 
    // Set up lsm geometry
    const RealBox& dom_rb = m_geom.ProbDomain();
    RealBox lsm_rb = dom_rb;
    Real lsm_z_hi = dom_rb.lo(2); // z_r
    Real lsm_z_lo = lsm_z_hi;
    for (int k = 0; k < m_nz_lsm; k++)
    {
        lsm_z_lo -= m_dz_lsm[k];
    }
    lsm_rb.setHi(2,lsm_z_hi); lsm_rb.setLo(2,lsm_z_lo);
 
    amrex::Box lsm_dom = m_geom.Domain();
    lsm_dom.setSmall(2, klo_lsm);
    lsm_dom.setBig(2, khi_lsm);
    m_lsm_geom.define(lsm_dom, lsm_rb, m_geom.Coord(), m_geom.isPeriodic());
 
    const RealBox& dom_rb0 = m_geom0.ProbDomain();
    RealBox lsm_rb0 = dom_rb0;
    Real lsm_z_hi0 = dom_rb0.lo(2);
    Real lsm_z_lo0 = lsm_z_hi0;
    for (int k = 0; k < m_nz_lsm; ++k) {
        lsm_z_lo0 -= m_dz_lsm[k];
    }
    lsm_rb0.setHi(2, lsm_z_hi0);
    lsm_rb0.setLo(2, lsm_z_lo0);
 
    Box lsm_dom0 = m_geom0.Domain();
    const int khi_lsm0 = lsm_dom0.smallEnd(2) - 1;
    const int klo_lsm0 = khi_lsm0 - m_nz_lsm + 1;
    lsm_dom0.setSmall(2, klo_lsm0);
    lsm_dom0.setBig(2, khi_lsm0);
    m_lsm_geom0.define(lsm_dom0, lsm_rb0, m_geom0.Coord(), m_geom0.isPeriodic());
 
    BoxList bl_lsm_2d = ba_lsm.boxList();
    for (auto& b : bl_lsm_2d) {
        b.setRange(2, 0, 1);
    }
    ba_lsm_2d = BoxArray(std::move(bl_lsm_2d));
    IntVect ng_2d(0, 0, 0);
 
    // Create the data
    for (auto ivar = 0; ivar < LsmVar_SLM::NumVars; ++ivar) {
        // State vars are CC
        lsm_fab_vars[ivar] = std::make_shared<MultiFab>(ba_lsm, dm, 1, ng);
        lsm_fab_vars[ivar]->setVal(zero);
    }
 
    // Create the fluxes
    for (auto ivar = 0; ivar < LsmFlux_SLM::NumVars; ++ivar) {
        // NOTE: Fluxes are CC with ghost cells for averaging
        lsm_fab_flux[ivar] = std::make_shared<MultiFab>(ba_lsm_2d, dm, 1, IntVect(1,1,0));
        lsm_fab_flux[ivar]->setVal(zero);
    }
 
    // build list for checkpointing extra variables not mapped to ERF in lsm_fab_vars
    unmapped_fields.clear();
    for (int i = 0; i < LsmVar_SLM::NumVars; i++) {
        int found = 0;
        for (int j = 0; j < m_lsm_data_size; j++) {
            if (LsmDataMap[j] == i) {
                found = 1;
                break;
            }
        }
        if (!found) {
            unmapped_fields.push_back(i);
        }
    }
 
    // Initial olen to neutral condition
    lsm_fab_flux[LsmFlux_SLM::olen]->setVal(1.0E34);
 
    // packed temporary 1D arrays in soil water and soil temperature
    soilt_vars.define(ba_lsm, dm, SLM_DST::NumVars, 0);
    soilw_vars.define(ba_lsm, dm, SLM_DSW::NumVars, 0);
    soilt_vars.setVal(zero);
    soilw_vars.setVal(zero);
 
    // Create local 2D data
    // TODO: Placeholder landmask array - fix!
    landmask.define(ba_lsm_2d, dm, 1, ng_2d);
    landmask.setVal(1);
 
    landtype.define(ba_lsm_2d, dm, 1, ng_2d);
    nroot.define(ba_lsm_2d, dm, 1, ng_2d);
    LAI.define(ba_lsm_2d, dm, 1, ng_2d);
    SAI.define(ba_lsm_2d, dm, 1, ng_2d);
    sstxy.define(ba_lsm_2d, dm, 1, ng_2d);
 
    t_canop.define(ba_lsm_2d, dm, 1, ng_2d);
    mw.define(ba_lsm_2d, dm, 1, ng_2d);
    mws.define(ba_lsm_2d, dm, 1, ng_2d);
    t_skin.define(ba_lsm_2d, dm, 1, ng_2d);
    t_ground_skin.define(ba_lsm_2d, dm, 1, ng_2d);
    t_cas.define(ba_lsm_2d, dm, 1, ng_2d);
    q_cas.define(ba_lsm_2d, dm, 1, ng_2d);
 
    t_sfc.define(ba_lsm_2d, dm, 1, ng_2d);
    q_sfc.define(ba_lsm_2d, dm, 1, ng_2d);
 
    q_gr.define(ba_lsm_2d, dm, 1, ng_2d);
    sdew.define(ba_lsm_2d, dm, 1, ng_2d);
 
    // NOAHMP radiation state variables
    albold_noahmp.define(ba_lsm_2d, dm, 1, ng_2d);
    tauss_noahmp.define(ba_lsm_2d, dm, 1, ng_2d);
 
    vegetype.define(ba_lsm_2d, dm, 1, ng_2d);
    vege_YES.define(ba_lsm_2d, dm, 1, ng_2d);
    cp_vege.define(ba_lsm_2d, dm, 1, ng_2d);
    cbiom.define(ba_lsm_2d, dm, 1, ng_2d);
    dleaf.define(ba_lsm_2d, dm, 1, ng_2d);
    z0_sfc.define(ba_lsm_2d, dm, 1, ng_2d);
    Khai_L.define(ba_lsm_2d, dm, 1, ng_2d);
    phi_1.define(ba_lsm_2d, dm, 1, ng_2d);
    phi_2.define(ba_lsm_2d, dm, 1, ng_2d);
    IR_emis_vege.define(ba_lsm_2d, dm, 1, ng_2d);
    IR_emis_soil.define(ba_lsm_2d, dm, 1, ng_2d);
    IR_emis_grnd.define(ba_lsm_2d, dm, 1, ng_2d);
    ztop.define(ba_lsm_2d, dm, 1, ng_2d);
    disp_hgt.define(ba_lsm_2d, dm, 1, ng_2d);
    Rgl.define(ba_lsm_2d, dm, 1, ng_2d);
    Rc_min.define(ba_lsm_2d, dm, 1, ng_2d);
    hs_rc.define(ba_lsm_2d, dm, 1, ng_2d);
    precip_extinc.define(ba_lsm_2d, dm, 1, ng_2d);
    mw_mx.define(ba_lsm_2d, dm, 1, ng_2d);
    mws_mx.define(ba_lsm_2d, dm, 1, ng_2d);
    BAI.define(ba_lsm_2d, dm, 1, ng_2d);
    IMPERV.define(ba_lsm_2d, dm, 1, ng_2d);
 
    cp_vege.setVal(zero);
    cbiom.setVal(0.02);
    dleaf.setVal(0.04);
    z0_sfc.setVal(zero);
    Khai_L.setVal(zero);
    phi_1.setVal(zero);
    phi_2.setVal(zero);
    ztop.setVal(zero);
    disp_hgt.setVal(zero);
    Rgl.setVal(zero);
    Rc_min.setVal(zero);
    hs_rc.setVal(zero);
    precip_extinc.setVal(zero);
    mw_mx.setVal(zero);
    mws_mx.setVal(zero);
    BAI.setVal(zero);
    IMPERV.setVal(zero);
 
    mw_inc.define(ba_lsm_2d, dm, 1, ng_2d);
 
    evapo_dry.define(ba_lsm_2d, dm, 1, ng_2d);
 
    shf_canop.define(ba_lsm_2d, dm, 1, ng_2d);
    shf_soil.define(ba_lsm_2d, dm, 1, ng_2d);
    shf_air.define(ba_lsm_2d, dm, 1, ng_2d);
    lhf_canop.define(ba_lsm_2d, dm, 1, ng_2d);
    lhf_soil.define(ba_lsm_2d, dm, 1, ng_2d);
    lhf_air.define(ba_lsm_2d, dm, 1, ng_2d);
    evp_canop.define(ba_lsm_2d, dm, 1, ng_2d);
    evp_soil.define(ba_lsm_2d, dm, 1, ng_2d);
    evp_air.define(ba_lsm_2d, dm, 1, ng_2d);
 
    albedovis_v.define(ba_lsm_2d, dm, 1, ng_2d);
    albedonir_v.define(ba_lsm_2d, dm, 1, ng_2d);
    albedovis_s.define(ba_lsm_2d, dm, 1, ng_2d);
    albedonir_s.define(ba_lsm_2d, dm, 1, ng_2d);
    albedovis_v.setVal(zero);
    albedovis_s.setVal(zero);
    albedonir_v.setVal(zero);
    albedonir_s.setVal(zero);
    IR_emis_vege.setVal(zero);
    IR_emis_soil.setVal(0.98);
    IR_emis_grnd.setVal(zero);
    vege_YES.setVal(zero);
 
    r_a.define(ba_lsm_2d, dm, 1, ng_2d);
    r_b.define(ba_lsm_2d, dm, 1, ng_2d);
    r_c.define(ba_lsm_2d, dm, 1, ng_2d);
    r_d.define(ba_lsm_2d, dm, 1, ng_2d);
    r_soil.define(ba_lsm_2d, dm, 1, ng_2d);
 
    net_rad.define(ba_lsm_2d, dm, SLM_NetRad::NumVars, ng_2d);
    wet_canop.define(ba_lsm_2d, dm, 1, ng_2d);
 
    slm_diag.define(ba_lsm_2d, dm, SLM_Diag::NumVars, ng_2d);
    slm_diag.setVal(zero);
 
    zrefxy.define(ba_lsm_2d, dm, 1, ng_2d);
    zrefxy.setVal(zero);
 
    r_soil.setVal(zero);
    lhf_air.setVal(zero);
    lhf_canop.setVal(zero);
    shf_air.setVal(zero);
    shf_canop.setVal(zero);
    evp_air.setVal(zero);
    evp_canop.setVal(zero);
    evp_soil.setVal(zero);
 
    t_canop.setVal(zero);
    t_cas.setVal(zero);
    t_skin.setVal(zero);
    t_ground_skin.setVal(zero);
    q_cas.setVal(zero);
 
    t_sfc.setVal(zero);
    q_sfc.setVal(zero);
    q_gr.setVal(zero);
    sdew.setVal(zero);
    wet_canop.setVal(zero);
 
    mw.setVal(zero);
    mws.setVal(zero);
    mw_inc.setVal(zero);
    evapo_dry.setVal(zero);
 
    r_a.setVal(zero);
    r_b.setVal(zero);
    r_c.setVal(zero);
    r_d.setVal(zero);
    r_soil.setVal(zero);
    lsm_fab_vars[LsmVar_SLM::ustar]->setVal(0.1);
    lsm_fab_vars[LsmVar_SLM::tstar]->setVal(zero);
    lsm_fab_vars[LsmVar_SLM::qstar]->setVal(zero);
 
    // Initialize SLM from inputs (for idealized cases, if specified), and load any other parameters
    init_from_inputs();
 
    if (!use_wrfinput) {
        // Supply a valid default category when no external soil category is available.
        lsm_fab_vars[LsmVar_SLM::soiltype]->setVal(one);
    }
 
    landtype.setVal(landtype0);
    nroot.setVal(m_nz_lsm);
    LAI.setVal(LAI0);
    SAI.setVal(zero);
    sstxy.setVal(zero);
    mws_mx.setVal(mws_mx0);
 
    net_rad.setVal(zero);
 
    // Initialize NOAHMP radiation state variables
    albold_noahmp.setVal(0.65);  // initial snow albedo
    tauss_noahmp.setVal(zero);    // initial snow age
 
    // Set a default vegetation fraction of 1.0.
    // Cells without vegetation (baresoil, urban) are set to 0.0 later on
    // If using WRFInput, this fraction will be overwritten with those values
    lsm_fab_vars[LsmVar_SLM::veg_frac]->setVal(one);
 
    if (!use_wrfinput) {
        // Initialize here if not using wrfinput, otherwise it is done at first time step
        slm_init();
    }
 
    // Following Noah-MP, zref is modified to become ztop (canopy top height) + dz0 (center height of the atmosphere's lowest grid)
    if (!use_wrfinput) {
        Real zlo      = m_geom.ProbLo(2);
        Real dz       = m_geom.CellSize(2);
        for ( MFIter mfi(cons_in,TileNoZ()); mfi.isValid(); ++mfi) {
            const Box& xybx      = mfi.growntilebox(0);
            const Array4<const Real>& z_nd_arr = (use_terrain) ? z_phys_nd->const_array(mfi) : Array4<Real>{};
            auto ztop_arr = ztop.array(mfi);
            auto zrefxy_arr = zrefxy.array(mfi);
 
            ParallelFor(xybx, [=] AMREX_GPU_DEVICE(int i, int j, int) noexcept {
                amrex::Real znd = (z_nd_arr) ? Compute_Zrel_AtCellCenter(i, j, 0, z_nd_arr) : zlo + myhalf*dz;
                zrefxy_arr(i,j,0) = ztop_arr(i,j,0) + znd;
            });
        }
    } else {
        zrefxy.setVal(zref);  // set zrefxy with the value read from inputs file
    }
 
    //slm_to_rad_vars = {Lsm_Data_Ptr(LsmVar_SLM::tsurf), &albedovis_s, &albedovis_v, &albedonir_s, &albedonir_v, &IR_emis_vege, &net_rad};
    slm_to_rad_vars = {Lsm_Data_Ptr(LsmVar_SLM::tsurf),
                       Lsm_Data_Ptr(Lsm_DataIndex("emis_sfc")),
                       Lsm_Data_Ptr(Lsm_DataIndex("alb_vis_sfc")),
                       Lsm_Data_Ptr(Lsm_DataIndex("alb_nir_sfc")),
                       Lsm_Data_Ptr(Lsm_DataIndex("alb_vis_sfc_diff")),
                       Lsm_Data_Ptr(Lsm_DataIndex("alb_nir_sfc_diff"))};
}

Here is the call graph for this function:

Init() [3/3]

virtual void NullSurf::Init

inline

    {
        Init(lev, cons_in, geom, geom0,
             domain_bcs_type, refRatio, dt_advance,
             nc_init_file);
    }

init_from_inputs()

void SLM::init_from_inputs

(

)

Initialize SLM from inputs.

Initializes for idealized cases if provided:

• Reads uniform land, vegetation, soil, and surface-property inputs.
• Reads layer-dependent soil properties when not using WRFInput. Initializes other options:
• Configures soil nudging and relaxation-height values.
• Loads optional Noah-MP parameter tables and radiation settings.

{
    ParmParse pp("slm");
    pp.query("landtype0", landtype0);
    pp.query("LAI0", LAI0);
 
    auto validate_value = [](const std::string& name, const amrex::Real value,
                             const std::optional<amrex::Real> lower = std::nullopt,
                             const std::optional<amrex::Real> upper = std::nullopt)
    {
        if (!std::isfinite(value) || (lower && value < *lower) || (upper && value > *upper)) {
            amrex::Abort("SLM: invalid value for '" + name + "'");
        }
    };
 
    auto const get_layer_prop = [&pp, &validate_value](
        const std::string& name, const int nz, amrex::Vector<amrex::Real>& prop,
        const std::optional<amrex::Real> lower = std::nullopt,
        const std::optional<amrex::Real> upper = std::nullopt)
    {
        int nval = pp.countval(name.c_str());
 
        if (nval == 1)
        {
            // read single val and fill prop array over all soil layers
            amrex::Real tmp;
            pp.query(name.c_str(), tmp);
            prop.resize(nz);
            std::fill(prop.begin(), prop.end(), tmp);
        } else {
            pp.queryarr(name.c_str(), prop);
            AMREX_ALWAYS_ASSERT_WITH_MESSAGE(static_cast<int>(prop.size()) == nz, " Expected " + name + " to have " + std::to_string(nz) + " values!");
        }
        for (const amrex::Real value : prop) {
            validate_value(name, value, lower, upper);
        }
    };
 
    pp.query("soiltnudging", dosoiltnudging);
    pp.query("soilwnudging", dosoilwnudging);
    pp.query("tausoil", tausoil);
 
    if (!use_wrfinput) {
        get_layer_prop("clay0", m_nz_lsm, clay0, 0.0, 100.0);
        get_layer_prop("sand0", m_nz_lsm, sand0, 0.0, 100.0);
        get_layer_prop("sw0", m_nz_lsm, sw0, 0.0, 1.0);
        get_layer_prop("st0", m_nz_lsm, st0);
    }
    if (dosoiltnudging || dosoilwnudging) {
        get_layer_prop("relax_hgt", m_nz_lsm, relax_hgt, 0.0, 1.0);
    } else {
        relax_hgt.resize(m_nz_lsm);
        std::fill(relax_hgt.begin(), relax_hgt.end(), 0.0);
    }
 
    if (!use_wrfinput) {
        for (int i = 0; i < m_nz_lsm; i++)
        {
            amrex::Print() << " " << i << ": soilt = " << st0[i] << " soilw = " << sw0[i] << " clay = " << clay0[i] << " sand = " << sand0[i] << " relax = " << relax_hgt[i] << std::endl;
        }
    }
 
    pp.query("tabs_s", tabs_s);
    pp.query("t00", t00);
 
    pp.query("z0_soil", z0_soil);
    pp.query("mws_mx0", mws_mx0);
    pp.query("Rc_max", Rc_max);
    pp.query("T_opt", T_opt);
    pp.query("zref", zref);
 
    validate_value("tausoil", tausoil, 0.0);
    validate_value("z0_soil", z0_soil, 0.0);
    validate_value("Rc_max", Rc_max, 0.0);
    validate_value("zref", zref, 0.0);
    validate_value("LAI0", LAI0, 0.0);
    validate_value("mws_mx0", mws_mx0, 0.0);
    validate_value("T_opt", T_opt);
    validate_value("tabs_s", tabs_s);
    validate_value("t00", t00);
 
    // Read NoahmpTable.TBL
    pp.query("use_parameter_file", use_param_file);
    pp.query("interpolate_lai", interpolate_lai);
    pp.query("parameter_file", parameter_file);
    pp.query("veg_dataset", veg_dataset);
    pp.query("soil_dataset", soil_dataset);
    pp.query("use_param_tbl", use_wrf_lai);
 
    if (use_param_file) {
        AMREX_ALWAYS_ASSERT_WITH_MESSAGE(use_wrf_lai != use_param_file, "Cannot use parameter file and parameter table, must choose one method");
        AMREX_ALWAYS_ASSERT_WITH_MESSAGE(parameter_file != "", "Using parameter file, but file path is empty!");
    }
 
    // Read NoahMP table if provided
    if (use_param_file && parameter_file != "") {
        full_params = ReadParameterFile(parameter_file, param_veg_categories, param_soil_categories);
        validate_parameter_tables();
 
        std::string soil_param_key, veg_param_key;
        const std::string soil_dataset_lower = amrex::toLower(soil_dataset);
        const std::string veg_dataset_lower = amrex::toLower(veg_dataset);
        if (soil_dataset_lower == "stas_ruc") {
            soil_param_key = "noahmp_soil_stas_ruc_parameters";
        } else if (soil_dataset_lower == "stas") {
            soil_param_key = "noahmp_soil_stas_parameters";
        } else {
            amrex::Abort("Unrecognized soil dataset type, expected 'stas_ruc' or 'stas'");
        }
 
        if (veg_dataset_lower == "usgs") {
            veg_param_key = "noahmp_usgs_parameters";
        } else if (veg_dataset_lower == "modis") {
            veg_param_key = "noahmp_modis_parameters";
        } else {
            amrex::Abort("Unrecognized vegetation dataset type, expected 'usgs' or 'modis'");
        }
 
        // Copy soil and vegetation datasets to GPU
        auto &h_soil_params = full_params.at(soil_param_key);
        auto &h_veg_params = full_params.at(veg_param_key);
 
        for (int i = 0; i < static_cast<int>(h_soil_params.size()); ++i) {
            const int varsize = static_cast<int>(h_soil_params[i].second.size());
            if (varsize > 1) {
                //amrex::Print() << " -- copying soil param '" << h_soil_params[i].first << "' to GPU " << std::endl;
                auto d_var = std::make_unique<amrex::Gpu::DeviceVector<amrex::Real>>(varsize);
                auto *d_var_ptr = d_var.get();
                d_soil_params.insert(std::make_pair(h_soil_params[i].first, std::move(d_var)));
                Gpu::copyAsync(Gpu::hostToDevice, h_soil_params[i].second.data(), h_soil_params[i].second.data()+varsize, d_var_ptr->data());
            }
        }
 
        for (int i = 0; i < static_cast<int>(h_veg_params.size()); ++i) {
            const int varsize = static_cast<int>(h_veg_params[i].second.size());
            if (h_veg_params[i].first == "nroot") {
                for (const amrex::Real value : h_veg_params[i].second) {
                    AMREX_ALWAYS_ASSERT_WITH_MESSAGE(
                        value >= zero && value <= m_nz_lsm && value == std::floor(value),
                        "SLM: NoahMP NROOT must be an integer in [0, slm.nsoil]");
                }
            }
            if (varsize > 1) {
                //amrex::Print() << " -- copying veg param '" << h_veg_params[i].first << "' to GPU " << std::endl;
                auto d_var = std::make_unique<amrex::Gpu::DeviceVector<amrex::Real>>(varsize);
                auto *d_var_ptr = d_var.get();
                d_veg_params.insert(std::make_pair(h_veg_params[i].first, std::move(d_var)));
                Gpu::copyAsync(Gpu::hostToDevice, h_veg_params[i].second.data(), h_veg_params[i].second.data()+varsize, d_var_ptr->data());
            }
        }
 
        Gpu::streamSynchronize();
 
        // Read radiation parameters from NoahmpTable.TBL
        // Read noahmp_rad_parameters block
        if (full_params.count("noahmp_rad_parameters") > 0) {
            auto &h_rad_params = full_params.at("noahmp_rad_parameters");
            for (int i = 0; i < static_cast<int>(h_rad_params.size()); ++i) {
                std::string pname = h_rad_params[i].first;
                const int varsize = static_cast<int>(h_rad_params[i].second.size());
 
                if (varsize > 1 &&
                    (pname == "albsat_vis" || pname == "albsat_nir" ||
                     pname == "albdry_vis" || pname == "albdry_nir" ||
                     pname == "alblak" || pname == "omegas")) {
                    auto d_var = std::make_unique<amrex::Gpu::DeviceVector<amrex::Real>>(varsize);
                    auto *d_var_ptr = d_var.get();
                    d_rad_params.insert(std::make_pair(pname, std::move(d_var)));
                    Gpu::copyAsync(Gpu::hostToDevice, h_rad_params[i].second.data(),
                                   h_rad_params[i].second.data()+varsize, d_var_ptr->data());
                } else if (pname == "betads" && varsize == 1) {
                    betads_rad = h_rad_params[i].second[0];
                } else if (pname == "betais" && varsize == 1) {
                    betais_rad = h_rad_params[i].second[0];
                }
            }
        }
 
        // Read noahmp_global_parameters block for snow albedo parameters
        if (full_params.count("noahmp_global_parameters") > 0) {
            auto &h_global_params = full_params.at("noahmp_global_parameters");
            for (int i = 0; i < static_cast<int>(h_global_params.size()); ++i) {
                std::string pname = h_global_params[i].first;
                const int varsize = static_cast<int>(h_global_params[i].second.size());
 
                if (varsize == 1) {
                    if (pname == "tau0") tau0_rad = h_global_params[i].second[0];
                    else if (pname == "grain_growth") grain_growth_rad = h_global_params[i].second[0];
                    else if (pname == "extra_growth") extra_growth_rad = h_global_params[i].second[0];
                    else if (pname == "dirt_soot") dirt_soot_rad = h_global_params[i].second[0];
                    else if (pname == "bats_cosz") bats_cosz_rad = h_global_params[i].second[0];
                    else if (pname == "bats_vis_new") bats_vis_new_rad = h_global_params[i].second[0];
                    else if (pname == "bats_nir_new") bats_nir_new_rad = h_global_params[i].second[0];
                    else if (pname == "bats_vis_age") bats_vis_age_rad = h_global_params[i].second[0];
                    else if (pname == "bats_nir_age") bats_nir_age_rad = h_global_params[i].second[0];
                    else if (pname == "bats_vis_dir") bats_vis_dir_rad = h_global_params[i].second[0];
                    else if (pname == "bats_nir_dir") bats_nir_dir_rad = h_global_params[i].second[0];
                    else if (pname == "swemx") swemx_rad = h_global_params[i].second[0];
                    else if (pname == "snow_emis") snow_emis_rad = h_global_params[i].second[0];
                    else if (pname == "rsurf_exp") rsurf_exp = h_global_params[i].second[0];
                } else if (varsize == 2) {
                    if (pname == "eg") {
                        eg_soil_rad = h_global_params[i].second[0];  // IST=1 (soil)
                        eg_lake_rad = h_global_params[i].second[1];  // IST=2 (lake)
                    }
                }
            }
        }
 
        Gpu::streamSynchronize();
 
        amrex::Print() << " SLM: NOAHMP radiation parameters loaded from " << parameter_file << std::endl;
    } else {
        load_builtin_radiation_parameters();
    }
 
    if (interpolate_lai) {
        pp.gettable("lai", lai_table);
        pp.gettable("sai", sai_table);
 
        // validate LAI and SAI tables
        AMREX_ALWAYS_ASSERT_WITH_MESSAGE(static_cast<int>(lai_table.size()) == 12, "Invalid LAI table size, expected values for all 12 months");
        AMREX_ALWAYS_ASSERT_WITH_MESSAGE(static_cast<int>(sai_table.size()) == 12, "Invalid SAI table size, expected values for all 12 months");
        if (lai_table[0].empty()) {
            amrex::Abort("SLM: LAI table must contain at least one landtype column");
        }
        num_landtypes = static_cast<int>(lai_table[0].size()); // use first entry as size, check all others against
        for (int i = 0; i < static_cast<int>(lai_table.size()); ++i) {
            AMREX_ALWAYS_ASSERT_WITH_MESSAGE(static_cast<int>(lai_table[i].size()) == num_landtypes, "Invalid LAI table - inconsistent number of landtype entries between months");
            AMREX_ALWAYS_ASSERT_WITH_MESSAGE(static_cast<int>(sai_table[i].size()) == num_landtypes, "Invalid SAI table - inconsistent number of landtype entries between months");
        }
 
        d_lai_curr.resize(num_landtypes);
        d_lai_next.resize(num_landtypes);
        d_sai_curr.resize(num_landtypes);
        d_sai_next.resize(num_landtypes);
    }
 
    if (use_wrf_lai) {
        pp.gettable("vegparam", param_table);
        if (static_cast<int>(param_table.size()) < 16) {
            amrex::Abort("SLM: vegparam must contain at least 16 landtype rows");
        }
        if (static_cast<int>(param_table[0].size()) < 10) {
            amrex::Abort("SLM: vegparam must contain at least 10 columns");
        }
        amrex::Print() << " param table = " << std::endl;
 
        const int nparam = static_cast<int>(param_table[0].size());
        for (int t = 0; t < static_cast<int>(param_table.size()); ++t) {
            amrex::Print() << "     LANDTYPE " << t << ": ";
            for (int i = 0; i < static_cast<int>(param_table[t].size()); ++i) {
                amrex::Print() << param_table[t][i] << " ";
            }
            amrex::Print() << std::endl;
 
            AMREX_ALWAYS_ASSERT_WITH_MESSAGE(static_cast<int>(param_table[t].size()) == nparam, "Invalid param table, inconsistent number of parameters for landtype");
            if (param_table[t][0] != t + 1) {
                amrex::Abort("SLM: vegparam landtype IDs must be sequential");
            }
        }
 
        // Copy parameter table to GPU
        d_param_table = TableData<Real, 2>({0, 0}, {static_cast<int>(param_table.size()), nparam});
#ifdef AMREX_USE_GPU
        TableData<Real, 2> h_param_table({0, 0}, {static_cast<int>(param_table.size()), nparam}, amrex::The_Pinned_Arena());
        auto const &h_tab = h_param_table.table();
#else
        auto const &h_tab = d_param_table.table();
#endif
        for (int t = 0; t < static_cast<int>(param_table.size()); ++t) {
            for (int i = 0; i < static_cast<int>(param_table[t].size()); ++i) {
                h_tab(t, i) = param_table[t][i];
            }
        }
#ifdef AMREX_USE_GPU
        d_param_table.copy(h_param_table);
        Gpu::streamSynchronize();
#endif
    }
 
    pp.query("rad_input_file", rad_input_file);
    if (rad_input_file != "") {
#ifndef ERF_USE_NETCDF
        amrex::Abort("ERF needs to be compiled with NetCDF to use the SLM rad_input_file option!");
#endif
#ifdef ERF_USE_NETCDF
        ncutils::NCFile rad_forcing_ncf = ncutils::NCFile::open(rad_input_file, NC_NOWRITE);
 
        ncutils::NCVar rad_time = rad_forcing_ncf.var("time");
        num_rad_times = rad_time.shape()[0];
        rad_times.resize(num_rad_times);
        rad_time.get(rad_times.dataPtr(), {0}, {static_cast<unsigned long>(num_rad_times)});
 
        amrex::Real start_rad_time = rad_times[0];
        for (int i = 0; i < num_rad_times; i++)
        {
            rad_times[i] = (rad_times[i] - start_rad_time) * 86400.0; // shift relative to first time
        }
 
        ncutils::NCDim rad_x = rad_forcing_ncf.dim("x");
        ncutils::NCDim rad_y = rad_forcing_ncf.dim("y");
 
        amrex::Print() << " Read radiation forcing file '" << rad_input_file << "'" << std::endl;
        amrex::Print() << "   rad forcing file has " << num_rad_times << " time values, x = " << rad_x.len() << " y = " << rad_y.len() << std::endl;
        AMREX_ALWAYS_ASSERT_WITH_MESSAGE(m_lsm_geom.Domain().length(0) == static_cast<int>(rad_x.len()) && m_lsm_geom.Domain().length(1) == static_cast<int>(rad_y.len()), "Radiation input file must have same X and Y dimensions!");
 
        BoxList bl_rad = ba_lsm_2d.boxList();
        for (auto& b : bl_rad) {
            b.setSmall(2, 0);
            b.setBig(2, num_rad_times - 1);
        }
        BoxArray ba_rad = BoxArray(std::move(bl_rad));
        IntVect ng_2d(0, 0, 0);
 
        // rad_input has 6 components: SWVIS, SWNIR, SWVISD, SWNIRD, COSZRS, LWDS
        rad_input_data.define(ba_rad, landmask.distributionMap, 6, ng_2d);
        rad_input_data.setVal(zero);
 
        amrex::Arena* Arena_Used = amrex::The_Arena();
#ifdef AMREX_USE_GPU
            Arena_Used = amrex::The_Pinned_Arena();
#endif
 
        for(int comp = 0; comp < rad_input_data.nComp(); ++comp) {
 
            ncutils::NCVar rad_var = rad_forcing_ncf.var(rad_names[comp]);
            amrex::Print() << " Reading radiation input var " << rad_var.name() << std::endl;
 
            for ( MFIter mfi(rad_input_data); mfi.isValid(); ++mfi) {
                const auto& box = mfi.fabbox();
 
                FArrayBox tmp(box, 1, Arena_Used);
                auto *dataPtr = tmp.dataPtr();
                AMREX_ALWAYS_ASSERT(dataPtr != nullptr);
 
                std::vector<size_t> starts = {0,
                                              static_cast<unsigned long>(box.loVect()[1]),
                                              static_cast<unsigned long>(box.loVect()[0])};
                std::vector<size_t> counts = {static_cast<unsigned long>(num_rad_times),
                                              static_cast<unsigned long>(box.length()[1]),
                                              static_cast<unsigned long>(box.length()[0])};
 
                amrex::Print() << "  -- reading {" << counts[0] << "," << counts[1] << "," << counts[2] << "} at index {" << starts[0] << "," << starts[1] << "," << starts[2] << "}" << std::endl;
                rad_var.get(dataPtr, starts, counts);
 
                auto mf_arr = rad_input_data.array(mfi, comp);
                auto tmp_arr = tmp.array();
                ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int k)
                {
                    mf_arr(i, j, k) = tmp_arr(i, j, k);
                });
            }
        }
 
        /*
         for ( MFIter mfi(rad_input_data); mfi.isValid(); ++mfi)
         {
            const auto& box = mfi.fabbox();
            auto rad_arr = rad_input_data.const_array(mfi);
            ParallelFor(box, rad_names.size(), [=] AMREX_GPU_DEVICE (int i, int j, int k, int n)
            {
                amrex::Print() << "   i = " << i << " j = " << j << " k = " << k << " n = " << n << " RADVAR = " << rad_arr(i, j, k, n) << std::endl;
            });
         }
         */
#endif
    }
 
    shf_soil.setVal(zero);
    lhf_soil.setVal(zero);
 
    r_a.setVal(1.0e9);
    r_b.setVal(1.0e4);
    r_c.setVal(1.0e4);
    r_d.setVal(1.0e4);
 
    mw.setVal(zero);
    mws.setVal(zero);
 
    mw_inc.setVal(zero);
    evapo_dry.setVal(zero);
}

Here is the call graph for this function:

init_from_params()

void SLM::init_from_params

(

)

Overwrites any default SLM variables from values set in the parameter file

{
    // do nothing if not using the parameter file
    if (!use_param_file) {
        return;
    }
 
    const int d_khi_lsm = khi_lsm;
    const int d_klo_lsm = klo_lsm;
 
    // Get pointers to GPU soil parameter values
    const amrex::Real *d_param_poro = d_soil_params.at("maxsmc")->data();
    const amrex::Real *d_param_theta_FC = d_soil_params.at("refsmc")->data();
    const amrex::Real *d_param_theta_WP = d_soil_params.at("wltsmc")->data();
    const amrex::Real *d_param_m_pot_sat = d_soil_params.at("satpsi")->data();
    const amrex::Real *d_param_Bconst = d_soil_params.at("bb")->data();
    const amrex::Real *d_param_ks = d_soil_params.at("satdk")->data();
 
    // Get pointers to GPU vegetation parameter values from NoahMP table
    const amrex::Real *d_param_rs = nullptr;
    const amrex::Real *d_param_rgl = nullptr;
    const amrex::Real *d_param_xl = nullptr;
    const amrex::Real *d_param_hs = nullptr;
    const amrex::Real *d_param_nroot = nullptr;
    const amrex::Real *d_param_hvt = nullptr;
    const amrex::Real *d_param_z0mvt = nullptr;
    const amrex::Real *d_param_cbiom = nullptr;
    const amrex::Real *d_param_dleaf = nullptr;
 
    // Check if vegetation parameters are available
    bool has_rs = false, has_rgl = false, has_xl = false, has_hs = false;
    bool has_nroot = false, has_hvt = false, has_z0mvt = false;
    bool has_cbiom = false, has_dleaf = false;
    if (d_veg_params.find("rs") != d_veg_params.end()) {
        d_param_rs = d_veg_params.at("rs")->data();
        has_rs = true;
        amrex::Print() << " SLM: Using RS (minimum stomatal resistance) from NoahMP parameter file" << std::endl;
    }
    if (d_veg_params.find("rgl") != d_veg_params.end()) {
        d_param_rgl = d_veg_params.at("rgl")->data();
        has_rgl = true;
        amrex::Print() << " SLM: Using RGL (radiation stress parameter) from NoahMP parameter file" << std::endl;
    }
    if (d_veg_params.find("xl") != d_veg_params.end()) {
        d_param_xl = d_veg_params.at("xl")->data();
        has_xl = true;
        amrex::Print() << " SLM: Using XL (leaf/stem orientation index) from NoahMP parameter file" << std::endl;
    }
    if (d_veg_params.find("hs") != d_veg_params.end()) {
        d_param_hs = d_veg_params.at("hs")->data();
        has_hs = true;
        amrex::Print() << " SLM: Using HS (VPD sensitivity parameter) from NoahMP parameter file" << std::endl;
        amrex::Print() << " SLM: Note - VPD formula changed to match NoahMP: 1/(1+HS*VPD)" << std::endl;
    }
    if (d_veg_params.find("nroot") != d_veg_params.end()) {
        d_param_nroot = d_veg_params.at("nroot")->data();
        has_nroot = true;
        amrex::Print() << " SLM: Using NROOT from NoahMP parameter file for the BTR=1 soil-water stress factor" << std::endl;
    }
    if (d_veg_params.find("hvt") != d_veg_params.end()) {
        d_param_hvt = d_veg_params.at("hvt")->data();
        has_hvt = true;
        amrex::Print() << " SLM: Using HVT (canopy top height) from NoahMP parameter file" << std::endl;
    }
    if (d_veg_params.find("z0mvt") != d_veg_params.end()) {
        d_param_z0mvt = d_veg_params.at("z0mvt")->data();
        has_z0mvt = true;
        amrex::Print() << " SLM: Using Z0MVT (vegetation momentum roughness) from NoahMP parameter file" << std::endl;
    }
    if (d_veg_params.find("cbiom") != d_veg_params.end()) {
        d_param_cbiom = d_veg_params.at("cbiom")->data();
        has_cbiom = true;
        amrex::Print() << " SLM: Using CBIOM (canopy biomass heat capacity parameter) from NoahMP parameter file" << std::endl;
    }
    if (d_veg_params.find("dleaf") != d_veg_params.end()) {
        d_param_dleaf = d_veg_params.at("dleaf")->data();
        has_dleaf = true;
        amrex::Print() << " SLM: Using DLEAF (characteristic leaf dimension) from NoahMP parameter file" << std::endl;
    }
 
    for ( amrex::MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        amrex::Box bx2d = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
        auto landtype_arr = landtype.const_array(mfi);
        auto vegetype_arr = vegetype.const_array(mfi);
        auto soiltype_arr = lsm_fab_vars[LsmVar_SLM::soiltype]->const_array(mfi);
 
        auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->array(mfi);
        auto theta_FC_arr = lsm_fab_vars[LsmVar_SLM::theta_FC]->array(mfi);
        auto theta_WP_arr = lsm_fab_vars[LsmVar_SLM::theta_WP]->array(mfi);
        auto m_pot_sat_arr = lsm_fab_vars[LsmVar_SLM::m_pot_sat]->array(mfi);
        auto Bconst_arr = lsm_fab_vars[LsmVar_SLM::Bconst]->array(mfi);
        auto ks_arr = lsm_fab_vars[LsmVar_SLM::ks]->array(mfi);
 
        // Get vegetation parameter arrays
        auto Rc_min_arr = Rc_min.array(mfi);
        auto Rgl_arr = Rgl.array(mfi);
        auto Khai_L_arr = Khai_L.array(mfi);
        auto hs_rc_arr = hs_rc.array(mfi);
        auto nroot_arr = nroot.array(mfi);
        auto ztop_arr = ztop.array(mfi);
        auto disp_hgt_arr = disp_hgt.array(mfi);
        auto z0_sfc_arr = z0_sfc.array(mfi);
        auto cbiom_arr = cbiom.array(mfi);
        auto dleaf_arr = dleaf.array(mfi);
 
        amrex::ParallelFor(bx2d, [=] AMREX_GPU_DEVICE(int i, int j, int) noexcept {
            if (landmask_arr(i, j, 0) == 1) {
 
                const int ltype = landtype_arr(i,j,0) - 1; // shift by one to match table index (i.e, types 1-20 -> index 0-19)
                const int stype = static_cast<int>(soiltype_arr(i,j,d_khi_lsm)) - 1;
 
                // Set soil parameters from parameter file
                for (int k = d_khi_lsm; k >= d_klo_lsm; k--) {
                    poro_soil_arr(i, j, k) = d_param_poro[stype];
                    theta_FC_arr(i, j, k) = d_param_theta_FC[stype];
                    theta_WP_arr(i, j, k) = d_param_theta_WP[stype];
                    // NoahMP stores SATPSI as a positive magnitude in meters;
                    // SLM uses a negative matric potential in millimeters.
                    m_pot_sat_arr(i, j, k) = -1000.0 * d_param_m_pot_sat[stype];
                    Bconst_arr(i, j, k) = d_param_Bconst[stype];
                    // NoahMP SATDK is m/s; SLM soil hydraulics use mm/s.
                    ks_arr(i, j, k) = 1000.0 * d_param_ks[stype];
                }
 
                // Set vegetation parameters from NoahMP table if available
                if (vegetype_arr(i,j,0) == 1) {
                    if (has_rs && d_param_rs != nullptr) {
                        // RS = minimum stomatal resistance [s/m]
                        Rc_min_arr(i, j, 0) = d_param_rs[ltype];
                    }
                    if (has_rgl && d_param_rgl != nullptr) {
                        // RGL = radiation stress parameter [W/m2]
                        Rgl_arr(i, j, 0) = d_param_rgl[ltype];
                    }
                    if (has_xl && d_param_xl != nullptr) {
                        // XL = leaf/stem orientation index (dimensionless)
                        // Directly maps to Khai_L in SLM
                        Khai_L_arr(i, j, 0) = d_param_xl[ltype];
                    }
                    if (has_hs && d_param_hs != nullptr) {
                        // HS = VPD sensitivity parameter (dimensionless)
                        // NOTE: This only works with the hyperbolic VPD formula: 1/(1+HS*VPD)
                        // If using exponential formula exp(-hs*VPD), HS values are NOT compatible
                        hs_rc_arr(i, j, 0) = d_param_hs[ltype];
                    }
                    if (has_nroot && d_param_nroot != nullptr) {
                        nroot_arr(i, j, 0) = static_cast<int>(d_param_nroot[ltype]);
                    }
                    if (has_hvt && d_param_hvt != nullptr) {
                        ztop_arr(i, j, 0) = d_param_hvt[ltype];
                        disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    }
                    if (has_z0mvt && d_param_z0mvt != nullptr) {
                        z0_sfc_arr(i, j, 0) = d_param_z0mvt[ltype];
                    }
                    if (has_cbiom && d_param_cbiom != nullptr) {
                        cbiom_arr(i, j, 0) = d_param_cbiom[ltype];
                    }
                    if (has_dleaf && d_param_dleaf != nullptr) {
                        dleaf_arr(i, j, 0) = d_param_dleaf[ltype];
                    }
                }
            }
        });
    }
 
    // set a flag to indicate remaining soil variables should be recomputed
    params_updated = true;
 
    // recompute soil variables using updated parameters
    init_soil_vars();
 
    // recompute derived vegetation fields using the updated parameters.
    for (amrex::MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        UpdateLAIParameters(mfi);
    }
}

Here is the call graph for this function:

init_landtype()

void SLM::init_landtype

(

)

Helper function to set properties according to the IGBP class

{
    const Real d_z0_soil = z0_soil;
 
    for ( MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box = mfi.tilebox();
 
        auto landtype_arr = landtype.const_array(mfi);
        auto landmask_arr = landmask.array(mfi);
#ifndef AMREX_USE_GPU
        auto LAI_arr = LAI.const_array(mfi);
#endif
        auto albedovis_v_arr = albedovis_v.array(mfi);
        auto albedonir_v_arr = albedonir_v.array(mfi);
        auto albedovis_s_arr = albedovis_s.array(mfi);
        auto albedonir_s_arr = albedonir_s.array(mfi);
        auto ztop_arr = ztop.array(mfi);
        auto disp_hgt_arr = disp_hgt.array(mfi);
        auto z0_sfc_arr = z0_sfc.array(mfi);
        auto Khai_L_arr = Khai_L.array(mfi);
        auto Rc_min_arr = Rc_min.array(mfi);
        auto Rgl_arr = Rgl.array(mfi);
        auto hs_rc_arr = hs_rc.array(mfi);
        auto BAI_arr = BAI.array(mfi);
        auto IMPERV_arr = IMPERV.array(mfi);
        auto vegetype_arr = vegetype.array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            switch (landtype_arr(i, j, 0))
            {
                case 0: // water
                    // TODO: should this landmask be ERF's lmask_lev variable?
                    landmask_arr(i, j, 0) = 0;
                    vegetype_arr(i, j, 0) = 0;
                    // set albedo for water so that it is populated for RRTMGP
                    albedovis_v_arr(i, j, 0) = 0.06;
                    albedonir_v_arr(i, j, 0) = 0.06;
                    albedovis_s_arr(i, j, 0) = 0.06;
                    albedonir_s_arr(i, j, 0) = 0.06;
                    break;
                case 1: // evergreen needleleaf forest
                    albedovis_v_arr(i, j, 0) = 0.094;
                    albedonir_v_arr(i, j, 0) = 0.161;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 20.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 1.09;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 250.;
                    Rgl_arr(i, j, 0) = 120.;
                    hs_rc_arr(i, j, 0) = 0.03;
                    BAI_arr(i, j, 0) = 200.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 2: // evergreen broadleaf forest
                    albedovis_v_arr(i, j, 0) = 0.086;
                    albedonir_v_arr(i, j, 0) = 0.146;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 20.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = one;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 250.;
                    Rgl_arr(i, j, 0) = 120.;
                    hs_rc_arr(i, j, 0) = 0.03;
                    BAI_arr(i, j, 0) = 200.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 3: // deciduous needleaf forest
                    albedovis_v_arr(i, j, 0) = 0.102;
                    albedonir_v_arr(i, j, 0) = 0.198;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 20.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 1.10;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 250.;
                    Rgl_arr(i, j, 0) = 120.;
                    hs_rc_arr(i, j, 0) = 0.03;
                    BAI_arr(i, j, 0) = 200.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 4: // deciduous broadleaf forest
                    albedovis_v_arr(i, j, 0) = 0.056;
                    albedonir_v_arr(i, j, 0) = 0.151;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 20.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.8;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 250.;
                    Rgl_arr(i, j, 0) = 120.;
                    hs_rc_arr(i, j, 0) = 0.03;
                    BAI_arr(i, j, 0) = 200.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 5: // mixed forest
                    albedovis_v_arr(i, j, 0) = 0.093;
                    albedonir_v_arr(i, j, 0) = 0.179;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 20.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.8;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 250.;
                    Rgl_arr(i, j, 0) = 120.;
                    hs_rc_arr(i, j, 0) = 0.03;
                    BAI_arr(i, j, 0) = 200.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 6: // closed shrublands
                    albedovis_v_arr(i, j, 0) = 0.069;
                    albedonir_v_arr(i, j, 0) = 0.121;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = one;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.1;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 220.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 60.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 7: // open shrublands
                    albedovis_v_arr(i, j, 0) = 0.079;
                    albedonir_v_arr(i, j, 0) = 0.226;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = one;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.1;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 220.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 60.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 8: // woody savannas
                    albedovis_v_arr(i, j, 0) = 0.071;
                    albedonir_v_arr(i, j, 0) = 0.085;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 5.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.3;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 180.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.02;
                    BAI_arr(i, j, 0) = 100.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 9: // savannas
                    albedovis_v_arr(i, j, 0) = 0.061;
                    albedonir_v_arr(i, j, 0) = 0.227;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = 5.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.3;
                    Khai_L_arr(i, j, 0) = fourth;
                    Rc_min_arr(i, j, 0) = 100.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 100.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 10: // grasslands
                    albedovis_v_arr(i, j, 0) = 0.09;
                    albedonir_v_arr(i, j, 0) = 0.269;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = myhalf;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.04;
                    Khai_L_arr(i, j, 0) = -0.3;
                    Rc_min_arr(i, j, 0) = 100.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 20.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 11: // permanent wetlands
                    albedovis_v_arr(i, j, 0) = 0.081;
                    albedonir_v_arr(i, j, 0) = 0.18;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = myhalf;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.2;
                    Khai_L_arr(i, j, 0) = -0.3;
                    Rc_min_arr(i, j, 0) = 100.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 20.0;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) =1;
                    break;
                case 12: // croplands
                    albedovis_v_arr(i, j, 0) = 0.084;
                    albedonir_v_arr(i, j, 0) = 0.193;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = myhalf;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.03;
                    Khai_L_arr(i, j, 0) = -0.3;
                    Rc_min_arr(i, j, 0) = 100.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 60.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 13: // urban
                    albedovis_v_arr(i, j, 0) = 0.102;
                    albedonir_v_arr(i, j, 0) = 0.164;
                    albedovis_s_arr(i, j, 0) = 0.15;
                    albedonir_s_arr(i, j, 0) = fourth;
                    ztop_arr(i, j, 0) = 10.;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = one;
                    Khai_L_arr(i, j, 0) = -0.3;
                    Rc_min_arr(i, j, 0) = zero;
                    Rgl_arr(i, j, 0) = zero;
                    hs_rc_arr(i, j, 0) = zero;
                    BAI_arr(i, j, 0) = zero;
                    IMPERV_arr(i, j, 0) = 0.75;
                    vegetype_arr(i, j, 0) = 0;
                    break;
                case 14: // croplands/natural mozaics
                    albedovis_v_arr(i, j, 0) = 0.071;
                    albedonir_v_arr(i, j, 0) = 0.169;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = myhalf;
                    disp_hgt_arr(i, j, 0) = 0.65 * ztop_arr(i, j, 0);
                    z0_sfc_arr(i, j, 0) = 0.04;
                    Khai_L_arr(i, j, 0) = -0.3;
                    Rc_min_arr(i, j, 0) = 100.;
                    Rgl_arr(i, j, 0) = 100.;
                    hs_rc_arr(i, j, 0) = 0.01;
                    BAI_arr(i, j, 0) = 20.;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 1;
                    break;
                case 15: // snow/ice
                    albedovis_v_arr(i, j, 0) = zero; // actually depends on moisture content
                    albedonir_v_arr(i, j, 0) = zero;
                    albedovis_s_arr(i, j, 0) = 0.91;
                    albedonir_s_arr(i, j, 0) = 0.65;
                    ztop_arr(i, j, 0) = zero;
                    disp_hgt_arr(i, j, 0) = zero;
                    z0_sfc_arr(i, j, 0) = 0.001;
                    Khai_L_arr(i, j, 0) = zero;
                    Rc_min_arr(i, j, 0) = zero;
                    Rgl_arr(i, j, 0) = zero;
                    hs_rc_arr(i, j, 0) = zero;
                    BAI_arr(i, j, 0) = zero;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 0;
                    break;
                case 16: // baresoil
                    albedovis_v_arr(i, j, 0) = zero; // actually depends on moisture content
                    albedonir_v_arr(i, j, 0) = zero;
                    albedovis_s_arr(i, j, 0) = 0.208;
                    albedonir_s_arr(i, j, 0) = 0.344;
                    ztop_arr(i, j, 0) = zero;
                    disp_hgt_arr(i, j, 0) = zero;
                    z0_sfc_arr(i, j, 0) = d_z0_soil;
                    Khai_L_arr(i, j, 0) = zero;
                    Rc_min_arr(i, j, 0) = zero;
                    Rgl_arr(i, j, 0) = zero;
                    hs_rc_arr(i, j, 0) = zero;
                    BAI_arr(i, j, 0) = zero;
                    IMPERV_arr(i, j, 0) = zero;
                    vegetype_arr(i, j, 0) = 0;
                    break;
                default:
// TODO: check if AMReX::Abort can be called inside ParFor?
#ifndef AMREX_USE_GPU
                  amrex::Abort(
                    "landtype invalid for i = " + std::to_string(i) +
                    " j = " + std::to_string(j));
#endif
                  break;
            }
#ifndef AMREX_USE_GPU
            if (vegetype_arr(i, j, 0) == 1 && LAI_arr(i, j, 0) == zero)
            {
                amrex::Abort("LAI is not set for vegetated land point at i = " + std::to_string(i) + " j = " + std::to_string(j));
            }
#endif
        });
  }
}

Here is the call graph for this function:

init_layer_depths()

void SLM::init_layer_depths

(

)

Calculates center and face depths for each soil layer

{
    const int d_khi_lsm = khi_lsm;
    const int d_klo_lsm = klo_lsm;
 
    const bool wrfinput = use_wrfinput;
 
    for ( MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box = mfi.tilebox();
 
        auto s_depth_arr = lsm_fab_vars[LsmVar_SLM::s_depth]->const_array(mfi);
 
        auto node_z_arr = lsm_fab_vars[LsmVar_SLM::node_z]->array(mfi);
        auto interface_z_arr = lsm_fab_vars[LsmVar_SLM::interface_z]->array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            // k = 0 = reference level
            // k = -1 = top of soil layer = khi_lsm
            // k = -m_nz_lsm = klo_lsm
 
            if (!wrfinput) {
                node_z_arr(i, j, d_khi_lsm) = myhalf * s_depth_arr(i, j, d_khi_lsm);
                for (int k = d_khi_lsm - 1; k >= d_klo_lsm; k--)
                {
                    node_z_arr(i, j, k) = myhalf * s_depth_arr(i, j, k);
 
                    for (int kk = d_khi_lsm; kk >= k + 1; kk--)
                    {
                        node_z_arr(i, j, k) = node_z_arr(i, j, k) + s_depth_arr(i, j, kk);
                    }
                }
            }
 
            for (int k = d_khi_lsm; k >= d_klo_lsm; k--)
            {
                interface_z_arr(i, j, k) = node_z_arr(i, j, k) + myhalf*s_depth_arr(i, j, k);
            }
        });
    }
}

Here is the call graph for this function:

init_slm_vars()

void SLM::init_slm_vars

(

)

{
    const int d_khi_lsm = khi_lsm;
 
    // Initializes SLM quantities from reference values tr, ts, qr
    for ( MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        auto box = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
 
        auto t_cas_arr = t_cas.array(mfi);
        auto q_cas_arr = q_cas.array(mfi);
        auto q_gr_arr = q_gr.array(mfi);
 
        auto t_canop_arr = t_canop.array(mfi);
        auto t_ground_skin_arr = t_ground_skin.array(mfi);
 
        auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->const_array(mfi);
        auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
        auto tref_arr  = lsm_fab_vars[LsmVar_SLM::tref]->const_array(mfi);
        auto tsurf_arr  = lsm_fab_vars[LsmVar_SLM::tsurf]->const_array(mfi);
        auto qref_arr  = lsm_fab_vars[LsmVar_SLM::qref]->const_array(mfi);
        auto pref_arr  = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
 
        //auto landtype_arr = landtype.const_array(mfi);
        ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            if (landmask_arr(i, j, 0) == 1)
            {
                amrex::Real q_ground;
 
                // soil surface specific humidity
                if (tsurf_arr(i, j, 0) > tfriz)
                {
                    erf_qsatw(tsurf_arr(i, j, 0), pref_arr(i, j, 0), q_ground);
                }
                else
                {
                    erf_qsati(tsurf_arr(i, j, 0), pref_arr(i, j, 0), q_ground);
                }
                q_ground *= soilw_arr(i, j, d_khi_lsm);
                q_gr_arr(i, j, 0) = q_ground;
 
                // canopy temperature: initialize as (ref level temperature + soil surf temperature)/2
                //t_canop_arr(i, j, 0) = 0.5*(tref_arr(i, j, 0) + tsurf_arr(i, j, 0));
                //t_cas_arr(i, j, 0) = 0.5*(tref_arr(i, j, 0) + tsurf_arr(i, j, 0));
 
                t_canop_arr(i, j, 0) = tref_arr(i, j, 0);
                t_cas_arr(i, j, 0) = tref_arr(i, j, 0);
                t_ground_skin_arr(i, j, 0) = soilt_arr(i, j, d_khi_lsm);
 
                // specific humidity in canopy air space
                q_cas_arr(i, j, 0) = myhalf*(qref_arr(i, j, 0) + q_ground);
 
                //amrex::Print() << " i = " << i << " j = " << j << " k = 0 : t_canop = " << t_canop_arr(i, j, 0) << " t_cas = " << t_cas_arr(i, j, 0) << " tsurf = " << tsurf_arr(i, j, 0) << " qcas = " << q_cas_arr(i, j, 0) << " qref = " << qref_arr(i, j, 0) << std::endl;
 
            }
        });
    }
 
    // initialize nudging profiles for soil based on the initial soilt and soilw
    MultiFab::Copy(*lsm_fab_vars[LsmVar_SLM::soilt_obs], *lsm_fab_vars[LsmVar_SLM::soilt], 0, 0, 1, 0);
    MultiFab::Copy(*lsm_fab_vars[LsmVar_SLM::soilw_obs], *lsm_fab_vars[LsmVar_SLM::soilw], 0, 0, 1, 0);
 
    initialize_surface_outputs();
}

Referenced by Update_Lsm_Vars().

Here is the call graph for this function:

Here is the caller graph for this function:

init_soil_tw()

void SLM::init_soil_tw

(

)

Reads soil input file, initializes soil wetness and temperature

{
    // TODO - read from input file
    const Real d_tabs_s = tabs_s;
    const Real d_t00 = t00;
 
    const int d_khi_lsm = khi_lsm;
 
    const bool wrfinput = use_wrfinput;
 
    amrex::Gpu::DeviceVector<Real> d_dz_lsm_vec(m_dz_lsm.size());
    amrex::Gpu::DeviceVector<Real> d_clay_vec(m_dz_lsm.size());
    amrex::Gpu::DeviceVector<Real> d_sand_vec(m_dz_lsm.size());
    amrex::Gpu::DeviceVector<Real> d_st0_vec(m_dz_lsm.size());
    amrex::Gpu::DeviceVector<Real> d_sw0_vec(m_dz_lsm.size());
    amrex::Gpu::DeviceVector<Real> d_relax_vec(m_dz_lsm.size());
 
    amrex::Gpu::copy(Gpu::hostToDevice, m_dz_lsm.begin(), m_dz_lsm.end(), d_dz_lsm_vec.begin());
    amrex::Gpu::copy(Gpu::hostToDevice, clay0.begin(), clay0.end(), d_clay_vec.begin());
    amrex::Gpu::copy(Gpu::hostToDevice, sand0.begin(), sand0.end(), d_sand_vec.begin());
    amrex::Gpu::copy(Gpu::hostToDevice, st0.begin(), st0.end(), d_st0_vec.begin());
    amrex::Gpu::copy(Gpu::hostToDevice, sw0.begin(), sw0.end(), d_sw0_vec.begin());
    amrex::Gpu::copy(Gpu::hostToDevice, relax_hgt.begin(), relax_hgt.end(), d_relax_vec.begin());
    Real *d_dz_lsm = d_dz_lsm_vec.data();
    Real *d_clay0 = d_clay_vec.data();
    Real *d_sand0 = d_sand_vec.data();
    Real *d_st0 = d_st0_vec.data();
    Real *d_sw0 = d_sw0_vec.data();
    Real *d_relax = d_relax_vec.data();
 
    auto tsurf = lsm_fab_vars[LsmVar_SLM::tsurf];
    for ( MFIter mfi(*tsurf, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box3d = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
 
        auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->array(mfi);
        auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->array(mfi);
 
        auto tsurf_arr   = lsm_fab_vars[LsmVar_SLM::tsurf]->array(mfi);
        auto lai_arr     = lsm_fab_vars[LsmVar_SLM::lai]->array(mfi);
        auto vegtype_arr = lsm_fab_vars[LsmVar_SLM::vegtype]->array(mfi);
 
        auto sand_arr = lsm_fab_vars[LsmVar_SLM::sand]->array(mfi);
        auto clay_arr = lsm_fab_vars[LsmVar_SLM::clay]->array(mfi);
 
        auto s_depth_arr = lsm_fab_vars[LsmVar_SLM::s_depth]->array(mfi);
        auto soil_relax_hgt_arr = lsm_fab_vars[LsmVar_SLM::soil_relax_hgt]->array(mfi);
 
        auto sstxy_arr = sstxy.array(mfi);
 
        auto soiltype_arr = lsm_fab_vars[LsmVar_SLM::soiltype]->array(mfi);
        auto landtype_arr = landtype.const_array(mfi);
        auto LAI_local_arr = LAI.const_array(mfi);
 
        ParallelFor(box3d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
        {
            if (landmask_arr(i, j, 0) == 1)
            {
                if (!wrfinput) {
                    s_depth_arr(i, j, k) = d_dz_lsm[(k*-1)+d_khi_lsm];
                    clay_arr(i, j, k) = d_clay0[(k*-1)+d_khi_lsm];
                    sand_arr(i, j, k) = d_sand0[(k*-1)+d_khi_lsm];
                    soilt_arr(i, j, k) = d_st0[(k*-1)+d_khi_lsm];
                    soilw_arr(i, j, k) = d_sw0[(k*-1)+d_khi_lsm];
                } else {
                    // initialize sand and clay % based on soil type from WRFInput
                    switch (static_cast<int>(soiltype_arr(i, j, d_khi_lsm)))
                    {
                        case 1: // sand
                            sand_arr(i,j,k) = 0.92;
                            clay_arr(i,j,k) = 0.03;
                            break;
                        case 2: // loamy sand
                            sand_arr(i,j,k) = 0.82;
                            clay_arr(i,j,k) = 0.06;
                            break;
                        case 3: // sandy loam
                            sand_arr(i,j,k) = 0.65;
                            clay_arr(i,j,k) = 0.10;
                            break;
                        case 4: // silt loam
                            sand_arr(i,j,k) = 0.20;
                            clay_arr(i,j,k) = 0.15;
                            break;
                        case 5: // silt
                            sand_arr(i,j,k) = 0.08;
                            clay_arr(i,j,k) = 0.12;
                            break;
                        case 6: // loam
                            sand_arr(i,j,k) = 0.40;
                            clay_arr(i,j,k) = 0.20;
                            break;
                        case 7: // sandy clay loam
                            sand_arr(i,j,k) = 0.60;
                            clay_arr(i,j,k) = 0.30;
                            break;
                        case 8: // clay loam
                            sand_arr(i,j,k) = 0.32;
                            clay_arr(i,j,k) = 0.34;
                            break;
                        case 9: // silty clay loam
                            sand_arr(i,j,k) = 0.20;
                            clay_arr(i,j,k) = 0.40;
                            break;
                        case 10: // sandy clay
                            sand_arr(i,j,k) = 0.52;
                            clay_arr(i,j,k) = 0.42;
                            break;
                        case 11: // silty clay
                            sand_arr(i,j,k) = 0.06;
                            clay_arr(i,j,k) = 0.47;
                            break;
                        case 12: // clay
                            sand_arr(i,j,k) = 0.20;
                            clay_arr(i,j,k) = 0.60;
                            break;
                        case 13: // organic material
                            //sand_arr(i,j,k) = 0.0;
                            //clay_arr(i,j,k) = 0.0;
                            sand_arr(i,j,k) = 0.001;
                            clay_arr(i,j,k) = 0.001;
                            break;
                        case 14: // water
                            sand_arr(i,j,k) = 0.001;
                            clay_arr(i,j,k) = 0.001;
                            break;
                        case 15: // bedrock
                            sand_arr(i,j,k) = 0.001;
                            clay_arr(i,j,k) = 0.001;
                            break;
                        case 16: // other (urban/builtup, etc)
                            sand_arr(i,j,k) = 0.001;
                            clay_arr(i,j,k) = 0.001;
                            break;
                        default:
                            sand_arr(i,j,k) = -1.0;
                            clay_arr(i,j,k) = -1.0;
                            break;
                    }
 
                    // convert to percentage
                    sand_arr(i,j,k) *= 100.0;
                    clay_arr(i,j,k) *= 100.0;
                }
 
                soil_relax_hgt_arr(i, j, k) = d_relax[(k*-1)+d_khi_lsm];
 
                // keep the 3D wrfinput copies consistent with the local SLM values if not using wrfinput
                if (!wrfinput && k == d_khi_lsm) {
                    tsurf_arr(i, j, d_khi_lsm) = d_st0[0];
                    tsurf_arr(i, j, 0) = d_st0[0];
                    lai_arr(i, j, d_khi_lsm) = LAI_local_arr(i, j, 0);
                    lai_arr(i, j, 0) = LAI_local_arr(i, j, 0);
                    vegtype_arr(i, j, d_khi_lsm) = landtype_arr(i, j, 0);
                    vegtype_arr(i, j, 0) = landtype_arr(i, j, 0);
                }
 
                // TODO: nrestart conditional here
                // TODO: sstxy - should be ERF surface temp array?
                sstxy_arr(i, j, 0) = soilt_arr(i, j, d_khi_lsm) - d_t00;
            } else {
                sstxy_arr(i, j, 0) = d_tabs_s - d_t00;
            }
        });
    }
 
    // Calculate node_z (depth of the center of each soil layer)
    init_layer_depths();
}

Here is the call graph for this function:

init_soil_vars()

void SLM::init_soil_vars

(

)

Initializes soil properties based on clay and sand percentages

{
    const bool d_param_updated = params_updated;
 
    auto tsurf = lsm_fab_vars[LsmVar_SLM::tsurf];
    for ( MFIter mfi(*tsurf, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box3d = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
 
        auto sand_arr = lsm_fab_vars[LsmVar_SLM::sand]->const_array(mfi);
        auto clay_arr = lsm_fab_vars[LsmVar_SLM::clay]->const_array(mfi);
 
        auto w_s_FC_arr = lsm_fab_vars[LsmVar_SLM::w_s_FC]->array(mfi);
        auto w_s_WP_arr = lsm_fab_vars[LsmVar_SLM::w_s_WP]->array(mfi);
        auto sst_capa_arr = lsm_fab_vars[LsmVar_SLM::sst_capa]->array(mfi);
        auto sst_cond_arr = lsm_fab_vars[LsmVar_SLM::sst_cond]->array(mfi);
        auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->array(mfi);
        auto theta_FC_arr = lsm_fab_vars[LsmVar_SLM::theta_FC]->array(mfi);
        auto theta_WP_arr = lsm_fab_vars[LsmVar_SLM::theta_WP]->array(mfi);
        auto m_pot_sat_arr = lsm_fab_vars[LsmVar_SLM::m_pot_sat]->array(mfi);
        auto Bconst_arr = lsm_fab_vars[LsmVar_SLM::Bconst]->array(mfi);
        auto ks_arr = lsm_fab_vars[LsmVar_SLM::ks]->array(mfi);
 
        ParallelFor(box3d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
        {
            if (landmask_arr(i, j, 0) == 1)
            {
                if (!d_param_updated) {
                    // compute the initial values
                    const amrex::Real sand_per = sand_arr(i, j, k); // sand percentage
 
                    // soil solids thermal conductivity (Johansen 1975)
                    //  quartz (= SAND content) thermal conductivity = 7.7 W/mK
                    const amrex::Real mineral_tcond = sand_per > 20.0 ? two : three; // thermal conductivity of other minerals [W/mK]
                    sst_cond_arr(i, j, k) = std::pow(amrex::Real(7.7), sand_per * amrex::Real(0.01)) * std::pow(mineral_tcond, one - sand_per * amrex::Real(0.01));
 
                    // Calculated following Cosby et al. 1984 ( hydraulic properties)
                    // hydraulic conductivity at satuation , mm/s
                    ks_arr(i, j, k) = std::pow(amrex::Real(10.0), amrex::Real(0.0153)*sand_per - amrex::Real(0.884)) * (amrex::Real(25.4) / amrex::Real(3600.0)); // [mm/s] from [inch/hr]
 
                    // constant B
                    Bconst_arr(i, j, k) = 0.159 * clay_arr(i, j, k) + 2.91;
 
                    // porosity (or saturation volumetric water content)
                    poro_soil_arr(i, j, k) = -0.00126 * sand_per + 0.489; // volume/volume
 
                    // moisture potential at saturation, [mm]
                    m_pot_sat_arr(i, j, k) = std::min(amrex::Real(-150.0), -amrex::Real(10.0) * std::pow(amrex::Real(10.0), amrex::Real(1.88) - amrex::Real(0.0131)*sand_per)); // [mm] from [cm]
 
                    // soil heat capacity, [J/m^3/K]
                    //  Following de Vries(1963) using SAND=34% CLAY=63%
                    sst_capa_arr(i, j, k) = 1.0e6 * (2.128*sand_per + 2.385*clay_arr(i, j, k)) / (sand_per + clay_arr(i, j, k));
 
                    // volumetric moisture content at field capacity
                    // field capacity is assumed to be the occasion when hydraulic conductivity is 0.1mm/d
                    theta_FC_arr(i, j, k) = poro_soil_arr(i, j, k) * std::pow((amrex::Real(0.1) / amrex::Real(86400.0) / ks_arr(i, j, k)), one / (two * Bconst_arr(i, j, k) + three));
 
                    // volumetric moisture content at wilting point
                    theta_WP_arr(i, j, k) = poro_soil_arr(i, j, k) * std::pow((amrex::Real(-150000.0) / m_pot_sat_arr(i, j, k)), -one / Bconst_arr(i, j, k));
                }
 
                // soil wetness at field capacity
                w_s_FC_arr(i, j, k) = theta_FC_arr(i, j, k) / poro_soil_arr(i, j, k);
 
                // soil wetness at wilting point
                w_s_WP_arr(i, j, k) = theta_WP_arr(i, j, k) / poro_soil_arr(i, j, k);
            }
        });
    }
}

Here is the call graph for this function:

init_wrfinput_vars()

void SLM::init_wrfinput_vars

(

)

Initializes local SLM fields from WRFInput data.

{
    if (wrfinput_initialized) {
        return;
    }
 
    // TODO: fix - WRFinput sets 3D MFs in lsm_data - these need to be copied into SLM local 2D MFs
    const int d_khi_lsm = khi_lsm;
 
    const int isnature = 14; // nature cell type to use for urban cells
    const int isurban  = 13; // urban cell type
    const int islake   = 21; // lake cell
    amrex::ignore_unused(isurban);
 
    const auto& input_vegtype = *lsm_fab_vars[LsmVar_SLM::vegtype];
    const int input_vegtype_min = static_cast<int>(input_vegtype.min(0));
    const int input_vegtype_max = static_cast<int>(input_vegtype.max(0));
    if (input_vegtype_min < 0 || input_vegtype_max > 21) {
        amrex::Abort("SLM: WRF vegetation categories must be in the supported range [0, 21], "
                     "where 0 denotes water/non-land! min = " +
                     std::to_string(input_vegtype_min) + ", max = " +
                     std::to_string(input_vegtype_max));
    }
 
    for (MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const Box bx2d = mfi.tilebox();
 
        auto vegtype_arr = lsm_fab_vars[LsmVar_SLM::vegtype]->array(mfi);
        auto in_lai_arr = lsm_fab_vars[LsmVar_SLM::lai]->const_array(mfi);
        auto in_tsk_arr = lsm_fab_vars[LsmVar_SLM::tsurf]->array(mfi);
        auto in_tsoil_arr = lsm_fab_vars[LsmVar_SLM::soilt]->array(mfi);
        auto in_vegfrac_arr = lsm_fab_vars[LsmVar_SLM::veg_frac]->array(mfi);
        auto in_vegfrac_min_arr = lsm_fab_vars[LsmVar_SLM::veg_frac_min]->array(mfi);
        auto in_vegfrac_max_arr = lsm_fab_vars[LsmVar_SLM::veg_frac_max]->array(mfi);
 
        auto emis_sfc_arr = lsm_fab_vars[LsmVar_SLM::emis_sfc]->array(mfi);
        auto alb_vis_sfc_arr = lsm_fab_vars[LsmVar_SLM::alb_vis_sfc]->array(mfi);
        auto alb_nir_sfc_arr = lsm_fab_vars[LsmVar_SLM::alb_nir_sfc]->array(mfi);
        auto alb_vis_sfc_dif_arr = lsm_fab_vars[LsmVar_SLM::alb_vis_sfc_diff]->array(mfi);
        auto alb_nir_sfc_dif_arr = lsm_fab_vars[LsmVar_SLM::alb_nir_sfc_diff]->array(mfi);
 
        auto landmask_arr = landmask.array(mfi);
        auto landtype_arr = landtype.array(mfi);
        auto lai_arr = LAI.array(mfi);
        auto sstxy_arr = sstxy.array(mfi);
        auto tskin_arr = t_skin.array(mfi);
        auto t_ground_skin_arr = t_ground_skin.array(mfi);
        auto vegetype_arr = vegetype.array(mfi);
        auto vege_YES_arr = vege_YES.array(mfi);
 
        const bool d_use_wrf_lai = use_wrf_lai;
        const Real d_urban_veg_frac = d_use_wrf_lai ? param_table[isnature - 1][1] : 0.0;
 
        ParallelFor(bx2d, [=] AMREX_GPU_DEVICE(int i, int j, int) noexcept
        {
            landtype_arr(i, j, 0) = static_cast<int>(vegtype_arr(i, j, d_khi_lsm));
            lai_arr(i, j, 0) = in_lai_arr(i, j, d_khi_lsm);
 
            const amrex::Real tsk = in_tsk_arr(i, j, d_khi_lsm);
            sstxy_arr(i, j, 0) = tsk;
            in_tsk_arr(i, j, 0) = tsk;
            tskin_arr(i, j, 0) = tsk;
            t_ground_skin_arr(i, j, 0) = in_tsoil_arr(i, j, d_khi_lsm);
 
            in_vegfrac_arr(i, j, d_khi_lsm) *= 0.01;
            in_vegfrac_arr(i, j, 0) = in_vegfrac_arr(i, j, d_khi_lsm);
            in_vegfrac_min_arr(i, j, d_khi_lsm) *= 0.01;
            in_vegfrac_min_arr(i, j, 0) = in_vegfrac_min_arr(i, j, d_khi_lsm);
            in_vegfrac_max_arr(i, j, d_khi_lsm) *= 0.01;
            in_vegfrac_max_arr(i, j, 0) = in_vegfrac_max_arr(i, j, d_khi_lsm);
 
            if (landtype_arr(i, j, 0) == 0 ||
                landtype_arr(i, j, 0) == 17 || landtype_arr(i, j, 0) == islake) {
                //amrex::Print() << "     -- water cell - setting landtype=0 landmask=0" << std::endl;
                landmask_arr(i, j, 0) = 0;
                landtype_arr(i, j, 0) = 0;
                vegetype_arr(i, j, 0) = 0;
                vege_YES_arr(i, j, 0) = zero;
                in_tsoil_arr(i, j, d_khi_lsm) = 273.16;
 
                emis_sfc_arr(i, j, 0) = 0.98;
                emis_sfc_arr(i, j, d_khi_lsm) = emis_sfc_arr(i, j, 0);
 
                alb_vis_sfc_arr(i, j, 0) = 0.06;
                alb_nir_sfc_arr(i, j, 0) = 0.06;
                alb_vis_sfc_dif_arr(i, j, 0) = 0.06;
                alb_nir_sfc_dif_arr(i, j, 0) = 0.06;
 
                alb_vis_sfc_arr(i, j, d_khi_lsm) = alb_vis_sfc_arr(i, j, 0);
                alb_nir_sfc_arr(i, j, d_khi_lsm) = alb_nir_sfc_arr(i, j, 0);
                alb_vis_sfc_dif_arr(i, j, d_khi_lsm) = alb_vis_sfc_dif_arr(i, j, 0);
                alb_nir_sfc_dif_arr(i, j, d_khi_lsm) = alb_nir_sfc_dif_arr(i, j, 0);
 
            } else if (landtype_arr(i, j, 0) > 16) {
                // amrex::Print() << "     -- urban cell (i = " << i << " j = " << j << ") - setting landtype=" << isnature << " (orig landtype = " << landtype_arr(i, j, 0) << ")" << std::endl;
                // for urban cells, set as a nature landtype for the non-building part
                landtype_arr(i, j, 0) = isnature;
                if (d_use_wrf_lai) {
                    // set the vegetation frac
                    in_vegfrac_arr(i, j, 0) = d_urban_veg_frac;
                }
                //landtype_arr(i, j, 0) = isurban;
            }
 
            // Keep the WRF vegetation class synchronized with the normalized SLM class.
            vegtype_arr(i, j, d_khi_lsm) = landtype_arr(i, j, 0);
            vegtype_arr(i, j, 0) = landtype_arr(i, j, 0);
        });
    }
 
    // If using WRFInput, SLM init needs to be delayed here to use correct values set from WRFInput
    slm_init();
 
    // Convert soil moisture from wrfinput to soil wetness for SLM
    for (MFIter mfi(*lsm_fab_vars[LsmVar_SLM::soilw], TileNoZ()); mfi.isValid(); ++mfi) {
        const Box box = mfi.tilebox();
        auto landmask_arr = landmask.const_array(mfi);
        auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
        auto wsoil_arr = lsm_fab_vars[LsmVar_SLM::soilw]->array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int k) noexcept
        {
            if (landmask_arr(i, j, 0) == 1) {
                wsoil_arr(i, j, k) /= poro_soil_arr(i, j, k);
            }
        });
    }
 
    init_slm_vars();
    wrfinput_initialized = true;
}

Referenced by Advance(), and Update_Lsm_Vars().

Here is the call graph for this function:

Here is the caller graph for this function:

initialize_processed_state()

void SLM::initialize_processed_state

(

const bool

preserve_checkpoint_fields = false

)

Rebuilds SLM-local fields after transferring an evolved state.

Reconstructs local SLM fields after a processed-state transfer.

{
    const int d_khi_lsm = khi_lsm;
    const int islake = 21;
 
    MultiFab saved_tsurf = lsm_fab_vars[LsmVar_SLM::tsurf]->deepCopy();
    MultiFab saved_soilt = lsm_fab_vars[LsmVar_SLM::soilt]->deepCopy();
    MultiFab saved_soilw = lsm_fab_vars[LsmVar_SLM::soilw]->deepCopy();
    Vector<std::unique_ptr<MultiFab>> saved_data;
    Vector<std::unique_ptr<MultiFab>> saved_unmapped;
    if (preserve_checkpoint_fields) {
        saved_data.resize(m_lsm_data_size);
        for (int ivar = 0; ivar < m_lsm_data_size; ++ivar) {
            saved_data[ivar] = std::make_unique<MultiFab>(
                lsm_fab_vars[LsmDataMap[ivar]]->deepCopy());
        }
        saved_unmapped.resize(unmapped_fields.size());
        for (int ivar = 0; ivar < static_cast<int>(unmapped_fields.size()); ++ivar) {
            saved_unmapped[ivar] = std::make_unique<MultiFab>(
                lsm_fab_vars[unmapped_fields[ivar]]->deepCopy());
        }
    }
 
    for (MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const Box box = mfi.tilebox();
        auto vegtype_arr = lsm_fab_vars[LsmVar_SLM::vegtype]->const_array(mfi);
        auto lai_in_arr = lsm_fab_vars[LsmVar_SLM::lai]->const_array(mfi);
        auto tsurf_arr = lsm_fab_vars[LsmVar_SLM::tsurf]->const_array(mfi);
 
        auto landmask_arr = landmask.array(mfi);
        auto landtype_arr = landtype.array(mfi);
        auto lai_arr = LAI.array(mfi);
        auto sstxy_arr = sstxy.array(mfi);
        auto tskin_arr = t_skin.array(mfi);
        auto vegetype_arr = vegetype.array(mfi);
        auto vege_yes_arr = vege_YES.array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int) noexcept {
            const int input_landtype = static_cast<int>(vegtype_arr(i, j, d_khi_lsm));
            const bool water = input_landtype <= 0 || input_landtype == 17 || input_landtype == islake;
            const int normalized_landtype = (input_landtype > 16) ? 14 : input_landtype;
 
            landmask_arr(i, j, 0) = water ? 0 : 1;
            landtype_arr(i, j, 0) = water ? 0 : normalized_landtype;
            lai_arr(i, j, 0) = lai_in_arr(i, j, d_khi_lsm);
            sstxy_arr(i, j, 0) = tsurf_arr(i, j, d_khi_lsm);
            tskin_arr(i, j, 0) = tsurf_arr(i, j, d_khi_lsm);
            vegetype_arr(i, j, 0) = water ? 0 : 1;
            vege_yes_arr(i, j, 0) = water ? 0.0 : 1.0;
        });
    }
 
    slm_init();
 
    const IntVect state_ng = lsm_fab_vars[LsmVar_SLM::tsurf]->nGrowVect();
    MultiFab::Copy(*lsm_fab_vars[LsmVar_SLM::tsurf], saved_tsurf, 0, 0, 1, state_ng);
    MultiFab::Copy(*lsm_fab_vars[LsmVar_SLM::soilt], saved_soilt, 0, 0, 1, state_ng);
    MultiFab::Copy(*lsm_fab_vars[LsmVar_SLM::soilw], saved_soilw, 0, 0, 1, state_ng);
 
    for (MFIter mfi(*lsm_fab_vars[LsmVar_SLM::tsurf], TileNoZ()); mfi.isValid(); ++mfi) {
        const Box box = mfi.tilebox().makeSlab(2, 0);
        auto tsurf_arr = lsm_fab_vars[LsmVar_SLM::tsurf]->array(mfi);
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int) noexcept {
            tsurf_arr(i, j, 0) = tsurf_arr(i, j, d_khi_lsm);
        });
    }
 
    init_slm_vars();
 
    if (preserve_checkpoint_fields) {
        for (int ivar = 0; ivar < m_lsm_data_size; ++ivar) {
            const IntVect ng = lsm_fab_vars[LsmDataMap[ivar]]->nGrowVect();
            MultiFab::Copy(*lsm_fab_vars[LsmDataMap[ivar]], *saved_data[ivar],
                           0, 0, 1, ng);
        }
        for (int ivar = 0; ivar < static_cast<int>(unmapped_fields.size()); ++ivar) {
            const IntVect ng = lsm_fab_vars[unmapped_fields[ivar]]->nGrowVect();
            MultiFab::Copy(*lsm_fab_vars[unmapped_fields[ivar]], *saved_unmapped[ivar],
                           0, 0, 1, ng);
        }
    }
}

Here is the call graph for this function:

initialize_surface_outputs()

void SLM::initialize_surface_outputs

(

)

Initializes diagnostics and radiation coupling fields from the SLM state.

{
    const int d_khi_lsm = khi_lsm;
 
    for (MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
        auto LAI_arr = LAI.const_array(mfi);
        auto phi_1_arr = phi_1.const_array(mfi);
        auto phi_2_arr = phi_2.const_array(mfi);
        auto albedovis_v_arr = albedovis_v.const_array(mfi);
        auto albedonir_v_arr = albedonir_v.const_array(mfi);
        auto albedovis_s_arr = albedovis_s.const_array(mfi);
        auto albedonir_s_arr = albedonir_s.const_array(mfi);
        auto vegetype_arr = vegetype.const_array(mfi);
        auto IR_emis_vege_arr = IR_emis_vege.const_array(mfi);
        auto IR_emis_soil_arr = IR_emis_soil.const_array(mfi);
        auto veg_frac_arr = lsm_fab_vars[LsmVar_SLM::veg_frac]->array(mfi);
        auto coszrsxy_arr = lsm_fab_vars[LsmVar_SLM::coszrsxy]->const_array(mfi);
        auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
        auto t_canop_arr = t_canop.const_array(mfi);
        auto mw_arr = mw.const_array(mfi);
        auto t_cas_arr = t_cas.const_array(mfi);
        auto q_cas_arr = q_cas.const_array(mfi);
        auto q_gr_arr = q_gr.const_array(mfi);
        auto t_ground_skin_arr = t_ground_skin.const_array(mfi);
        auto tsurf_arr = lsm_fab_vars[LsmVar_SLM::tsurf]->array(mfi);
        auto t_skin_arr = t_skin.array(mfi);
        auto t_sfc_arr = t_sfc.array(mfi);
        auto q_sfc_arr = q_sfc.array(mfi);
        auto tveg_arr = lsm_fab_vars[LsmVar_SLM::tv]->array(mfi);
        auto mveg_arr = lsm_fab_vars[LsmVar_SLM::mv]->array(mfi);
        auto emis_sfc_arr = lsm_fab_vars[LsmVar_SLM::emis_sfc]->array(mfi);
        auto alb_nir_sfc_arr = lsm_fab_vars[LsmVar_SLM::alb_nir_sfc]->array(mfi);
        auto alb_vis_sfc_arr = lsm_fab_vars[LsmVar_SLM::alb_vis_sfc]->array(mfi);
        auto alb_nir_sfc_diff_arr = lsm_fab_vars[LsmVar_SLM::alb_nir_sfc_diff]->array(mfi);
        auto alb_vis_sfc_diff_arr = lsm_fab_vars[LsmVar_SLM::alb_vis_sfc_diff]->array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            const amrex::Real cosz = coszrsxy_arr(i, j, 0);
            const amrex::Real direct_extinction = phi_1_arr(i, j, 0) / std::max(amrex::Real(0.01), cosz) + phi_2_arr(i, j, 0);
            const amrex::Real diffuse_extinction = phi_1_arr(i, j, 0) + phi_2_arr(i, j, 0);
            const amrex::Real explai = std::exp(-direct_extinction * LAI_arr(i, j, 0));
            const amrex::Real explai0 = std::exp(-diffuse_extinction * LAI_arr(i, j, 0));
            const amrex::Real wetfactor = one - myhalf * soilw_arr(i, j, d_khi_lsm);
 
            const amrex::Real veg_frac = std::min(std::max(veg_frac_arr(i, j, 0), amrex::Real(zero)), amrex::Real(one));
            const amrex::Real soil_nir = albedonir_s_arr(i, j, 0) * wetfactor;
            const amrex::Real soil_vis = albedovis_s_arr(i, j, 0) * wetfactor;
            const amrex::Real canopy_nir = albedonir_v_arr(i, j, 0) * (1.0 - explai) + soil_nir * explai;
            const amrex::Real canopy_vis = albedovis_v_arr(i, j, 0) * (1.0 - explai) + soil_vis * explai;
            const amrex::Real canopy_nir_diff = albedonir_v_arr(i, j, 0) * (1.0 - explai0) + soil_nir * explai0;
            const amrex::Real canopy_vis_diff = albedovis_v_arr(i, j, 0) * (1.0 - explai0) + soil_vis * explai0;
            const amrex::Real alb_nir = veg_frac * canopy_nir + (1.0 - veg_frac) * soil_nir;
            const amrex::Real alb_vis = veg_frac * canopy_vis + (1.0 - veg_frac) * soil_vis;
            const amrex::Real alb_nir_diff = veg_frac * canopy_nir_diff + (1.0 - veg_frac) * soil_nir;
            const amrex::Real alb_vis_diff = veg_frac * canopy_vis_diff + (1.0 - veg_frac) * soil_vis;
 
            t_skin_arr(i, j, 0) = tsurf_arr(i, j, 0);
            tsurf_arr(i, j, d_khi_lsm) = tsurf_arr(i, j, 0);
            veg_frac_arr(i, j, d_khi_lsm) = veg_frac;
            tveg_arr(i, j, 0) = t_canop_arr(i, j, 0);
            tveg_arr(i, j, d_khi_lsm) = t_canop_arr(i, j, 0);
            mveg_arr(i, j, 0) = mw_arr(i, j, 0);
            mveg_arr(i, j, d_khi_lsm) = mw_arr(i, j, 0);
 
            if (landmask_arr(i, j, 0) == 1 && vegetype_arr(i, j, 0) == 1) {
                t_sfc_arr(i, j, 0) = t_cas_arr(i, j, 0);
                q_sfc_arr(i, j, 0) = q_cas_arr(i, j, 0);
            } else {
                t_sfc_arr(i, j, 0) = t_ground_skin_arr(i, j, 0);
                q_sfc_arr(i, j, 0) = q_gr_arr(i, j, 0);
            }
 
            emis_sfc_arr(i, j, 0) = IR_emis_vege_arr(i, j, 0) * veg_frac + IR_emis_soil_arr(i, j, 0) * (1.0 - veg_frac);
            alb_nir_sfc_arr(i, j, 0) = alb_nir;
            alb_vis_sfc_arr(i, j, 0) = alb_vis;
            alb_nir_sfc_diff_arr(i, j, 0) = alb_nir_diff;
            alb_vis_sfc_diff_arr(i, j, 0) = alb_vis_diff;
 
            emis_sfc_arr(i, j, d_khi_lsm) = emis_sfc_arr(i, j, 0);
            alb_nir_sfc_arr(i, j, d_khi_lsm) = alb_nir_sfc_arr(i, j, 0);
            alb_vis_sfc_arr(i, j, d_khi_lsm) = alb_vis_sfc_arr(i, j, 0);
            alb_nir_sfc_diff_arr(i, j, d_khi_lsm) = alb_nir_sfc_diff_arr(i, j, 0);
            alb_vis_sfc_diff_arr(i, j, d_khi_lsm) = alb_vis_sfc_diff_arr(i, j, 0);
        });
    }
}

Here is the call graph for this function:

initialize_zrefxy()

void SLM::initialize_zrefxy

(

)

Initializes the canopy-adjusted reference height on the current grid.

{
    const Real zlo = m_geom.ProbLo(2);
    const Real dz = m_geom.CellSize(2);
    for (MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const Box& xybx = mfi.growntilebox(0);
        const Array4<const Real>& z_nd_arr = use_terrain
            ? z_phys_nd->const_array(mfi) : Array4<Real>{};
        auto ztop_arr = ztop.array(mfi);
        auto zrefxy_arr = zrefxy.array(mfi);
        auto landmask_arr = landmask.const_array(mfi);
 
        ParallelFor(xybx, [=] AMREX_GPU_DEVICE(int i, int j, int) noexcept {
            if (landmask_arr(i, j, 0) == 1) {
                const Real znd = z_nd_arr ? Compute_Zrel_AtCellCenter(i, j, 0, z_nd_arr)
                                           : zlo + myhalf * dz;
                zrefxy_arr(i, j, 0) = ztop_arr(i, j, 0) + znd;
            }
        });
    }
}

Referenced by Advance().

Here is the call graph for this function:

Here is the caller graph for this function:

linear_interp()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE amrex::Real SLM::linear_interp ( const amrex::Real  t0, const amrex::Real  t1, const amrex::Real  t, const amrex::Real  x, const amrex::Real  y  )

static

{
  // returns a value that is linearly interpolated between x and y at time t. x
  // is at t=t0, y is at t=t1.
  if (t0 == t1 || t > t1) {
    return y;
  }
  const amrex::Real dt = (t - t0) / (t1 - t0);
  return x + (y - x) * dt;
}

load_builtin_radiation_parameters()

void SLM::load_builtin_radiation_parameters

(

)

Loads built-in Noah-MP radiation lookup values for idealized SLM cases.

Loads the Noah-MP radiation lookup values used when no parameter file is supplied.

{
    auto load_params = [](auto& params, const char* name, const auto& values)
    {
        auto d_var = std::make_unique<Gpu::DeviceVector<Real>>(values.size());
        auto* d_var_ptr = d_var.get();
        Gpu::copyAsync(Gpu::hostToDevice, values.data(), values.data() + values.size(), d_var_ptr->data());
        params.emplace(name, std::move(d_var));
    };
 
    load_params(d_veg_params, "cwpvt", SLMDefaultParams::cwpvt);
    load_params(d_veg_params, "den", SLMDefaultParams::den);
    load_params(d_veg_params, "hvb", SLMDefaultParams::hvb);
    load_params(d_veg_params, "rc", SLMDefaultParams::rc);
    load_params(d_veg_params, "rhol_vis", SLMDefaultParams::rhol_vis);
    load_params(d_veg_params, "rhol_nir", SLMDefaultParams::rhol_nir);
    load_params(d_veg_params, "rhos_vis", SLMDefaultParams::rhos_vis);
    load_params(d_veg_params, "rhos_nir", SLMDefaultParams::rhos_nir);
    load_params(d_veg_params, "taul_vis", SLMDefaultParams::taul_vis);
    load_params(d_veg_params, "taul_nir", SLMDefaultParams::taul_nir);
    load_params(d_veg_params, "taus_vis", SLMDefaultParams::taus_vis);
    load_params(d_veg_params, "taus_nir", SLMDefaultParams::taus_nir);
 
    load_params(d_rad_params, "albsat_vis", SLMDefaultParams::albsat_vis);
    load_params(d_rad_params, "albsat_nir", SLMDefaultParams::albsat_nir);
    load_params(d_rad_params, "albdry_vis", SLMDefaultParams::albdry_vis);
    load_params(d_rad_params, "albdry_nir", SLMDefaultParams::albdry_nir);
    load_params(d_rad_params, "alblak", SLMDefaultParams::alblak);
    load_params(d_rad_params, "omegas", SLMDefaultParams::omegas);
 
    Gpu::streamSynchronize();
    amrex::Print() << " SLM: Using built-in Noah-MP radiation parameters" << std::endl;
}

Lsm_Atmos_Geom()

amrex::Geometry SLM::Lsm_Atmos_Geom ( )

inlineoverridevirtual

Returns the atmospheric geometry used by SLM coupling fields.

Reimplemented from NullSurf.

{ return m_geom; }

Lsm_Data_Ptr()

amrex::MultiFab* SLM::Lsm_Data_Ptr ( const int &  varIdx )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx < SLM::m_lsm_data_size && varIdx >= 0);
        int lsmIdx = LsmDataMap[varIdx];
        AMREX_ALWAYS_ASSERT(lsmIdx < LsmVar_SLM::NumVars && lsmIdx>=0);
        return lsm_fab_vars[lsmIdx].get();
    }

Here is the call graph for this function:

Lsm_Data_Size()

int SLM::Lsm_Data_Size ( )

inlineoverridevirtual

Reimplemented from NullSurf.

{ return SLM::m_lsm_data_size; }

Lsm_DataIndex()

int SLM::Lsm_DataIndex ( const std::string &  varname )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        int varIdx = -1;
        std::string lc_varname = amrex::toLower(varname);
        for (int idx(0); idx<SLM::m_lsm_data_size; ++idx) {
            if (lc_varname == amrex::toLower(Lsm_DataName(idx))) {
                varIdx = idx;
            }
        }
        AMREX_ASSERT(varIdx != -1); // no name found
        return varIdx;
    }

Here is the call graph for this function:

Lsm_DataName()

std::string SLM::Lsm_DataName ( const int &  varIdx )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx < SLM::m_lsm_data_size && varIdx >= 0);
        return LsmDataName[varIdx];
    }

Referenced by Lsm_DataIndex().

Here is the call graph for this function:

Here is the caller graph for this function:

Lsm_Flux_Ptr()

amrex::MultiFab* SLM::Lsm_Flux_Ptr ( const int &  varIdx )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx < SLM::m_lsm_flux_size && varIdx >= 0);
        int lsmIdx = LsmFluxMap[varIdx];
        AMREX_ALWAYS_ASSERT(lsmIdx < LsmFlux_SLM::NumVars && lsmIdx>=0);
        return lsm_fab_flux[lsmIdx].get();
    }

Here is the call graph for this function:

Lsm_Flux_Size()

int SLM::Lsm_Flux_Size ( )

inlineoverridevirtual

Reimplemented from NullSurf.

{ return SLM::m_lsm_flux_size; }

Lsm_FluxIndex()

int SLM::Lsm_FluxIndex ( const std::string &  varname )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        int varIdx = -1;
        std::string lc_varname = amrex::toLower(varname);
        for (int idx(0); idx<SLM::m_lsm_flux_size; ++idx) {
            if (lc_varname == amrex::toLower(Lsm_FluxName(idx))) {
                varIdx = idx;
            }
        }
        AMREX_ALWAYS_ASSERT(varIdx != -1); // no name found
        return varIdx;
    }

Here is the call graph for this function:

Lsm_FluxName()

std::string SLM::Lsm_FluxName ( const int &  varIdx )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx < SLM::m_lsm_flux_size && varIdx >= 0);
        return LsmFluxName[varIdx];
    }

Referenced by Lsm_FluxIndex().

Here is the call graph for this function:

Here is the caller graph for this function:

Lsm_Geom()

amrex::Geometry SLM::Lsm_Geom ( )

inlineoverridevirtual

Reimplemented from NullSurf.

{ return m_lsm_geom; }

Lsm_Interpolate_From_Source()

void SLM::Lsm_Interpolate_From_Source ( const amrex::Geometry &  source_geom, const amrex::Geometry &  source_lsm_geom, const amrex::IntVect &  ref_ratio, LSMTransferMode  mode  )

overridevirtual

Transfers exposed state from a source AMR level.

Transfers SLM fields from a source AMR level.

Reimplemented from NullSurf.

{
    AMREX_ALWAYS_ASSERT(static_cast<int>(source_data.size()) == m_lsm_data_size);
    AMREX_ALWAYS_ASSERT(static_cast<int>(source_flux.size()) == m_lsm_flux_size);
    AMREX_ALWAYS_ASSERT(source_unmapped.size() == unmapped_fields.size());
 
    const IntVect rr2d(ref_ratio[0], ref_ratio[1], 1);
    for (int ivar = 0; ivar < m_lsm_data_size; ++ivar) {
        AMREX_ALWAYS_ASSERT(source_data[ivar] != nullptr);
        InterpFromCoarseLevel(*lsm_fab_vars[LsmDataMap[ivar]],
                              lsm_fab_vars[LsmDataMap[ivar]]->nGrowVect(),
                              IntVect(0,0,0), *source_data[ivar], 0, 0, 1,
                              source_lsm_geom, m_lsm_geom, rr2d,
                              &cell_cons_interp, m_domain_bcs_type,
                              BCVars::cons_bc);
    }
 
    for (int ivar = 0; ivar < m_lsm_flux_size; ++ivar) {
        AMREX_ALWAYS_ASSERT(source_flux[ivar] != nullptr);
        InterpFromCoarseLevel(*lsm_fab_flux[LsmFluxMap[ivar]],
                              lsm_fab_flux[LsmFluxMap[ivar]]->nGrowVect(),
                              IntVect(0,0,0), *source_flux[ivar], 0, 0, 1,
                              source_geom, m_geom, rr2d,
                              &cell_cons_interp, m_domain_bcs_type,
                              BCVars::cons_bc);
    }
 
    for (int ivar = 0; ivar < static_cast<int>(unmapped_fields.size()); ++ivar) {
        AMREX_ALWAYS_ASSERT(source_unmapped[ivar] != nullptr);
        InterpFromCoarseLevel(*lsm_fab_vars[unmapped_fields[ivar]],
                              lsm_fab_vars[unmapped_fields[ivar]]->nGrowVect(),
                              IntVect(0,0,0), *source_unmapped[ivar], 0, 0, 1,
                              source_lsm_geom, m_lsm_geom, rr2d,
                              &cell_cons_interp, m_domain_bcs_type,
                              BCVars::cons_bc);
    }
 
    if (mode == LSMTransferMode::RawInput) {
        first_step = true;
        wrfinput_initialized = false;
    } else {
        initialize_processed_state();
        initialize_zrefxy();
        first_step = false;
        wrfinput_initialized = use_wrfinput;
    }
}

Here is the call graph for this function:

Lsm_Regrid_Level()

void SLM::Lsm_Regrid_Level ( const int &  lev, const amrex::MultiFab &  cons_in, const amrex::MultiFab &  u_in, const amrex::MultiFab &  v_in, const amrex::Geometry &  geom, const amrex::Geometry &  geom0, amrex::Vector< amrex::BCRec > &  domain_bcs_type, amrex::IntVect &  refRatio, const amrex::Real &  dt, std::unique_ptr< amrex::MultiFab > &  z_phys_nd_in, amrex::Vector< amrex::Vector< std::string >> &  nc_init_file, const amrex::Geometry &  source_geom, const amrex::Geometry &  source_lsm_geom, const amrex::IntVect &  source_ref_ratio, const bool  has_source  )

overridevirtual

Rebuilds SLM arrays on a remade atmospheric grid and transfers state.

Reimplemented from NullSurf.

{
    const Geometry old_geom = m_geom;
    const Geometry old_lsm_geom = m_lsm_geom;
    Vector<std::unique_ptr<MultiFab>> saved_data(m_lsm_data_size);
    Vector<std::unique_ptr<MultiFab>> saved_flux(m_lsm_flux_size);
    Vector<std::unique_ptr<MultiFab>> saved_unmapped(unmapped_fields.size());
 
    for (int ivar = 0; ivar < m_lsm_data_size; ++ivar) {
        saved_data[ivar] = std::make_unique<MultiFab>(Lsm_Data_Ptr(ivar)->deepCopy());
    }
    for (int ivar = 0; ivar < m_lsm_flux_size; ++ivar) {
        saved_flux[ivar] = std::make_unique<MultiFab>(Lsm_Flux_Ptr(ivar)->deepCopy());
    }
    for (int ivar = 0; ivar < static_cast<int>(unmapped_fields.size()); ++ivar) {
        saved_unmapped[ivar] = std::make_unique<MultiFab>(
            lsm_fab_vars[unmapped_fields[ivar]]->deepCopy());
    }
 
    Init(lev, cons_in, u_in, v_in, geom, geom0, domain_bcs_type,
         refRatio, dt, z_phys_nd_in, nc_init_file);
 
    if (has_source) {
        Lsm_Interpolate_From_Source(source_geom, source_lsm_geom,
                                    source_ref_ratio, LSMTransferMode::ProcessedState);
 
        for (int ivar = 0; ivar < m_lsm_data_size; ++ivar) {
            lsm_fab_vars[LsmDataMap[ivar]]->ParallelCopy(*saved_data[ivar], 0, 0, 1);
        }
        for (int ivar = 0; ivar < m_lsm_flux_size; ++ivar) {
            lsm_fab_flux[LsmFluxMap[ivar]]->ParallelCopy(*saved_flux[ivar], 0, 0, 1);
        }
    } else {
        source_data.resize(m_lsm_data_size, nullptr);
        source_flux.resize(m_lsm_flux_size, nullptr);
        source_unmapped.resize(unmapped_fields.size(), nullptr);
        for (int ivar = 0; ivar < m_lsm_data_size; ++ivar) {
            source_data[ivar] = saved_data[ivar].get();
        }
        for (int ivar = 0; ivar < m_lsm_flux_size; ++ivar) {
            source_flux[ivar] = saved_flux[ivar].get();
        }
        for (int ivar = 0; ivar < static_cast<int>(unmapped_fields.size()); ++ivar) {
            source_unmapped[ivar] = saved_unmapped[ivar].get();
        }
 
        Lsm_Interpolate_From_Source(old_geom, old_lsm_geom,
                                    IntVect(1), LSMTransferMode::ProcessedState);
    }
 
    // ERF checkpoints the mapped fields and this registry of otherwise-private
    // SLM fields. Restore the latter after rebuilding the level so a remake
    // does not discard state which ERF does not expose through lsm_data.
    for (int ivar = 0; ivar < static_cast<int>(unmapped_fields.size()); ++ivar) {
        lsm_fab_vars[unmapped_fields[ivar]]->ParallelCopy(*saved_unmapped[ivar], 0, 0, 1);
    }
    initialize_processed_state(true);
    initialize_zrefxy();
 
    source_data.clear();
    source_flux.clear();
    source_unmapped.clear();
}

Lsm_Set_Source_Data_Ptr()

void SLM::Lsm_Set_Source_Data_Ptr ( const int &  varIdx, amrex::MultiFab *  source_data_ptr  )

inlineoverridevirtual

Registers an exposed source data field.

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx >= 0 && varIdx < m_lsm_data_size);
        if (static_cast<int>(source_data.size()) != m_lsm_data_size) {
            source_data.resize(m_lsm_data_size, nullptr);
        }
        source_data[varIdx] = source_data_ptr;
    }

Here is the call graph for this function:

Lsm_Set_Source_Flux_Ptr()

void SLM::Lsm_Set_Source_Flux_Ptr ( const int &  varIdx, amrex::MultiFab *  source_flux_ptr  )

inlineoverridevirtual

Registers an exposed source flux field.

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx >= 0 && varIdx < m_lsm_flux_size);
        if (static_cast<int>(source_flux.size()) != m_lsm_flux_size) {
            source_flux.resize(m_lsm_flux_size, nullptr);
        }
        source_flux[varIdx] = source_flux_ptr;
    }

Here is the call graph for this function:

Lsm_Set_Source_Unmapped_Ptr()

void SLM::Lsm_Set_Source_Unmapped_Ptr ( const int &  varIdx, amrex::MultiFab *  source_data_ptr  )

inlineoverridevirtual

Registers a private source SLM state field.

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx >= 0 && varIdx < static_cast<int>(unmapped_fields.size()));
        if (source_unmapped.size() != unmapped_fields.size()) {
            source_unmapped.resize(unmapped_fields.size(), nullptr);
        }
        source_unmapped[varIdx] = source_data_ptr;
    }

Here is the call graph for this function:

Lsm_Type()

int SLM::Lsm_Type ( )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        return LSM_Type::SLM;
    }

Lsm_Unmapped_Ptr()

amrex::MultiFab* SLM::Lsm_Unmapped_Ptr ( const int &  varIdx )

inlineoverridevirtual

Returns a private SLM state field.

Reimplemented from NullSurf.

    {
        AMREX_ALWAYS_ASSERT(varIdx >= 0 && varIdx < static_cast<int>(unmapped_fields.size()));
        return lsm_fab_vars[unmapped_fields[varIdx]].get();
    }

Here is the call graph for this function:

Lsm_Unmapped_Size()

int SLM::Lsm_Unmapped_Size ( )

inlineoverridevirtual

Returns the number of private SLM state fields.

Reimplemented from NullSurf.

{ return static_cast<int>(unmapped_fields.size()); }

Lsm_WRFInputNames()

std::unordered_map<std::string, std::string>& SLM::Lsm_WRFInputNames ( )

inlineoverridevirtual

Reimplemented from NullSurf.

                                  {
        return SLM::wrfinput_map;
    }

radiation_noahmp()

void SLM::radiation_noahmp

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const int d_opt_rad = opt_rad;
    const int d_opt_alb = opt_alb;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
    auto vegtype_arr = lsm_fab_vars[LsmVar_SLM::vegtype]->const_array(mfi);
    auto vegetype_arr = vegetype.const_array(mfi);
 
    // Input arrays
    auto swdsvisxyref_arr  = lsm_fab_vars[LsmVar_SLM::swdsvisxyref]->const_array(mfi);
    auto swdsnirxyref_arr  = lsm_fab_vars[LsmVar_SLM::swdsnirxyref]->const_array(mfi);
    auto swdsvisdxyref_arr = lsm_fab_vars[LsmVar_SLM::swdsvisdxyref]->const_array(mfi);
    auto swdsnirdxyref_arr = lsm_fab_vars[LsmVar_SLM::swdsnirdxyref]->const_array(mfi);
    auto coszrsxy_arr      = lsm_fab_vars[LsmVar_SLM::coszrsxy]->const_array(mfi);
    auto precipref_arr     = lsm_fab_vars[LsmVar_SLM::precipref]->const_array(mfi);
 
    auto LAI_arr   = LAI.const_array(mfi);
    auto SAI_arr   = SAI.const_array(mfi);
    auto t_canop_arr = t_canop.const_array(mfi);
    auto t_ground_skin_arr = t_ground_skin.const_array(mfi);
    auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
    auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
    auto veg_frac_arr = lsm_fab_vars[LsmVar_SLM::veg_frac]->const_array(mfi);
 
    // Existing SLM vegetation structure parameters (used instead of reading from NoahmpTable.TBL)
    // NOTE: Khai_L is equivalent to NOAHMP's XL (leaf/stem orientation index)
    // NOTE: ztop is equivalent to NOAHMP's HVT (top of canopy height in meters)
    auto Khai_L_arr = Khai_L.const_array(mfi);  // leaf/stem orientation (NOAHMP name: XL)
    auto ztop_arr = ztop.const_array(mfi);      // canopy height (NOAHMP name: HVT)
 
    // State variables for NOAHMP radiation
    auto tauss_arr  = tauss_noahmp.array(mfi);
 
    // Net radiation arrays for output
    auto net_rad_arr = net_rad.array(mfi);
    auto t_skin_arr  = t_skin.array(mfi);
 
    // Incoming longwave radiation
    auto lwref_arr = lsm_fab_vars[LsmVar_SLM::lwref]->const_array(mfi);
 
    // Outputs
    auto emis_sfc_arr     = lsm_fab_vars[LsmVar_SLM::emis_sfc]->array(mfi);
    auto alb_nir_sfc_arr  = lsm_fab_vars[LsmVar_SLM::alb_nir_sfc]->array(mfi);
    auto alb_vis_sfc_arr  = lsm_fab_vars[LsmVar_SLM::alb_vis_sfc]->array(mfi);
    auto alb_nir_sfc_diff_arr  = lsm_fab_vars[LsmVar_SLM::alb_nir_sfc_diff]->array(mfi);
    auto alb_vis_sfc_diff_arr  = lsm_fab_vars[LsmVar_SLM::alb_vis_sfc_diff]->array(mfi);
 
    amrex::Real dt_loc = m_dt;
 
    // Get radiation parameters on device
    const amrex::Real* d_rhol_vis = d_veg_params.at("rhol_vis")->data();
    const amrex::Real* d_rhol_nir = d_veg_params.at("rhol_nir")->data();
    const amrex::Real* d_rhos_vis = d_veg_params.at("rhos_vis")->data();
    const amrex::Real* d_rhos_nir = d_veg_params.at("rhos_nir")->data();
    const amrex::Real* d_taul_vis = d_veg_params.at("taul_vis")->data();
    const amrex::Real* d_taul_nir = d_veg_params.at("taul_nir")->data();
    const amrex::Real* d_taus_vis = d_veg_params.at("taus_vis")->data();
    const amrex::Real* d_taus_nir = d_veg_params.at("taus_nir")->data();
    // NOTE: d_xl uses existing Khai_L_arr, d_hvt uses existing ztop_arr
    const amrex::Real* d_rc = d_veg_params.at("rc")->data();
    const amrex::Real* d_hvb = d_veg_params.at("hvb")->data();
    const amrex::Real* d_den = d_veg_params.at("den")->data();
 
    const amrex::Real* d_albsat_vis = d_rad_params.at("albsat_vis")->data();
    const amrex::Real* d_albsat_nir = d_rad_params.at("albsat_nir")->data();
    const amrex::Real* d_albdry_vis = d_rad_params.at("albdry_vis")->data();
    const amrex::Real* d_albdry_nir = d_rad_params.at("albdry_nir")->data();
    const amrex::Real* d_alblak = d_rad_params.at("alblak")->data();
    const amrex::Real* d_omegas = d_rad_params.at("omegas")->data();
 
    const amrex::Real d_betads = betads_rad;
    const amrex::Real d_betais = betais_rad;
    const amrex::Real d_tau0 = tau0_rad;
    const amrex::Real d_grain_growth = grain_growth_rad;
    const amrex::Real d_extra_growth = extra_growth_rad;
    const amrex::Real d_dirt_soot = dirt_soot_rad;
    const amrex::Real d_swemx = swemx_rad;
    const amrex::Real d_bats_cosz = bats_cosz_rad;
    const amrex::Real d_bats_vis_new = bats_vis_new_rad;
    const amrex::Real d_bats_nir_new = bats_nir_new_rad;
    const amrex::Real d_bats_vis_age = bats_vis_age_rad;
    const amrex::Real d_bats_nir_age = bats_nir_age_rad;
    const amrex::Real d_bats_vis_dir = bats_vis_dir_rad;
    const amrex::Real d_bats_nir_dir = bats_nir_dir_rad;
 
    // Emissivity parameters for longwave radiation
    const amrex::Real d_snow_emis = snow_emis_rad;
    const amrex::Real d_eg_soil = eg_soil_rad;
    const amrex::Real d_eg_lake = eg_lake_rad;
 
    // Stefan-Boltzmann constant
    constexpr amrex::Real SB = 5.67e-08;  // W/m²/K⁴
 
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
 
        // --------------------------------------------------------------------------------------------------
        // Local variables for radiation calculation (all arrays from NOAHMP RADIATION subroutine)
        // --------------------------------------------------------------------------------------------------
        constexpr amrex::Real MPE = 1.0E-6;
        constexpr int NBAND = 2;
        amrex::Real fage;   //snow age function (0 - new snow)
        amrex::Real albgrd[2]; //ground albedo (direct)
        amrex::Real albgri[2]; //ground albedo (diffuse)
        amrex::Real albd[2];   //surface albedo (direct)
        amrex::Real albi[2];   //surface albedo (diffuse)
        amrex::Real fabd[2];   //flux abs by veg (per unit direct flux)
        amrex::Real fabi[2];   //flux abs by veg (per unit diffuse flux)
        amrex::Real ftdd[2];   //down direct flux below veg (per unit dir flux)
        amrex::Real ftid[2];   //down diffuse flux below veg (per unit dir flux)
        amrex::Real ftii[2];   //down diffuse flux below veg (per unit dif flux)
        amrex::Real frevd[2], frevi[2], fregd[2], fregi[2];
        amrex::Real albsnd[2];   //snow albedo (direct)
        amrex::Real albsni[2];   //snow albedo (diffuse)
        amrex::Real ftdi[2];     //down direct flux below veg per unit dif flux = 0
 
        amrex::Real fsha;   //shaded fraction of canopy
        amrex::Real vai;    //total LAI + stem area index, one sided
        amrex::Real fsun;   //sunlit fraction of canopy (-)
        amrex::Real laisun; //sunlit leaf area (-)
        amrex::Real laisha; //shaded leaf area (-)
        amrex::Real parsun; //average absorbed par for sunlit leaves (w/m2)
        amrex::Real parsha; //average absorbed par for shaded leaves (w/m2)
        amrex::Real sav;    //solar radiation absorbed by vegetation (w/m2)
        amrex::Real sag;    //solar radiation absorbed by ground (w/m2)
        amrex::Real fsa;    //total absorbed solar radiation (w/m2)
        amrex::Real fsr;    //total reflected solar radiation (w/m2)
        amrex::Real fsrv;   //veg. reflected solar radiation (w/m2)
        amrex::Real fsrg;   //ground reflected solar radiation (w/m2)
        amrex::Real bgap, wgap;
        amrex::Real gdir;   //average projected leaf/stem area in solar direction
        amrex::Real ext;    //optical depth direct beam per unit leaf + stem area
        amrex::Real xl_diag_val, chil_diag_val, phi1_diag_val, phi2_diag_val; //diagnostic outputs
 
        amrex::Real rho[2];      //leaf/stem reflectance weighted by fraction LAI and SAI
        amrex::Real tau[2];      //leaf/stem transmittance weighted by fraction LAI and SAI
        amrex::Real wl, ws;      //fraction of LAI+SAI that is LAI/SAI
 
        // Get input values
        amrex::Real cosz = coszrsxy_arr(i, j, 0);
        amrex::Real elai = LAI_arr(i, j, 0);
        amrex::Real esai = SAI_arr(i, j, 0);
        amrex::Real tv = t_canop_arr(i, j, 0);
        amrex::Real tg = t_ground_skin_arr(i, j, 0);
        amrex::Real fveg = veg_frac_arr(i, j, d_khi_lsm);
        int vegtyp = static_cast<int>(vegtype_arr(i, j, d_khi_lsm));
        int veg_idx = vegtyp - 1;  // convert to 0-based index
 
        // Incoming solar radiation
        amrex::Real solad[2], solai[2];
        solad[0] = swdsvisxyref_arr(i, j, 0);   // direct visible
        solad[1] = swdsnirxyref_arr(i, j, 0);   // direct NIR
        solai[0] = swdsvisdxyref_arr(i, j, 0);  // diffuse visible
        solai[1] = swdsnirdxyref_arr(i, j, 0);  // diffuse NIR
 
        // Snow variables (set to zero for now - can be added later)
        amrex::Real fsno = zero;     // snow cover fraction
        amrex::Real snowh = zero;    // snow height (mm)
        amrex::Real sneqvo = zero;   // snow mass at last time step (mm)
        amrex::Real sneqv = zero;    // snow mass (mm)
        amrex::Real qsnow = zero;    // snowfall (mm/s)
        amrex::ignore_unused(snowh, qsnow);
 
        // Wetness fraction (simplified - using precipitation as indicator)
        amrex::Real fwet = (precipref_arr(i, j, 0) > zero) ? 0.1 : zero;
 
        // Soil moisture for top layer
        amrex::Real smc[1];
        smc[0] = soilw_arr(i, j, d_khi_lsm) * poro_soil_arr(i, j, d_khi_lsm);
 
        int nsoil = 1;  // using top layer only for albedo calc
        int ice = 0;    // not ice
        int ist = 1;    // soil surface type
 
        // Initialize outputs
        bgap = zero;
        wgap = zero;
        for (int ib = 0; ib < NBAND; ib++) {
            albgrd[ib] = zero;
            albgri[ib] = zero;
            albd[ib] = zero;
            albi[ib] = zero;
            fabd[ib] = zero;
            fabi[ib] = zero;
            ftdd[ib] = zero;
            ftid[ib] = zero;
            ftii[ib] = zero;
            albsnd[ib] = zero;
            albsni[ib] = zero;
            frevd[ib] = zero;
            frevi[ib] = zero;
            fregd[ib] = zero;
            fregi[ib] = zero;
            ftdi[ib] = zero;
        }
        fsun = zero;
 
        // --------------------------------------------------------------------------------------------------
        // ALBEDO CALCULATION (inline to make it device-callable)
        // --------------------------------------------------------------------------------------------------
 
        // snow age (allow nighttime aging)
        snow_age_noahmp(dt_loc, tg, sneqvo, sneqv, d_tau0, d_grain_growth, d_extra_growth,
                        d_dirt_soot, d_swemx, tauss_arr(i,j,0), fage);
 
        if (cosz > zero) {
 
            // weight reflectance/transmittance by LAI and SAI
            vai = elai + esai;
            wl  = elai / std::max(vai,MPE);
            ws  = esai / std::max(vai,MPE);
 
            // snow albedos: only if COSZ > 0 and FSNO > 0
            if(d_opt_alb == 1) {
                snowalb_bats_noahmp(NBAND, fsno, cosz, fage,
                                   d_bats_cosz, d_bats_vis_new, d_bats_nir_new,
                                   d_bats_vis_age, d_bats_nir_age,
                                   d_bats_vis_dir, d_bats_nir_dir,
                                   albsnd, albsni);
            }
 
            // ground surface albedo
            // Get soil albedo parameters (using soil color index = 4 as default for now)
            int soil_color_idx = 3;  // index into albedo arrays (0-based for index 4 soil color)
            amrex::Real albsat[2], albdry[2], alblak[2];
            albsat[0] = d_albsat_vis[soil_color_idx];
            albsat[1] = d_albsat_nir[soil_color_idx];
            albdry[0] = d_albdry_vis[soil_color_idx];
            albdry[1] = d_albdry_nir[soil_color_idx];
            alblak[0] = d_alblak[0];
            alblak[1] = d_alblak[1];
 
            groundalb_noahmp(nsoil, NBAND, ice, ist, fsno, smc, albsnd, albsni, cosz, tg,
                            albsat, albdry, alblak, albgrd, albgri);
 
            const bool has_canopy = vegetype_arr(i, j, 0) == 1 && fveg > zero && vai > zero;
            if (has_canopy) {
                // Get parameters for this vegetation type
                for (int ib = 0; ib < NBAND; ib++) {
                    amrex::Real rhol_val = (ib == 0) ? d_rhol_vis[veg_idx] : d_rhol_nir[veg_idx];
                    amrex::Real rhos_val = (ib == 0) ? d_rhos_vis[veg_idx] : d_rhos_nir[veg_idx];
                    amrex::Real taul_val = (ib == 0) ? d_taul_vis[veg_idx] : d_taul_nir[veg_idx];
                    amrex::Real taus_val = (ib == 0) ? d_taus_vis[veg_idx] : d_taus_nir[veg_idx];
                    rho[ib] = std::max(rhol_val*wl + rhos_val*ws, MPE);
                    tau[ib] = std::max(taul_val*wl + taus_val*ws, MPE);
                }
 
                // loop over NBAND wavebands to calculate surface albedos and solar
                // fluxes for unit incoming direct (IC=0) and diffuse (IC=1)
 
                for (int ib = 0; ib < NBAND; ib++) {
                    // direct (IC=0)
                    twostream_noahmp(ib, 0, vegtyp, cosz, vai, fwet, tv, albgrd, albgri,
                                    rho, tau, fveg, ist,
                                    Khai_L_arr(i,j,0), d_omegas[ib], d_betads, d_betais,
                                    d_opt_rad, d_rc[veg_idx], ztop_arr(i,j,0), d_hvb[veg_idx], d_den[veg_idx],
                                    fabd, albd, ftdd, ftid, gdir, frevd, fregd, bgap, wgap,
                                    xl_diag_val, chil_diag_val, phi1_diag_val, phi2_diag_val);
 
                    // diffuse (IC=1)
                    twostream_noahmp(ib, 1, vegtyp, cosz, vai, fwet, tv, albgrd, albgri,
                                    rho, tau, fveg, ist,
                                    Khai_L_arr(i,j,0), d_omegas[ib], d_betads, d_betais,
                                    d_opt_rad, d_rc[veg_idx], ztop_arr(i,j,0), d_hvb[veg_idx], d_den[veg_idx],
                                    fabi, albi, ftdi, ftii, gdir, frevi, fregi, bgap, wgap,
                                    xl_diag_val, chil_diag_val, phi1_diag_val, phi2_diag_val);
                }
 
                // sunlit fraction of canopy. set FSUN = 0 if FSUN < 0.01.
                ext = gdir/cosz * std::sqrt(one-rho[0]-tau[0]);
                fsun = (one-std::exp(-ext*vai)) / std::max(ext*vai,MPE);
                ext = fsun;
 
                if (ext < 0.01) {
                    wl = zero;
                } else {
                    wl = ext;
                }
                fsun = wl;
            } else {
                for (int ib = 0; ib < NBAND; ib++) {
                    albd[ib] = albgrd[ib];
                    albi[ib] = albgri[ib];
                    ftdd[ib] = one;
                    ftii[ib] = one;
                    fregd[ib] = albgrd[ib];
                    fregi[ib] = albgri[ib];
                }
            }
 
        } // cosz>0
 
        // --------------------------------------------------------------------------------------------------
        // SURRAD CALCULATION
        // --------------------------------------------------------------------------------------------------
 
        fsha = 1.0-fsun;
        laisun = elai*fsun;
        laisha = elai*fsha;
        vai = elai+ esai;
 
        surrad_noahmp(MPE, fsun, fsha, elai, vai, laisun, laisha, solad, solai,
                     fabd, fabi, ftdd, ftid, ftii, albgrd, albgri, albd, albi,
                     frevd, frevi, fregd, fregi,
                     parsun, parsha, sav, sag, fsa, fsr, fsrv, fsrg);
 
        // --------------------------------------------------------------------------------------------------
        // LONGWAVE RADIATION CALCULATION (NOAHMP formulation)
        // --------------------------------------------------------------------------------------------------
        // NOAHMP longwave scheme includes multiple reflections between canopy and ground
        // References: NOAHMP module_sf_noahmplsm.F lines 2137-2144 (emissivity)
        //                                               lines 3874-3875, 4041 (canopy LW)
        //                                               lines 4086-4087, 4104 (ground LW)
        // --------------------------------------------------------------------------------------------------
 
        // Get incoming longwave radiation from atmosphere (W/m²)
        // lwdn is positive downward (standard atmospheric convention)
        amrex::Real lwdn = lwref_arr(i, j, 0);
 
        // Calculate emissivities
        // Vegetation emissivity (NOAHMP line 2139)
        // EMV depends on total vegetation area index (LAI + SAI)
        // EMV = 1 for dense canopy, EMV → 0 for sparse/no vegetation
        amrex::Real emv = 1.0 - std::exp(-(elai + esai));
 
        // Ground emissivity (NOAHMP lines 2140-2144)
        // EMG is weighted by snow cover fraction (fsno)
        // Note: ice = 1 if IST = 2 (lake/ice), for now assume ice = 0 (soil)
        // Note: fsno and ist are already declared earlier (lines 5159, 5174)
        amrex::Real emg;
        if (ist == 1) {
            emg = d_eg_soil * (1.0 - fsno) + d_snow_emis * fsno;
        } else {
            emg = d_eg_lake * (1.0 - fsno) + d_snow_emis * fsno;
        }
 
        // --------------------------------------------------------------------------------------------------
        // Canopy net longwave radiation (IRC) - NOAHMP lines 3874-3875, 4041
        // --------------------------------------------------------------------------------------------------
        // NOAHMP SIGN CONVENTION: IRC is NET UPWARD longwave flux (positive = energy loss)
        //   IRC = emitted_upward - absorbed_from_atmosphere - absorbed_from_ground
        // NOAHMP energy balance: SAV - IRC - SHC - EVC = 0
        //
        // Physical interpretation of AIR_C term:
        //   -EMV*LWDN: canopy absorbs atmospheric LW (gain, hence negative)
        //   -EMV*(1-EMV)*(1-EMG)*LWDN: multiple reflection of atmospheric LW
        //                               (transmitted through canopy, reflected by ground, absorbed by canopy)
        //   -EMV*EMG*SB*TG^4: canopy absorbs ground emission (gain, hence negative)
        //
        // Physical interpretation of CIR_C*TV^4 term:
        //   2*EMV*SB*TV^4: canopy emits in both directions (up and down)
        //   -EMV^2*(1-EMG)*SB*TV^4: multiple reflection of canopy downward emission
        //                            (reflected by ground and re-absorbed by canopy)
        // --------------------------------------------------------------------------------------------------
        amrex::Real air_c = -emv * (1.0 + (1.0 - emv) * (1.0 - emg)) * lwdn
                          - emv * emg * SB * amrex::Math::powi<4>(tg);
        amrex::Real cir_c = (two - emv * (one - emg)) * emv * SB;
        amrex::Real irc = air_c + cir_c * amrex::Math::powi<4>(tv);
 
        // --------------------------------------------------------------------------------------------------
        // Ground net longwave radiation (IRG) - NOAHMP lines 4086-4087, 4104
        // --------------------------------------------------------------------------------------------------
        // NOAHMP SIGN CONVENTION: IRG is NET UPWARD longwave flux (positive = energy loss)
        //   IRG = emitted_upward - absorbed_from_atmosphere - absorbed_from_canopy
        // NOAHMP energy balance: SAG - IRG - SHG - EVG = 0
        //
        // Physical interpretation of AIR_G term:
        //   -EMG*(1-EMV)*LWDN: ground absorbs transmitted atmospheric LW (gain, hence negative)
        //   -EMG*EMV*SB*TV^4: ground absorbs canopy downward emission (gain, hence negative)
        //
        // Physical interpretation of CIR_G*TG^4 term:
        //   EMG*SB*TG^4: ground emits upward
        // --------------------------------------------------------------------------------------------------
        amrex::Real air_g = -emg * (1.0 - emv) * lwdn - emg * emv * SB * amrex::Math::powi<4>(tv);
        amrex::Real cir_g = emg * SB;
        amrex::Real irg = cir_g * amrex::Math::powi<4>(tg) + air_g;
 
        amrex::Real tir1 = emv * SB * amrex::Math::powi<4>(tv);
        amrex::Real tir2 = emg * SB * amrex::Math::powi<4>(tg);
        amrex::Real lwdn1 = lwdn;
        amrex::Real lwdn2 = (1.0 - emv) * lwdn + tir1;
        amrex::Real lwup2 = tir2 + (1.0 - emg) * lwdn2;
        amrex::Real lwup1 = lwdn + irc + irg;
 
        // --------------------------------------------------------------------------------------------------
        // Store shortwave and longwave radiation to net_rad arrays
        // --------------------------------------------------------------------------------------------------
        // SLM SIGN CONVENTION: net_rad is NET ABSORBED radiation (positive = energy gain)
        //   net_rad = absorbed_radiation (all sources) - emitted_radiation
        // SLM energy balance: net_rad - SH - LH = heat storage change
        //
        // SIGN CONVERSION: IRC/IRG (net upward) → net_lw (net absorbed)
        //   net_absorbed = -net_upward
        //   When IRC > 0 (net upward flux, energy loss), net_lw1 < 0 (energy loss)
        //   When IRC < 0 (net downward flux, energy gain), net_lw1 > 0 (energy gain)
        // --------------------------------------------------------------------------------------------------
 
        // Shortwave absorbed (W/m²)
        net_rad_arr(i, j, 0, SLM_NetRad::net_sw1) = sav;  // canopy absorbed solar
        net_rad_arr(i, j, 0, SLM_NetRad::net_sw2) = sag;  // ground absorbed solar
 
        // Longwave absorbed (W/m²)
        // Sign flip converts NOAHMP convention (net upward) to SLM convention (net absorbed)
        net_rad_arr(i, j, 0, SLM_NetRad::tir1) = tir1;
        net_rad_arr(i, j, 0, SLM_NetRad::tir2) = tir2;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwup1) = lwup1;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwup2) = lwup2;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwdn1) = lwdn1;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwdn2) = lwdn2;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lw1) = -irc;  // canopy absorbed longwave
        net_rad_arr(i, j, 0, SLM_NetRad::net_lw2) = -irg;  // ground absorbed longwave
 
        // Total net radiation (W/m²)
        // net_rad = shortwave_absorbed + longwave_absorbed
        //         = sav + (-irc) = sav - irc
        net_rad_arr(i, j, 0, SLM_NetRad::net_rad1) = sav - irc;  // canopy: SW + LW
        net_rad_arr(i, j, 0, SLM_NetRad::net_rad2) = sag - irg;  // ground: SW + LW
 
        // Directional shortwave diagnostics use positive physical directions:
        // downwelling is positive in net_swdn and upwelling is positive in net_swup.
        // net_sw1 and net_sw2 remain positive for absorbed shortwave.
        // The surrad terms satisfy SW_in = reflected + canopy absorbed + ground absorbed.
        // Downwelling shortwave for stomatal resistance calculation
        // Total incoming SW = direct + diffuse for both visible and NIR
        const amrex::Real sw_in = solad[0] + solad[1] + solai[0] + solai[1];
        net_rad_arr(i, j, 0, SLM_NetRad::net_swdn1) = sw_in;
 
        // Reflected shortwave at the canopy top.
        net_rad_arr(i, j, 0, SLM_NetRad::net_swup1) = fsr;
 
        // Downwelling SW reaching ground (transmitted through canopy)
        amrex::Real sw_down_ground = zero;
        for (int ib = 0; ib < NBAND; ib++) {
            sw_down_ground += solad[ib] * (ftdd[ib] + ftid[ib])
                            + solai[ib] * ftii[ib];
        }
        net_rad_arr(i, j, 0, SLM_NetRad::net_swdn2) = sw_down_ground;
        net_rad_arr(i, j, 0, SLM_NetRad::net_swup2) = sw_down_ground - sag;
        // --------------------------------------------------------------------------------------------------
        // Store albedo outputs
        // --------------------------------------------------------------------------------------------------
 
        alb_vis_sfc_arr(i, j, 0) = albd[0];
        alb_nir_sfc_arr(i, j, 0) = albd[1];
        alb_vis_sfc_diff_arr(i, j, 0) = albi[0];
        alb_nir_sfc_diff_arr(i, j, 0) = albi[1];
 
        alb_vis_sfc_arr(i, j, d_khi_lsm) = albd[0];
        alb_nir_sfc_arr(i, j, d_khi_lsm) = albd[1];
        alb_vis_sfc_diff_arr(i, j, d_khi_lsm) = albi[0];
        alb_nir_sfc_diff_arr(i, j, d_khi_lsm) = albi[1];
 
        // Surface emissivity for the vegetated canopy-ground system, including
        // the Noah-MP multiple-reflection term.
        amrex::Real emiss_sfc = emv + emg * (1.0 - emv)
                              + emv * (1.0 - emv) * (1.0 - emg);
        emis_sfc_arr(i, j, 0) = emiss_sfc;
        emis_sfc_arr(i, j, d_khi_lsm) = emis_sfc_arr(i, j, 0);
 
        t_skin_arr(i, j, 0) = std::pow(
            std::max(MPE, (lwup1 - (one - emiss_sfc) * lwdn) /
                     (emiss_sfc * SB)), fourth);
 
    }); // End ParallelFor
}

Here is the call graph for this function:

ReadCheckpoint()

void SLM::ReadCheckpoint ( const int &  lev, const std::string &  checkpointname  )

overridevirtual

Reimplemented from NullSurf.

{
    auto check_start = amrex::second();
 
    amrex::Print() << " Reading SLM checkpoint at level " << lev << std::endl;
 
    // Header
    std::string File(checkpointname + "/Level_" + std::to_string(lev) + "/SLM_Header");
 
    VisMF::IO_Buffer io_buffer(VisMF::GetIOBufferSize());
 
    Vector<char> fileCharPtr;
    ParallelDescriptor::ReadAndBcastFile(File, fileCharPtr);
    std::string fileCharPtrString(fileCharPtr.dataPtr());
    std::istringstream is(fileCharPtrString, std::istringstream::in);
 
    std::string line, word;
 
    // read in title line
    std::getline(is, line);
 
    // read in number of soil layers
    is >> m_nz_lsm;
 
    // read in array of dz
    std::getline(is, line);
    {
        std::istringstream lis(line);
        int i = 0;
        while (lis >> word) {
            m_dz_lsm[i++] = std::stod(word);
        }
    }
    GotoNextLine(is);
 
    // Read in time
    is >> m_dt;
    is >> time;
    is >> start_time;
    is >> m_calday;
    is >> m_orbital_year;
    is >> m_orbital_mon;
    is >> m_orbital_day;
    is >> m_orbital_sec;
    GotoNextLine(is);
 
    // Read in constants
    is >> tabs_s;
    is >> t00;
    is >> LAI0;
    is >> tausoil;
    is >> zref;
    is >> z0_soil;
    is >> mws_mx0;
    is >> Rc_max;
    is >> T_opt;
    GotoNextLine(is);
 
    // Read in flags
    int reserved_slm_flag = 0;
    is >> dosoiltnudging;
    is >> dosoilwnudging;
    is >> reserved_slm_flag;
    is >> use_param_file;
    is >> interpolate_lai;
    is >> use_wrf_lai;
    is >> use_wrfinput;
    amrex::ignore_unused(reserved_slm_flag);
    GotoNextLine(is);
 
    // read in level 'lev' BoxArray from Header
    BoxArray ba;
    ba.readFrom(is);
    GotoNextLine(is);
 
    AMREX_ALWAYS_ASSERT(ba == ba_lsm_2d);
 
    //
    // Lifecycle flags, if this checkpoint carries them (see WriteCheckpoint).  The
    // defaults are what the reader always did: treat the model as initialized.
    //
    // NOTE: the BoxArray read above is already followed by its own GotoNextLine, so
    //       the stream sits at the start of this line -- do not skip another.
    //
    int chk_first_step = 0;
    int chk_wrfinput_initialized = (use_wrfinput) ? 1 : 0;
    {
        int a, b;
        if (is >> a >> b) { chk_first_step = a; chk_wrfinput_initialized = b; }
    }
 
    const std::string prefix = "SLM_";
 
    // Use distribution map from data vars, since those are already created and loaded by ERF
    const DistributionMapping& dm = lsm_fab_vars[0]->DistributionMap();
    IntVect ng = IntVect(0,0,0);
    {
        MultiFab mf(ba_lsm_2d,dm,1,ng);
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "landmask"));
        landmask = amrex::cast<iMultiFab>(mf);
 
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "landtype"));
        landtype = amrex::cast<iMultiFab>(mf);
 
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "vegetype"));
        vegetype = amrex::cast<iMultiFab>(mf);
    }
 
    {
        // DST
        MultiFab mf(soilt_vars.boxArray(),dm,SLM_DST::NumVars,0);
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "DST"));
        MultiFab::Copy(soilt_vars,mf,0,0,SLM_DST::NumVars,ng);
    }
 
    {
        // DSW
        MultiFab mf(soilw_vars.boxArray(),dm,SLM_DSW::NumVars,0);
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "DSW"));
        MultiFab::Copy(soilw_vars,mf,0,0,SLM_DSW::NumVars,ng);
    }
 
    {
        // net_rad
        MultiFab mf(net_rad.boxArray(),dm,SLM_NetRad::NumVars,0);
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "net_rad"));
        MultiFab::Copy(net_rad,mf,0,0,SLM_NetRad::NumVars,ng);
    }
 
    {
        // slm_diag
        MultiFab mf(slm_diag.boxArray(),dm,SLM_Diag::NumVars,0);
        VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "slm_diag"));
        MultiFab::Copy(slm_diag,mf,0,0,SLM_Diag::NumVars,ng);
    }
 
    MultiFab mf(ba_lsm_2d,dm,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "LAI"));
    MultiFab::Copy(LAI,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "SAI"));
    MultiFab::Copy(SAI,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "sstxy"));
    MultiFab::Copy(sstxy,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_canop"));
    MultiFab::Copy(t_canop,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mw"));
    MultiFab::Copy(mw,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mws"));
    MultiFab::Copy(mws,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_skin"));
    MultiFab::Copy(t_skin,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_ground_skin"));
    MultiFab::Copy(t_ground_skin,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_cas"));
    MultiFab::Copy(t_cas,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "q_cas"));
    MultiFab::Copy(q_cas,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "vege_YES"));
    MultiFab::Copy(vege_YES,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "cp_vege"));
    MultiFab::Copy(cp_vege,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "z0_sfc"));
    MultiFab::Copy(z0_sfc,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Khai_L"));
    MultiFab::Copy(Khai_L,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "phi_1"));
    MultiFab::Copy(phi_1,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "phi_2"));
    MultiFab::Copy(phi_2,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "IR_emis_vege"));
    MultiFab::Copy(IR_emis_vege,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "IR_emis_soil"));
    MultiFab::Copy(IR_emis_soil,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "ztop"));
    MultiFab::Copy(ztop,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "disp_hgt"));
    MultiFab::Copy(disp_hgt,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Rgl"));
    MultiFab::Copy(Rgl,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Rc_min"));
    MultiFab::Copy(Rc_min,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "hs_rc"));
    MultiFab::Copy(hs_rc,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "precip_extinc"));
    MultiFab::Copy(precip_extinc,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mw_mx"));
    MultiFab::Copy(mw_mx,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mws_mx"));
    MultiFab::Copy(mws_mx,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "BAI"));
    MultiFab::Copy(BAI,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mw_inc"));
    MultiFab::Copy(mw_inc,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "evapo_dry"));
    MultiFab::Copy(evapo_dry,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "shf_canop"));
    MultiFab::Copy(shf_canop,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "shf_soil"));
    MultiFab::Copy(shf_soil,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "shf_air"));
    MultiFab::Copy(shf_air,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "lhf_canop"));
    MultiFab::Copy(lhf_canop,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "lhf_soil"));
    MultiFab::Copy(lhf_soil,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "lhf_air"));
    MultiFab::Copy(lhf_air,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedovis_v"));
    MultiFab::Copy(albedovis_v,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedonir_v"));
    MultiFab::Copy(albedonir_v,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedovis_s"));
    MultiFab::Copy(albedovis_s,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedonir_s"));
    MultiFab::Copy(albedonir_s,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_a"));
    MultiFab::Copy(r_a,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_b"));
    MultiFab::Copy(r_b,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_c"));
    MultiFab::Copy(r_c,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_d"));
    MultiFab::Copy(r_d,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_soil"));
    MultiFab::Copy(r_soil,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "wet_canop"));
    MultiFab::Copy(wet_canop,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "zrefxy"));
    MultiFab::Copy(zrefxy,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albold_noahmp"));
    MultiFab::Copy(albold_noahmp,mf,0,0,1,ng);
 
    VisMF::Read(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "tauss_noahmp"));
    MultiFab::Copy(tauss_noahmp,mf,0,0,1,ng);
 
    for (int i = 0; i < static_cast<int>(unmapped_fields.size()); i++) {
        MultiFab mf_unmapped(lsm_fab_vars[unmapped_fields[i]]->boxArray(),dm,1,IntVect(1,1,1));
        VisMF::Read(mf_unmapped, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Data" + std::to_string(unmapped_fields[i])));
        MultiFab::Copy(*(lsm_fab_vars[unmapped_fields[i]]),mf_unmapped,0,0,1,IntVect(1,1,1));
    }
 
    //
    // Restore where the model was, rather than asserting it was past its first step.
    // A checkpoint taken before any step has been advanced leaves first_step set, so
    // the first Advance after the restart does the deferred wrfinput read and rebuilds
    // zrefxy -- exactly what the run being continued did at that point.
    //
    first_step           = (chk_first_step != 0);
    wrfinput_initialized = (chk_wrfinput_initialized != 0);
 
    // Initialize common parameters
    init_layer_depths();
    init_soil_vars();
    rebuild_restart_fields();
 
    auto check_end = amrex::second() - check_start;
    ParallelDescriptor::ReduceRealMax(check_end,ParallelDescriptor::IOProcessorNumber());
    amrex::Print() << "    SLM Checkpoint load time = " << check_end << " seconds." << '\n';
}

Here is the call graph for this function:

ReadParameterFile()

SLMParameterTable SLM::ReadParameterFile	(	const std::string &	filename,
		amrex::Vector< std::string > &	veg_categories,
		amrex::Vector< std::string > &	soil_categories
	)

Loads and parses the given .TBL file (such as NoahMPTable.TBL)

Returns an unordered map containing the name of each parameter block, where each block contains a list of variables, with each variable containing one or more values.

Returns the vegetation and soil category names loaded from file as a vector of names.

{
    amrex::Print() << " SLM: Reading parameter file '" << filename << "'..." << std::endl;
 
    Vector<char> fileCharPtr;
    ParallelDescriptor::ReadAndBcastFile(filename, fileCharPtr);
    std::string fileCharPtrString(fileCharPtr.dataPtr());
    std::istringstream is(fileCharPtrString, std::istringstream::in);
 
    std::string line;
 
    std::unordered_map<std::string,
                       amrex::Vector<std::pair<std::string, amrex::Vector<amrex::Real>>>> table;
 
    const auto trim = [](std::string value) {
        const auto first = value.find_first_not_of(" \t\r\n");
        if (first == std::string::npos) { return std::string{}; }
        const auto last = value.find_last_not_of(" \t\r\n");
        return value.substr(first, last - first + 1);
    };
 
    std::string block_name;
    while (std::getline(is, line)) {
        const auto comment_pos = line.find('!');
        if (comment_pos != std::string::npos) { line.erase(comment_pos); }
        line = trim(line);
        if (line.empty()) { continue; }
 
        if (line[0] == '&') {
            block_name = amrex::toLower(trim(line.substr(1)));
            table.try_emplace(block_name);
            continue;
        }
        if (line[0] == '/') {
            block_name.clear();
            continue;
        }
        if (block_name.empty()) { continue; }
 
        const auto equal_pos = line.find('=');
        if (equal_pos == std::string::npos) { continue; }
 
        const std::string varname = amrex::toLower(trim(line.substr(0, equal_pos)));
        std::string values = trim(line.substr(equal_pos + 1));
        if (varname == "veg_dataset_description") {
            veg_categories.push_back(values);
            continue;
        }
        if (varname == "sltype") {
            soil_categories.push_back(values);
            continue;
        }
 
        std::replace(values.begin(), values.end(), ',', ' ');
        std::replace(values.begin(), values.end(), 'D', 'E');
        std::replace(values.begin(), values.end(), 'd', 'e');
        std::istringstream value_stream(values);
        std::string token;
        amrex::Vector<amrex::Real> var_values;
        while (value_stream >> token) {
            try {
                std::size_t parsed = 0;
                const amrex::Real value = std::stod(token, &parsed);
                if (parsed != token.size()) {
                    amrex::Abort("SLM: invalid value '" + token + "' for parameter '" +
                                 varname + "' in block '" + block_name + "'");
                }
                var_values.push_back(value);
            } catch (const std::exception&) {
                amrex::Abort("SLM: invalid value '" + token + "' for parameter '" +
                             varname + "' in block '" + block_name + "'");
            }
        }
        if (!var_values.empty()) {
            table[block_name].push_back(std::make_pair(varname, var_values));
        }
    }
 
 
    // Print out all the variables:
    amrex::Print() << "---------------------------------------------------" << std::endl;
    amrex::Print() << " SLM Parameter File '" << filename << "':" << std::endl;
    amrex::Print() << "---------------------------------------------------" << std::endl;
    for (auto &block : table) {
        amrex::Print() << "  '" << block.first << "':" << std::endl;
        for (auto &var : block.second) {
            amrex::Print() << "      - '" << var.first << "': [";
            for (int i = 0; i < static_cast<int>(var.second.size()); ++i) {
                amrex::Print() << " " << var.second[i];
                if (i + 1 < static_cast<int>(var.second.size())) {
                    amrex::Print() << ",";
                }
            }
            amrex::Print() << " ]" << std::endl;
        }
    }
    amrex::Print() << "---------------------------------------------------" << std::endl;
 
    return table;
}

rebuild_restart_fields()

void SLM::rebuild_restart_fields

(

)

Rebuilds restart fields that can be derived from the checkpoint state.

{
    const int d_khi_lsm = khi_lsm;
 
    nroot.setVal(m_nz_lsm);
    for (MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const Box box = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
        auto landtype_arr = landtype.const_array(mfi);
        auto vegetype_arr = vegetype.const_array(mfi);
        auto nroot_arr = nroot.array(mfi);
        auto IR_emis_soil_arr = IR_emis_soil.const_array(mfi);
        auto IR_emis_grnd_arr = IR_emis_grnd.array(mfi);
        auto IMPERV_arr = IMPERV.array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int) noexcept
        {
            if (landmask_arr(i, j, 0) == 1) {
                IMPERV_arr(i, j, 0) = landtype_arr(i, j, 0) == 13 ? 0.75 : 0.0;
                IR_emis_grnd_arr(i, j, 0) = landtype_arr(i, j, 0) == 13
                    ? IR_emis_urban * IMPERV_arr(i, j, 0)
                      + IR_emis_soil_arr(i, j, 0) * (1.0 - IMPERV_arr(i, j, 0))
                    : IR_emis_soil_arr(i, j, 0);
                if (vegetype_arr(i, j, 0) == 0) {
                    nroot_arr(i, j, 0) = 0;
                }
            } else {
                IMPERV_arr(i, j, 0) = zero;
                IR_emis_grnd_arr(i, j, 0) = zero;
            }
        });
    }
 
    // Reapply table-derived parameters without resetting prognostic state.
    init_from_params();
 
    for (MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const Box box = mfi.tilebox();
 
        auto landmask_arr = landmask.const_array(mfi);
        auto vegetype_arr = vegetype.const_array(mfi);
        auto t_ground_skin_arr = t_ground_skin.const_array(mfi);
        auto mws_arr = mws.const_array(mfi);
        auto m_pot_sat_arr = lsm_fab_vars[LsmVar_SLM::m_pot_sat]->const_array(mfi);
        auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
        auto Bconst_arr = lsm_fab_vars[LsmVar_SLM::Bconst]->const_array(mfi);
        auto pref_arr = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
        auto q_gr_arr = q_gr.array(mfi);
        auto sdew_arr = sdew.array(mfi);
        auto t_sfc_arr = t_sfc.array(mfi);
        auto q_sfc_arr = q_sfc.array(mfi);
        auto t_cas_arr = t_cas.const_array(mfi);
        auto q_cas_arr = q_cas.const_array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int) noexcept
        {
            if (landmask_arr(i, j, 0) != 1) {
                q_gr_arr(i, j, 0) = zero;
                sdew_arr(i, j, 0) = zero;
                t_sfc_arr(i, j, 0) = zero;
                q_sfc_arr(i, j, 0) = zero;
                return;
            }
 
            amrex::Real q_ground;
            amrex::Real dew_factor = one;
            if (t_ground_skin_arr(i, j, 0) >= tfriz) {
                erf_qsatw(t_ground_skin_arr(i, j, 0), pref_arr(i, j, 0), q_ground);
                if (mws_arr(i, j, 0) == zero) {
                    const amrex::Real humidity_factor = fh_calc(
                        t_ground_skin_arr(i, j, 0),
                        m_pot_sat_arr(i, j, d_khi_lsm),
                        soilw_arr(i, j, d_khi_lsm),
                        Bconst_arr(i, j, d_khi_lsm));
                    dew_factor = humidity_factor > 0.99 ? one : zero;
                    q_ground *= humidity_factor;
                }
            } else {
                erf_qsati(t_ground_skin_arr(i, j, 0), pref_arr(i, j, 0), q_ground);
            }
 
            q_gr_arr(i, j, 0) = q_ground;
            sdew_arr(i, j, 0) = dew_factor;
            if (vegetype_arr(i, j, 0) == 1) {
                t_sfc_arr(i, j, 0) = t_cas_arr(i, j, 0);
                q_sfc_arr(i, j, 0) = q_cas_arr(i, j, 0);
            } else {
                t_sfc_arr(i, j, 0) = t_ground_skin_arr(i, j, 0);
                q_sfc_arr(i, j, 0) = q_ground;
            }
        });
    }
}

Here is the call graph for this function:

resistances()

void SLM::resistances

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const int d_nz_lsm = m_nz_lsm;
    const Real d_z0_soil = z0_soil;
    const Real d_T_opt = T_opt;
    const Real d_Rc_max = Rc_max;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
    auto landtype_arr = landtype.const_array(mfi);
    auto vegetype_arr = vegetype.const_array(mfi);
 
    auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->const_array(mfi);
    auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
    auto s_depth_arr = lsm_fab_vars[LsmVar_SLM::s_depth]->const_array(mfi);
    auto pref_arr  = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
 
    auto LAI_arr = LAI.const_array(mfi);
    auto SAI_arr = SAI.const_array(mfi);
    auto t_cas_arr = t_cas.const_array(mfi);
    auto q_cas_arr = q_cas.const_array(mfi);
    auto ustar_arr = lsm_fab_vars[LsmVar_SLM::ustar]->const_array(mfi);
 
    auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
    auto theta_FC_arr = lsm_fab_vars[LsmVar_SLM::theta_FC]->const_array(mfi);
    auto theta_WP_arr = lsm_fab_vars[LsmVar_SLM::theta_WP]->const_array(mfi);
    auto soil_transp_frac_arr = lsm_fab_vars[LsmVar_SLM::soil_transp_frac]->array(mfi);
 
    auto ztop_arr = ztop.const_array(mfi);
    auto disp_hgt_arr = disp_hgt.const_array(mfi);
    auto z0_sfc_arr = z0_sfc.const_array(mfi);
    auto Rgl_arr = Rgl.const_array(mfi);
    auto Rc_min_arr = Rc_min.const_array(mfi);
    auto hs_rc_arr = hs_rc.const_array(mfi);
    auto nroot_arr = nroot.const_array(mfi);
    auto dleaf_arr = dleaf.const_array(mfi);
    auto zrefxy_arr = zrefxy.const_array(mfi);
    auto net_rad_arr = net_rad.const_array(mfi);
 
    auto ur_arr = lsm_fab_vars[LsmVar_SLM::uref]->const_array(mfi);
    auto vr_arr = lsm_fab_vars[LsmVar_SLM::vref]->const_array(mfi);
 
    auto r_a_arr = r_a.const_array(mfi);
    auto r_b_arr = r_b.array(mfi);
    auto r_c_arr = r_c.array(mfi);
    auto r_d_arr = r_d.array(mfi);
 
    // Get CWPVT parameter (canopy wind extinction factor) if available
    const amrex::Real* d_cwpvt = nullptr;
    if (d_veg_params.find("cwpvt") != d_veg_params.end()) {
        d_cwpvt = d_veg_params.at("cwpvt")->data();
    }
    const amrex::Real d_cwpvt_default = one;  // default value if not from table
 
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
 
        for (int k = 0; k < d_nz_lsm; k++) {
            soil_transp_frac_arr(i, j, d_khi_lsm - k) = zero;
        }
 
        if (vegetype_arr(i, j, 0) == 0)
        {
            // for baresoil, r_d = r_a
            // under canopy resistance
            r_d_arr(i, j, 0) = r_a_arr(i, j, 0);
        }
        else
        {
            // for vegetated land surfaces
            amrex::Real rc_fac_rad, rc_fac_vpd, rc_fac_t, rc_fac_sw, d_root, tmp_radf;
 
            // ===================================================
            // Aerodynamic resistance for heat and vapor transfer under canopy space : r_d
            // ===================================================
            // NoahMP method: ResistanceLeafToGroundMod.F90
            // Reference: Niu et al. (2011), He et al. (2023)
 
            const amrex::Real MPE = 1.0e-6;
            const amrex::Real CONST_VON_KARMAN = 0.4;
            amrex::Real temp_diff = t_cas_arr(i, j, 0) - soilt_arr(i, j, d_khi_lsm);
 
            // Get CWPVT (canopy wind extinction parameter) for this vegetation type
            int veg_idx = landtype_arr(i, j, 0) - 1;  // Convert the vegetation class to a 0-based table index
            amrex::Real CanopyWindExtFac = (d_cwpvt != nullptr) ? d_cwpvt[veg_idx] : d_cwpvt_default;
 
            // Stability correction for undercanopy (MoStabCorrShUndCan)
            amrex::Real MoStabCorrShUndCan = one;  // Initialize to neutral
            // For now, use simple stability correction based on temperature difference
            if (temp_diff < zero) {
                // Unstable: (1 - 15*z/L)^(-0.25)
                amrex::Real zeta = std::min(amrex::Real(zero), amrex::Real(-0.1));  // Assume moderately unstable
                MoStabCorrShUndCan = std::pow(one - amrex::Real(15.0) * zeta, -fourth);
            } else {
                // Stable: 1 + 4.7*z/L
                amrex::Real zeta = std::min(amrex::Real(one), amrex::Real(0.1));  // Assume moderately stable
                MoStabCorrShUndCan = one + amrex::Real(4.7) * zeta;
            }
 
            // Wind extinction coefficient
            amrex::Real VegAreaIndEff = std::min(amrex::Real(6.0), LAI_arr(i, j, 0) + SAI_arr(i, j, 0));
            amrex::Real CanopyHeight = ztop_arr(i, j, 0);
            amrex::Real WindExtCoeffCanopy = std::sqrt(CanopyWindExtFac * VegAreaIndEff * CanopyHeight * MoStabCorrShUndCan);
 
            // Roughness lengths
            amrex::Real RoughLenShVegGrd = d_z0_soil;  // Ground roughness for heat under canopy
            amrex::Real RoughLenShCanopy = z0_sfc_arr(i, j, 0);  // Canopy roughness for heat
            amrex::Real ZeroPlaneDispSfc = disp_hgt_arr(i, j, 0);  // Zero plane displacement
 
            // Exponential wind profile terms
            amrex::Real TMP1 = std::exp(-WindExtCoeffCanopy * RoughLenShVegGrd / CanopyHeight);
            amrex::Real TMP2 = std::exp(-WindExtCoeffCanopy * (RoughLenShCanopy + ZeroPlaneDispSfc) / CanopyHeight);
            amrex::Real TMPRAH2 = CanopyHeight * std::exp(WindExtCoeffCanopy) / WindExtCoeffCanopy * (TMP1 - TMP2);
 
            // Turbulent transfer coefficient KH
            amrex::Real KH = std::max(CONST_VON_KARMAN * ustar_arr(i, j, 0) * (CanopyHeight - ZeroPlaneDispSfc), MPE);
 
            // Undercanopy aerodynamic resistance
            r_d_arr(i, j, 0) = TMPRAH2 / KH;
 
            // Original SLM method (commented out for comparison)
            /*
            // temp_diff > 0 : stable undercanopy
            // temp_diff < 0 : unstable undercanopy
            amrex::Real temp_diff = t_cas_arr(i, j, 0) - soilt_arr(i, j, d_khi_lsm);
 
            // turbulent transfer coefficient under dense canopy
            if (temp_diff < zero)
            {
                Cs_dense = 0.004;
            }
            else
            {
                // rd_correc_fac : undercanopy stability parameter, in effect only for stable undercanopy
                amrex::Real rd_correc_fac = CONST_GRAV * ztop_arr(i, j, 0) * std::max(amrex::Real(zero), temp_diff) / soilt_arr(i, j, d_khi_lsm) / (std::pow(ustar_arr(i, j, 0), 2));
                // stable undercanopy - Cs_dense becomes smaller than 0.004
                Cs_dense = 0.004 / (one + myhalf * std::min(amrex::Real(10.0), rd_correc_fac));
            }
 
            // turbulent transfer coefficient over the exposed topsoil
            // typical value of Cs_bare ~0.2
            Cs_bare = 0.4 / 0.13 * std::pow((d_z0_soil * ustar_arr(i, j, 0) / (1.5e-5)), -0.45);
 
            // turbulence transfer coefficient undercanopy
            // LAI-weighed sum of Cs_bare and Cs_dense
            Cs = Cs_bare * std::exp(-1.0 * LAI_arr(i, j, 0)) + Cs_dense * (1.0 - std::exp(-1.0 * LAI_arr(i, j, 0)));
 
            // Undercanopy aerodynamic resistance depends on the weighed sum of the dense canopy covered soil
            // and baresoil turbulent transfer coefficient and friction velocity
            //   Reference: [Oleson et al., 2004] [Zeng et al., 2005]
            r_d_arr(i, j, 0) = std::min(amrex::Real(400.0), 1.0 / ustar_arr(i, j, 0) / Cs); // prevent r_d from getting too large under stable condition
            */
 
            // ===================================================
            // Leaf boundary layer resistance : r_b
            // ===================================================
            // Original SLM formula:
            // r_b_arr(i, j, 0) = 0.5 * r_a_arr(i, j, 0);
 
            // NoahMP leaf boundary resistance from ResistanceLeafToGroundMod.F90.
            const amrex::Real wind_ref = std::max(
                std::sqrt(ur_arr(i, j, 0) * ur_arr(i, j, 0)
                          + vr_arr(i, j, 0) * vr_arr(i, j, 0)), MPE);
            const amrex::Real wind_canopy_top = std::max(
                wind_ref
                    * std::log((CanopyHeight - ZeroPlaneDispSfc + RoughLenShCanopy)
                               / RoughLenShCanopy)
                    / std::log(zrefxy_arr(i, j, 0) / RoughLenShCanopy),
                MPE);
            const amrex::Real rb_factor = WindExtCoeffCanopy * 50.0
                / std::max(one - std::exp(-WindExtCoeffCanopy / two), MPE);
            r_b_arr(i, j, 0) = std::min(amrex::Real(50.0), std::max(amrex::Real(5.0),
                rb_factor * std::sqrt(dleaf_arr(i, j, 0) / wind_canopy_top)));
 
            // Original SLM Method 1 (commented out for reference)
            // turbulent transfer coefficient between canopy surface and canopy air : Cv = 0.01m/s^-0.5
            // characteristic dimension of the leaves in the direction of wind flux : d_leaf = 0.04m
            // r_b_arr(i, j, 0) = 1.0 / 0.01 * std::pow( ustar_arr(i, j, 0) / 0.04, -0.5) / std::max(0.1, LAI_arr(i, j, 0));
            // Above equation seems to overestimate LHF
 
            // ===================================================
            // Stomatal resistance : r_c
            // ===================================================
            // radiation factor (Noah/NoahMP Jarvis bulk formulation)
            // Reference: Noah LSM CANRES subroutine, Chen et al. (1996, 2001)
            amrex::Real RadFac = 0.55 * net_rad_arr(i, j, 0, SLM_NetRad::net_swdn1) * two / Rgl_arr(i, j, 0) / LAI_arr(i, j, 0);
            rc_fac_rad = (Rc_min_arr(i, j, 0) / d_Rc_max + RadFac) / (one + RadFac);
            rc_fac_rad = std::max(rc_fac_rad, amrex::Real(0.0001));
 
            /* Original SLM sunlit/shaded approach (commented out to match Noah bulk approach)
            // TODO: check if this is the correct downwelling SW to use
            //amrex::Real tmp_radf = 0.55 * net_rad_arr(i, j, 0, SLM_NetRad::net_swdn1) * 2.0 / Rgl_arr(i, j, 0) / LAI_arr(i, j, 0);
            //rc_fac_rad = (Rc_min_arr(i, j, 0) / d_Rc_max + tmp_radf) / (1.0 + tmp_radf);
            // modify above to account for the shaded and sunlit part of leaves
            k_beer = phi_1_arr(i, j, 0) + phi_2_arr(i, j, 0); // extinction coef
            f_shade = 0.1 ; // fraction or radiation reaching shaded leaves (empirical)
 
            // partition LAI into sunlit and shaded components
            lai_sun = std::max(amrex::Real(1.e-6), (one - std::exp(-one * k_beer * LAI_arr(i, j, 0))) / k_beer);
            lai_shade = std::max(amrex::Real(zero), LAI_arr(i, j, 0) - lai_sun);
 
            // Radiation reaching to sunlit and shaded leaves
            sw_sun = net_rad_arr(i, j, 0, SLM_NetRad::net_swdn1);
            sw_shade = f_shade * sw_sun;
 
            // compute radiation factors (NoahMP Jarvis form - no LAI division)
            tmp_sun = 0.55 * sw_sun * 2. / Rgl_arr(i, j, 0);
            tmp_shade = 0.55 * sw_shade * 2. / Rgl_arr(i, j, 0);
            rc_fac_sun   = (Rc_min_arr(i,j,0) / d_Rc_max + tmp_sun) / (one + tmp_sun);
            rc_fac_shade = (Rc_min_arr(i,j,0) / d_Rc_max + tmp_shade) / (one + tmp_shade);
 
            // combine weighted by LAI
            rc_fac_rad = (lai_sun * rc_fac_sun + lai_shade * rc_fac_shade) / LAI_arr(i, j, 0);
            *///
 
 
            // vapor pressure deficit factor (Noah/NoahMP Jarvis formulation)
            // Noah uses VPD in mixing ratio units (kg/kg), not vapor pressure (hPa)
            // Reference: Noah LSM CANRES subroutine, Chen et al. (1996, 2001)
            amrex::Real qsatw;
            erf_qsatw(t_cas_arr(i, j, 0), pref_arr(i, j, 0), qsatw);
            amrex::Real VPD_mixratio = qsatw - q_cas_arr(i, j, 0); // VPD in mixing ratio [kg/kg]
            rc_fac_vpd = one / (one + hs_rc_arr(i, j, 0) * VPD_mixratio);
            rc_fac_vpd = std::max(rc_fac_vpd, amrex::Real(0.01));
 
            /* Original SLM VPD calculation using vapor pressure in hPa (commented out)
            // Above is modified following changes in gSAM-SLM
            amrex::Real e_cas, es_cas;
            e_cas = q_cas_arr(i, j, 0) * pref_arr(i, j ,0)/(0.622+0.388*q_cas_arr(i, j, 0)); //vapor pressure in hPa (mb)
            es_cas = erf_esatw(t_cas_arr(i, j, 0));
            // NoahMP Jarvis form: hyperbolic response to VPD
            rc_fac_vpd = one / (one + hs_rc_arr(i, j, 0) * (es_cas - e_cas));
            *///
 
            // temperature factor
            rc_fac_t = std::max(amrex::Real(zero), one - amrex::Real(0.0016) * amrex::Math::powi<2>(d_T_opt - t_cas_arr(i, j, 0)));
 
            // NoahMP BTR_OPTION=1 soil-moisture stress factor. All rooted
            // layers remain in the depth denominator, including dry layers.
            const int nroot_cell = nroot_arr(i, j, 0);
            d_root = zero;
            for (int k = 0; k < nroot_cell; k++) {
                const int lsm_k = d_khi_lsm - k;
                d_root += s_depth_arr(i, j, lsm_k);
            }
 
            rc_fac_sw = zero;
            amrex::Real transp_frac_sum = zero;
            for (int k = 0; k < nroot_cell; k++) {
                const int lsm_k = d_khi_lsm - k;
                const amrex::Real theta_liq = soilw_arr(i, j, lsm_k) * poro_soil_arr(i, j, lsm_k);
                const amrex::Real moisture_range = theta_FC_arr(i, j, lsm_k) - theta_WP_arr(i, j, lsm_k);
                const amrex::Real soil_wet_fac = std::min(amrex::Real(one), std::max(amrex::Real(zero),
                    (theta_liq - theta_WP_arr(i, j, lsm_k)) / moisture_range));
                const amrex::Real transp_frac =
                    s_depth_arr(i, j, lsm_k) / std::max(amrex::Real(1.0e-6), d_root) * soil_wet_fac;
                soil_transp_frac_arr(i, j, lsm_k) = transp_frac;
                transp_frac_sum += transp_frac;
                rc_fac_sw += std::max(amrex::Real(1.0e-6), transp_frac);
            }
 
            rc_fac_sw = std::max(amrex::Real(1.0e-6), rc_fac_sw);
            for (int k = 0; k < nroot_cell; k++) {
                const int lsm_k = d_khi_lsm - k;
                if (transp_frac_sum > zero) {
                    soil_transp_frac_arr(i, j, lsm_k) /= transp_frac_sum;
                }
            }
 
            tmp_radf = std::max(amrex::Real(1.0e-6), rc_fac_rad*rc_fac_vpd*rc_fac_t*rc_fac_sw);
            // Leaf-level stomatal resistance. LAI is applied once when this
            // resistance is converted to canopy transpiration conductance.
            r_c_arr(i, j, 0) = std::min(d_Rc_max, Rc_min_arr(i, j, 0) / tmp_radf);
 
            // ===================================================
            // r_litter : litter resistance - not used in this version
            // ===================================================
            //r_litter_arr(i, j, 0) = 0.0;
            //   Ref. [Sakaguchi and Zeng 2009]
            //   Set litter LAI as 0.5
            // r_litter_arr(i, j, 0) = 1.0 / 0.004 / ustar_arr(i, j, 0) * (1.0 - std::exp(-0.5));
        }
    });
}

Here is the call graph for this function:

set_dt()

void SLM::set_dt ( const amrex::Real &  dt )

inline

                                      {
        m_dt = dt;
    }

set_precip_input()

void SLM::set_precip_input ( const amrex::MultiFab *  precip_in )

overridevirtual

Reimplemented from NullSurf.

{
    int khi = khi_lsm;
 
    auto tsurf = lsm_fab_vars[LsmVar_SLM::tsurf];
 
    for ( MFIter mfi(*tsurf, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box3d = mfi.tilebox();
 
        // Create a box with the same i,j bounds, but only at z = 0
        amrex::Box b2d = box3d;
        b2d.setRange(2, 0);
 
        auto precip_array = precip_in->const_array(mfi);
 
        auto slm_precip   = lsm_fab_vars[LsmVar_SLM::precipref]->array(mfi);
 
        ParallelFor(b2d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
        {
            slm_precip(i, j, k) = precip_array(i, j, k, 0);
 
            // TODO: this is for plotting purposes.. state arrays are at k=0 which is ghost cell for SLM values
            //  SLM AMREX plotfile does not write ghost cells, but NetCDF does - fix?
            slm_precip(i, j, khi) = slm_precip(i, j, 0);
        });
    }
}

Here is the call graph for this function:

set_terrain_inputs()

void SLM::set_terrain_inputs ( const amrex::Vector< std::unique_ptr< amrex::MultiFab >> &  sst_in, const amrex::Vector< std::unique_ptr< amrex::iMultiFab >> &  lmask_in  )

overridevirtual

Reimplemented from NullSurf.

{
    if (!first_step)
    {
        return;
    }
    auto tsurf = lsm_fab_vars[LsmVar_SLM::tsurf];
    const int d_khi_lsm = khi_lsm;
 
    if (lmask_in[0]) {
        for ( MFIter mfi(*tsurf, TileNoZ()); mfi.isValid(); ++mfi) {
            const auto& box3d = mfi.tilebox();
 
            // Create a box with the same i,j bounds, but only at z = 0
            amrex::Box b2d = box3d;
            b2d.setRange(2, 0);
 
            auto lmask_array = lmask_in[0]->array(mfi);
            auto slm_lmask = landmask.array(mfi);
            ParallelFor(b2d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
            {
                slm_lmask(i, j, k) = lmask_array(i, j, k, 0);
            });
        }
    } else {
        landmask.setVal(1);
    }
 
    if (!use_wrfinput) {
        slm_init();
    }
 
    if (sst_in[0]) {
        // Set SLM surface temperature input from ERF.
        for ( MFIter mfi(*tsurf, TileNoZ()); mfi.isValid(); ++mfi) {
            const auto& box3d = mfi.tilebox();
 
            // Create a box with the same i,j bounds, but only at z = 0
            amrex::Box b2d = box3d;
            b2d.setRange(2, 0);
 
            auto sst_array = sst_in[0]->array(mfi);
            auto slm_sst = sstxy.array(mfi);
            auto slm_tsk = lsm_fab_vars[LsmVar_SLM::tsurf]->array(mfi);
            auto slm_tskin = t_skin.array(mfi);
            const bool d_use_wrfinput = use_wrfinput;
            ParallelFor(b2d, [=] AMREX_GPU_DEVICE (int i, int j, int k)
            {
                const amrex::Real tsk = d_use_wrfinput
                    ? slm_tsk(i, j, d_khi_lsm)
                    : sst_array(i, j, k, 0);
                slm_sst(i, j, k) = tsk;
                slm_tsk(i, j, k) = tsk;
                slm_tskin(i, j, k) = tsk;
            });
        }
    } else if (!use_wrfinput) {
        // If no terrain is setup, initialize SST to reference temperature.
        lsm_fab_vars[LsmVar_SLM::tsurf]->setVal(st0[0]);
    }
}

Here is the call graph for this function:

slm_init()

void SLM::slm_init

(

)

Initialize SLM

{
    // validate the landtype flag
    const int landtype_min = landtype.min(0);
    const int landtype_max = landtype.max(0);
    if (landtype_min < 0 || landtype_max > 16)
    {
        amrex::Abort("SLM: landtype values are outside of valid 0-16 range! min = " +
                     std::to_string(landtype_min) + ", max = " + std::to_string(landtype_max));
    }
 
    // validate LAI - check that they are within [0,10]
    const double lai_min = LAI.min(0);
    const double lai_max = LAI.max(0);
    if (lai_min < zero || lai_max > 10.0)
    {
      amrex::Abort("SLM: LAI values are outside of valid [0-10] range! min = " +
                   std::to_string(lai_min) + ", max = " + std::to_string(lai_max));
    }
 
    if (use_param_file && landtype_max > num_veg_params)
    {
        amrex::Abort("SLM: vegetation category " + std::to_string(landtype_max) +
                     " is outside the selected parameter table range [1, " +
                     std::to_string(num_veg_params) + "]");
    }
    if (interpolate_lai && landtype_max > num_landtypes)
    {
        amrex::Abort("SLM: vegetation category " + std::to_string(landtype_max) +
                     " is outside the LAI/SAI table range [1, " +
                     std::to_string(num_landtypes) + "]");
    }
    if (use_param_file) {
        const auto& soiltype = *lsm_fab_vars[LsmVar_SLM::soiltype];
        const int soiltype_min = static_cast<int>(soiltype.min(0));
        const int soiltype_max = static_cast<int>(soiltype.max(0));
        if (soiltype_min < 0 || soiltype_max > num_soil_params)
        {
            amrex::Abort("SLM: soil categories are outside the selected parameter table range [1, " +
                         std::to_string(num_soil_params) + "]! min = " +
                         std::to_string(soiltype_min) + ", max = " +
                         std::to_string(soiltype_max));
        }
    }
 
    // Sets model properties based on the landtype
    init_landtype();
 
    // TODO: VEGYES and set minimum LAI
    vege_YES.setVal(one);
 
    for ( MFIter mfi(landtype, TileNoZ()); mfi.isValid(); ++mfi) {
        const auto& box = mfi.tilebox();
 
        auto vege_YES_arr = vege_YES.array(mfi);
        auto vegetype_arr = vegetype.const_array(mfi);
        auto nroot_arr = nroot.array(mfi);
        auto landtype_arr = landtype.const_array(mfi);
 
        auto IR_emis_vege_arr = IR_emis_vege.array(mfi);
        auto IR_emis_soil_arr = IR_emis_soil.array(mfi);
        auto IR_emis_grnd_arr = IR_emis_grnd.array(mfi);
        auto phi_1_arr = phi_1.array(mfi);
        auto phi_2_arr = phi_2.array(mfi);
        auto precip_extinc_arr = precip_extinc.array(mfi);
        auto mw_mx_arr = mw_mx.array(mfi);
        auto LAI_arr = LAI.array(mfi);
        auto BAI_arr = BAI.const_array(mfi);
        auto IMPERV_arr = IMPERV.const_array(mfi);
        auto ztop_arr = ztop.const_array(mfi);
        auto Khai_L_arr = Khai_L.array(mfi);
        auto landmask_arr = landmask.const_array(mfi);
 
        auto veg_frac_arr = lsm_fab_vars[LsmVar_SLM::veg_frac]->array(mfi);
 
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            if (landmask_arr(i, j, 0) == 1) {
                if (vegetype_arr(i, j, 0) == 0) {
                    vege_YES_arr(i, j, 0) = zero;
                    veg_frac_arr(i, j, 0) = zero;
                    nroot_arr(i, j, 0) = 0;
                } else {
                    // set minimum LAI for vegetated land
                    LAI_arr(i, j, 0) = std::max(LAI_arr(i, j, 0), amrex::Real(0.001));
                }
 
                phi_1_arr(i, j, 0) = myhalf - 0.633 * Khai_L_arr(i, j, 0) - 0.33 * amrex::Math::powi<2>(Khai_L_arr(i, j, 0));
                phi_2_arr(i, j, 0) = 0.877 * (one - two * phi_1_arr(i, j, 0));
                IR_emis_vege_arr(i, j, 0) = 0.97 * (one - std::exp(-(phi_1_arr(i, j, 0) + phi_2_arr(i, j, 0)) * LAI_arr(i, j, 0)));
                precip_extinc_arr(i, j, 0) = phi_1_arr(i, j, 0) + phi_2_arr(i, j, 0);
                //mw_mx_arr(i, j, 0) = 0.1 * LAI_arr(i, j, 0);
                //add the basal area to mw_mx. circumference of trunks per unit area = sqrt(4*PI*basal area), which then is converted from sq.feet/sq acre to m2/m2 by diving by 43560
                mw_mx_arr(i, j, 0) = 0.1 * LAI_arr(i, j, 0) + ztop_arr(i, j, 0) * std::pow(four * PI * BAI_arr(i, j, 0) / amrex::Real(43560.0), myhalf);
 
                if(landtype_arr(i, j, 0) == 13)
                {
                    IR_emis_grnd_arr(i, j, 0) = IR_emis_urban * IMPERV_arr(i, j, 0) + IR_emis_soil_arr(i, j, 0) * (1.-IMPERV_arr(i, j, 0)); // urban IR emissivity
                }
                else
                {
                    IR_emis_grnd_arr(i, j, 0) = IR_emis_soil_arr(i, j, 0);
                }
            } else {
                vege_YES_arr(i, j, 0) = zero;
                veg_frac_arr(i, j, 0) = zero;
            }
        });
    }
 
    // Initialize soil parameters
    init_soil_tw();
 
    init_soil_vars();
 
    // Update any parameters using the values from a parameter file
    init_from_params();
}

Here is the call graph for this function:

snow_age_noahmp()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE void SLM::snow_age_noahmp ( amrex::Real  dt, amrex::Real  tg, amrex::Real  sneqvo, amrex::Real  sneqv, amrex::Real  tau0, amrex::Real  grain_growth, amrex::Real  extra_growth, amrex::Real  dirt_soot, amrex::Real  swemx, amrex::Real &  tauss, amrex::Real &  fage  )

static

{
    //input
    //  DT        !main time step (s)
    //  TG        !ground temperature (k)
    //  SNEQVO    !snow mass at last time step(mm)
    //  SNEQV     !snow water per unit ground area (mm)
 
    //output
    //  FAGE     !snow age
 
    //input/output
    //  TAUSS      !non-dimensional snow age
 
    //local
    amrex::Real tage;       //total aging effects
    amrex::Real age1;       //effects of grain growth due to vapor diffusion
    amrex::Real age2;       //effects of grain growth at freezing of melt water
    amrex::Real age3;       //effects of soot
    amrex::Real dela;       //temporary variable
    amrex::Real sge;        //temporary variable
    amrex::Real dels;       //temporary variable
    amrex::Real dela0;      //temporary variable
    amrex::Real arg;        //temporary variable
    // See Yang et al. (1997) J.of Climate for detail.
 
    constexpr amrex::Real TFRZ = 273.16; // freezing/melting point (k)
 
    if(sneqv <= zero) {
        tauss = zero;
    } else {
        dela0 = dt/tau0;
        arg   = grain_growth*(1.0/TFRZ-1.0/tg);
        age1  = std::exp(arg);
        age2  = std::exp(std::min(amrex::Real(zero), extra_growth*arg));
        age3  = dirt_soot;
        tage  = age1+age2+age3;
        dela  = dela0*tage;
        dels  = std::max(amrex::Real(zero), sneqv-sneqvo) / swemx;
        sge   = (tauss+dela)*(1.0-dels);
        tauss = std::max(amrex::Real(zero),sge);
    }
 
    fage= tauss/(tauss+1.0);
}

snowalb_bats_noahmp()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE void SLM::snowalb_bats_noahmp ( int  nband, amrex::Real  fsno, amrex::Real  cosz, amrex::Real  fage, amrex::Real  bats_cosz, amrex::Real  bats_vis_new, amrex::Real  bats_nir_new, amrex::Real  bats_vis_age, amrex::Real  bats_nir_age, amrex::Real  bats_vis_dir, amrex::Real  bats_nir_dir, amrex::Real *  albsnd, amrex::Real *  albsni  )

static

{
    // --------------------------------------------------------------------------------------------------
    // input
    //  NBAND  !number of waveband classes
    //  COSZ    !cosine solar zenith angle
    //  FSNO    !snow cover fraction (-)
    //  FAGE    !snow age correction
 
    // output
    //  ALBSND !snow albedo for direct(1=vis, 2=nir)
    //  ALBSNI !snow albedo for diffuse
    // ---------------------------------------------------------------------------------------------
 
    // ------------------------ local variables ----------------------------------------------------
    amrex::Real fzen;                 //zenith angle correction
    amrex::Real cf1;                  //temporary variable
    amrex::Real sl2;                  //2.*SL
    amrex::Real sl1;                  //1/SL
    amrex::Real sl;                   //adjustable parameter
    //  REAL, PARAMETER :: C1 = 0.2  !default in BATS
    //  REAL, PARAMETER :: C2 = 0.5  !default in BATS
    //  REAL, PARAMETER :: C1 = 0.2 * 2. ! double the default to match Sleepers River's
    //  REAL, PARAMETER :: C2 = 0.5 * 2. ! snow surface albedo (double aging effects)
    // ---------------------------------------------------------------------------------------------
    // zero albedos for all points
 
    albsnd[0] = zero;
    albsnd[1] = zero;
    albsni[0] = zero;
    albsni[1] = zero;
 
    // when cosz > 0
 
    sl=bats_cosz;
    sl1=1.0/sl;
    sl2=two*sl;
    cf1=((1.0+sl1)/(1.0+sl2*cosz)-sl1);
    fzen=std::max(cf1,amrex::Real(zero));
 
    albsni[0]=bats_vis_new*(1.0-bats_vis_age*fage);
    albsni[1]=bats_nir_new*(1.0-bats_nir_age*fage);
 
    albsnd[0]=albsni[0]+bats_vis_dir*fzen*(1.0-albsni[0]);    //  vis direct
    albsnd[1]=albsni[1]+bats_nir_dir*fzen*(1.0-albsni[1]);    //  nir direct
}

soil_nudging()

void SLM::soil_nudging

(

const amrex::MFIter &

mfi3d

)

{
    if (!dosoiltnudging && !dosoilwnudging) return;
 
    const Real dt = m_dt;
 
    auto box = mfi3d.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi3d);
 
    auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->array(mfi3d);
    auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->array(mfi3d);
 
    auto soilt_nudge_arr = lsm_fab_vars[LsmVar_SLM::soilt_nudge]->array(mfi3d);
    auto soilw_nudge_arr = lsm_fab_vars[LsmVar_SLM::soilw_nudge]->array(mfi3d);
    auto soil_relax_hgt_arr = lsm_fab_vars[LsmVar_SLM::soil_relax_hgt]->const_array(mfi3d);
 
    auto soilt_obs_arr = lsm_fab_vars[LsmVar_SLM::soilt_obs]->const_array(mfi3d);
    auto soilw_obs_arr = lsm_fab_vars[LsmVar_SLM::soilw_obs]->const_array(mfi3d);
 
    const Real d_tau = tausoil;
    if (dosoiltnudging)
    {
        ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int k)
        {
            if (landmask_arr(i, j, 0) != 1) {
                return;
            }
 
            soilt_arr(i, j, k) -= (soilt_arr(i, j, k) - soilt_obs_arr(i, j, k))*dt/d_tau*soil_relax_hgt_arr(i, j, k);
            soilt_nudge_arr(i, j, k) = (soilt_arr(i, j, k) - soilt_obs_arr(i, j, k))*soil_relax_hgt_arr(i, j, k) / d_tau;
        });
    }
 
    if (dosoilwnudging)
    {
        ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int k)
        {
            if (landmask_arr(i, j, 0) != 1) {
                return;
            }
 
            soilw_arr(i, j, k) -= (soilw_arr(i, j, k) - soilw_obs_arr(i, j, k))*dt/d_tau*soil_relax_hgt_arr(i, j, k);
            soilw_nudge_arr(i, j, k) = (soilw_arr(i, j, k) - soilw_obs_arr(i, j, k))*soil_relax_hgt_arr(i, j, k) / d_tau;
        });
    }
}

Here is the call graph for this function:

soil_temperature()

void SLM::soil_temperature

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const int d_klo_lsm = klo_lsm;
    const int d_nz_lsm = m_nz_lsm;
    const Real dt = m_dt;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
    auto landtype_arr = landtype.const_array(mfi);
 
    auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->array(mfi);
    auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
 
    auto sst_capa_arr = lsm_fab_vars[LsmVar_SLM::sst_capa]->const_array(mfi);
    auto sst_cond_arr = lsm_fab_vars[LsmVar_SLM::sst_cond]->const_array(mfi);
    auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
 
    auto s_depth_arr = lsm_fab_vars[LsmVar_SLM::s_depth]->const_array(mfi);
 
    auto slm_diag_arr = slm_diag.array(mfi);
 
    auto dst_vars = soilt_vars.array(mfi);
 
    auto mws_arr = mws.array(mfi);
 
    // TODO: Refactor this whole loop for GPU
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
 
        amrex::Real temp, k_dry, k_sat, Ke;
 
        amrex::Real grflux0 = slm_diag_arr(i, j, 0, SLM_Diag::grflux);
        slm_diag_arr(i, j, 0, SLM_Diag::grflux) = grflux0;
        if (landtype_arr(i, j, 0) == 15) {
            // ice
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
                dst_vars(i, j, lsm_k, SLM_DST::st_cond) = 1.6; // thermal conductivity of ice
                dst_vars(i, j, lsm_k, SLM_DST::st_capa) = 917.0 * 2030.0; // ice heat capacity
            }
        } else {
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
 
                temp = (1.0 - poro_soil_arr(i, j, lsm_k)) * 2700.0;
 
                // dry thermal conductivity [W/mK]
                k_dry = (0.135 * temp + 64.7) / (2700.0 - 0.947*temp);
 
                // saturated soil thermal conductivity
                k_sat = std::pow(sst_cond_arr(i, j, lsm_k), one - poro_soil_arr(i, j, lsm_k));
                if (soilt_arr(i, j, lsm_k) > tfriz) {
                    k_sat *= std::pow(amrex::Real(0.57), poro_soil_arr(i, j, lsm_k)); // 0.57 = cond_water
                }
                else {
                    k_sat *= std::pow(amrex::Real(1.60), poro_soil_arr(i, j, lsm_k)); // 1.6 = cond_ice
                }
 
                // Weighing factor between dry and saturated soil thermal conductivity
                Ke = std::log10(std::max(amrex::Real(0.1), soilw_arr(i, j, lsm_k))) + one;
 
                // Total soil thermal conductivity at each node_z
                dst_vars(i, j, lsm_k, SLM_DST::st_cond) = Ke * (k_sat - k_dry) + k_dry;
 
                // Soil volumetric heaet capacity at each node_z depth
                if (soilt_arr(i, j, lsm_k) > tfriz) {
                    dst_vars(i, j, lsm_k, SLM_DST::st_capa) =
                        (1.0 - poro_soil_arr(i, j, lsm_k)) *
                        sst_capa_arr(i, j, lsm_k) +
                        (998.0 * 4182.0) * soilw_arr(i, j, lsm_k) *
                        poro_soil_arr(i, j, lsm_k); // water heat capacity
                } else {
                    dst_vars(i, j, lsm_k, SLM_DST::st_capa) =
                        (1.0 - poro_soil_arr(i, j, lsm_k)) *
                        sst_capa_arr(i, j, lsm_k) +
                        (917.0 * 2030.0) * soilw_arr(i, j, lsm_k) *
                        poro_soil_arr(i, j, lsm_k); // ice heat capacity
                }
            }
        }
 
        for (int k = 0; k < d_nz_lsm - 1; k++) {
            const int lsm_k = d_khi_lsm - k;
 
            // calculate effective conductivity at the adjacent soil layer interface
            dst_vars(i, j, lsm_k, SLM_DST::st_eff_cond) =
                (dst_vars(i, j, lsm_k - 1, SLM_DST::st_cond) * s_depth_arr(i, j, lsm_k - 1) +
                 dst_vars(i, j, lsm_k, SLM_DST::st_cond) * s_depth_arr(i, j, lsm_k)) /
                 (s_depth_arr(i, j, lsm_k - 1) + s_depth_arr(i, j, lsm_k));
        }
 
        // from FDE by the implicit, Thomas algorithm is applied
        //   aa: terms related with T(k-1)
        //   bb: terms related with T(k)
        //   cc: terms related with T(k+1)
        //   dd: current soil temperature + (additional source/sink on soil top)
        // For first layer:
        amrex::Real aa = zero;
        amrex::Real cc =
          -two * dst_vars(i, j, d_khi_lsm, SLM_DST::st_eff_cond) * dt /
          dst_vars(i, j, d_khi_lsm, SLM_DST::st_capa) /
          (s_depth_arr(i, j, d_khi_lsm) *
           (s_depth_arr(i, j, d_khi_lsm) + s_depth_arr(i, j, d_khi_lsm - 1)));
        amrex::Real bb = 1.0 - cc;
        amrex::Real dd = soilt_arr(i, j, d_khi_lsm) - grflux0 * dt / s_depth_arr(i, j, d_khi_lsm) / dst_vars(i, j, d_khi_lsm, SLM_DST::st_capa);
 
        dst_vars(i, j, d_khi_lsm, SLM_DST::alpha) = cc / bb;
        dst_vars(i, j, d_khi_lsm, SLM_DST::beta) = dd / bb;
 
        // For 2-(nsoil-1) layer:
        for (int k = 1; k < d_nz_lsm - 1; k++) {
            // NOTE: SLM k-1 indices here are switched from original SAM
            // version because our soil level indices are from -1 (top) to
            // -nsoil (bottom)
            // Index mapping:
            //  SAM SLM  -> ERF SLM
            //   1       ->  d_khi_lsm
            //   k - 1   ->  k + 1
            //   k + 1   ->  k - 1
            //   nsoil   ->  d_klo_lsm
            const int lsm_k = d_khi_lsm - k;
 
            const amrex::Real st_eff_cond_up = dst_vars(i, j, lsm_k + 1, SLM_DST::st_eff_cond);
            const amrex::Real st_eff_cond    = dst_vars(i, j, lsm_k    , SLM_DST::st_eff_cond);
            const amrex::Real st_capa        = dst_vars(i, j, lsm_k,     SLM_DST::st_capa);
 
            aa = -two * st_eff_cond_up * dt / s_depth_arr(i, j, lsm_k) / st_capa / (s_depth_arr(i, j, lsm_k+1) + s_depth_arr(i, j, lsm_k));
            cc = -two * st_eff_cond * dt / s_depth_arr(i, j, lsm_k) / st_capa / (s_depth_arr(i, j, lsm_k) + s_depth_arr(i, j, lsm_k-1));
            bb = 1.0 - cc - aa;
            dd = soilt_arr(i, j, lsm_k); // current time step
 
            dst_vars(i, j, lsm_k, SLM_DST::alpha) = cc / (bb - aa * dst_vars(i, j, lsm_k + 1, SLM_DST::alpha));
            dst_vars(i, j, lsm_k, SLM_DST::beta) = (dd - aa * dst_vars(i, j, lsm_k + 1, SLM_DST::beta)) / (bb - aa * dst_vars(i, j, lsm_k + 1, SLM_DST::alpha));
        }
 
        // For bottom layer:
        aa = -two * dst_vars(i, j, d_klo_lsm + 1, SLM_DST::st_eff_cond) * dt / s_depth_arr(i, j, d_klo_lsm) / dst_vars(i, j, d_klo_lsm, SLM_DST::st_capa) / (s_depth_arr(i, j, d_klo_lsm + 1) + s_depth_arr(i, j, d_klo_lsm));
        cc = zero;
        bb = 1.0 - aa;
        dd = soilt_arr(i, j, d_klo_lsm);
 
        dst_vars(i, j, d_klo_lsm, SLM_DST::alpha)  = zero;
        dst_vars(i, j, d_klo_lsm, SLM_DST::beta) = (dd - aa * dst_vars(i, j, d_klo_lsm + 1, SLM_DST::beta)) / (bb - aa * dst_vars(i, j, d_klo_lsm + 1, SLM_DST::alpha));
 
        // (n+1) time step soil temperature:
        soilt_arr(i, j, d_klo_lsm) = dst_vars(i, j, d_klo_lsm, SLM_DST::beta);
        for (int k = d_nz_lsm - 2; k >= 0; k--) {
            const int lsm_k = d_khi_lsm - k;
            soilt_arr(i, j, lsm_k) = dst_vars(i, j, lsm_k, SLM_DST::beta) - dst_vars(i, j, lsm_k, SLM_DST::alpha) * soilt_arr(i, j, lsm_k - 1);
        }
 
        // for wetland, surface water is already implied: gSAM+SLM
        if (landtype_arr(i, j, 0) == 11) {
            mws_arr(i, j, 0) = zero;
        }
    });
}

Here is the call graph for this function:

soil_water()

void SLM::soil_water

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const int d_klo_lsm = klo_lsm;
    const int d_nz_lsm = m_nz_lsm;
    const Real dt = m_dt;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
    auto landtype_arr = landtype.const_array(mfi);
 
    auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->const_array(mfi);
    auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->array(mfi);
 
    auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
    auto s_depth_arr = lsm_fab_vars[LsmVar_SLM::s_depth]->const_array(mfi);
 
    auto IMPERV_arr = IMPERV.const_array(mfi);
 
    auto mws_arr = mws.array(mfi);
    auto mws_mx_arr = mws_mx.const_array(mfi);
 
    auto evp_soil_arr = evp_soil.const_array(mfi);
    auto evapo_dry_arr = evapo_dry.const_array(mfi);
    auto prsfc_arr  = lsm_fab_vars[LsmVar_SLM::prsfc]->array(mfi);
    auto m_pot_sat_arr = lsm_fab_vars[LsmVar_SLM::m_pot_sat]->const_array(mfi);
    auto ks_arr = lsm_fab_vars[LsmVar_SLM::ks]->const_array(mfi);
    auto Bconst_arr = lsm_fab_vars[LsmVar_SLM::Bconst]->const_array(mfi);
    auto w_s_WP_arr = lsm_fab_vars[LsmVar_SLM::w_s_WP]->const_array(mfi);
    auto w_s_FC_arr = lsm_fab_vars[LsmVar_SLM::w_s_FC]->const_array(mfi);
    auto soil_transp_frac_arr = lsm_fab_vars[LsmVar_SLM::soil_transp_frac]->const_array(mfi);
 
    auto slm_diag_arr = slm_diag.array(mfi);
 
    auto dsw_vars = soilw_vars.array(mfi);
 
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
 
        amrex::Real aa, bb, cc, dd;
            amrex::Real precip_in = zero;
        amrex::Real precip_sfc_loc = prsfc_arr(i, j, 0);
 
        if (landtype_arr(i, j, 0) == 15) {
            // ice
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
                soilw_arr(i, j, lsm_k) = zero;
            }
        } else {
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
                dsw_vars(i, j, lsm_k, SLM_DSW::sdepth_mm) = s_depth_arr(i, j, lsm_k) * 1.0e3;
            }
            const amrex::Real ground_flux = evp_soil_arr(i, j, 0);
            const amrex::Real pond_evaporation = std::min(std::max(amrex::Real(zero), ground_flux),
                std::max(amrex::Real(zero), mws_arr(i, j, 0)) / dt);
            const amrex::Real soil_evaporation =
                std::max(amrex::Real(zero), ground_flux - pond_evaporation);
            mws_arr(i, j, 0) = std::max(amrex::Real(zero),
                mws_arr(i, j, 0) - pond_evaporation * dt
                - std::min(amrex::Real(zero), ground_flux) * dt);
 
            // Calculate precipitation infiltration rate into the first soil layer
            bool any_less_than_one = false;
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
                if(soilw_arr(i, j, lsm_k) < one) {
                    any_less_than_one = true;
                    break;
                }
            }
            if (any_less_than_one && soilt_arr(i, j, d_khi_lsm) >= tfriz)
            {
                precip_in = (1.-IMPERV_arr(i, j, 0))*std::min(precip_sfc_loc + mws_arr(i, j, 0)/dt, ks_arr(i, j, d_khi_lsm));
            } else {
                precip_in = zero;
            }
            // calculate diffusion coefficient and velocity for soil moisture transfer
            // at each interfacial layer(= between adjacent soil layers)
            for (int k = 0; k < d_nz_lsm - 1; k++) {
                const int lsm_k = d_khi_lsm - k;
 
                if (soilt_arr(i, j, lsm_k) >= tfriz && soilt_arr(i, j, lsm_k-1) >= tfriz)
                {
                    const amrex::Real sd_lo = dsw_vars(i, j, lsm_k - 1, SLM_DSW::sdepth_mm);
                    const amrex::Real sd    = dsw_vars(i, j, lsm_k    , SLM_DSW::sdepth_mm);
                    const amrex::Real dz = sd + sd_lo;
 
                    dsw_vars(i, j, lsm_k, SLM_DSW::sh_eff_cond) =
                      (sd * std::pow(
                              soilw_arr(i, j, lsm_k),
                              Bconst_arr(i, j, lsm_k) + two) +
                       sd_lo * std::pow(
                                 soilw_arr(i, j, lsm_k - 1),
                                 Bconst_arr(i, j, lsm_k) + two)) /
                      dz * ks_arr(i, j, lsm_k) * Bconst_arr(i, j, lsm_k) *
                      std::abs(m_pot_sat_arr(i, j, lsm_k)) /
                      poro_soil_arr(i, j, lsm_k);
 
                    dsw_vars(i, j, lsm_k, SLM_DSW::sh_eff_vel) =
                      (sd * std::pow(
                              soilw_arr(i, j, lsm_k),
                              two * Bconst_arr(i, j, lsm_k) + two) +
                       sd_lo * std::pow(
                                 soilw_arr(i, j, lsm_k - 1),
                                 two * Bconst_arr(i, j, lsm_k) + two)) /
                      dz * ks_arr(i, j, lsm_k) / poro_soil_arr(i, j, lsm_k);
                } else {
                    // no water movement between two layers, one of which is frozen
                    dsw_vars(i, j, lsm_k, SLM_DSW::sh_eff_cond) = zero;
                    dsw_vars(i, j, lsm_k, SLM_DSW::sh_eff_vel) = zero;
                }
            }
 
            // make saturated soil for wetlands
            if (landtype_arr(i, j, 0) == 11)
            {
                for (int k = 0; k < d_nz_lsm; k++) {
                    const int lsm_k = d_khi_lsm - k;
                    soilw_arr(i, j, lsm_k) = w_s_FC_arr(i, j, lsm_k);
                }
            }
 
            // from FDE by the implicit method, Thomas algorithm is applied
            //  aa: terms related with soilw(k-1)
            //  bb: terms related with soilw(k)
            //  cc: terms related with soilw(k+1)
            //  dd: current soil wetness - sink + source
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
                if (soilw_arr(i, j, lsm_k) < w_s_WP_arr(i, j, lsm_k))
                {
                    dsw_vars(i, j, lsm_k, SLM_DSW::sw_wgt) = zero;
                } else {
                    dsw_vars(i, j, lsm_k, SLM_DSW::sw_wgt) = one;
                }
            }
            aa = zero;
            cc = -two * dsw_vars(i, j, d_khi_lsm, SLM_DSW::sh_eff_cond)*dt/(dsw_vars(i, j, d_khi_lsm, SLM_DSW::sdepth_mm)*(dsw_vars(i, j, d_khi_lsm, SLM_DSW::sdepth_mm) + dsw_vars(i, j, d_khi_lsm - 1, SLM_DSW::sdepth_mm)));
            bb = 1.0 - cc + dsw_vars(i, j, d_khi_lsm, SLM_DSW::sh_eff_vel)*dt/dsw_vars(i, j, d_khi_lsm, SLM_DSW::sdepth_mm);
            dd = soilw_arr(i, j, d_khi_lsm) - (soil_evaporation + soil_transp_frac_arr(i, j, d_khi_lsm)*evapo_dry_arr(i, j, 0) - precip_in)*dt / poro_soil_arr(i, j, d_khi_lsm) / dsw_vars(i, j, d_khi_lsm, SLM_DSW::sdepth_mm);
 
            dsw_vars(i, j, d_khi_lsm, SLM_DSW::alpha) = cc / bb;
            dsw_vars(i, j, d_khi_lsm, SLM_DSW::beta) = dd / bb;
 
            // For 2-(nsoil-1) layer:
            for (int k = 1; k < d_nz_lsm - 1; k++) {
                // NOTE: SLM k-1 indices here are switched from original SAM
                // version because our soil level indices are from -1 (top) to
                // -nsoil (bottom)
                // Index mapping:
                //  SAM SLM  -> ERF SLM
                //   1       ->  d_khi_lsm
                //   k - 1   ->  k + 1
                //   k + 1   ->  k - 1
                //   nsoil   ->  d_klo_lsm
                const int lsm_k = d_khi_lsm - k; // lsm_k = -2 to -nsoil+1
 
                const amrex::Real sd_lo = dsw_vars(i, j, lsm_k - 1, SLM_DSW::sdepth_mm);
                const amrex::Real sd    = dsw_vars(i, j, lsm_k    , SLM_DSW::sdepth_mm);
                const amrex::Real sd_up = dsw_vars(i, j, lsm_k + 1, SLM_DSW::sdepth_mm);
 
                const amrex::Real sh_eff_cond    = dsw_vars(i, j, lsm_k    , SLM_DSW::sh_eff_cond);
                const amrex::Real sh_eff_cond_up = dsw_vars(i, j, lsm_k + 1, SLM_DSW::sh_eff_cond);
 
                const amrex::Real sh_eff_vel    = dsw_vars(i, j, lsm_k    , SLM_DSW::sh_eff_vel);
                const amrex::Real sh_eff_vel_up = dsw_vars(i, j, lsm_k + 1, SLM_DSW::sh_eff_vel);
 
                aa = -one * dt / sd * (sh_eff_vel_up + sh_eff_cond_up * two / (sd_up + sd));
                cc = -one * dt / sd * two * sh_eff_cond / (sd + sd_lo);
                bb = one - cc + dt / sd * sh_eff_vel + two * dt / sd * sh_eff_cond_up / (sd_up + sd);
                dd = soilw_arr(i, j, lsm_k) - soil_transp_frac_arr(i, j, lsm_k) * evapo_dry_arr(i, j, 0) * dt / poro_soil_arr(i, j, lsm_k) / sd; // current time step
 
                dsw_vars(i, j, lsm_k, SLM_DSW::alpha) = cc / (bb - aa * dsw_vars(i, j, lsm_k + 1, SLM_DSW::alpha));
                dsw_vars(i, j, lsm_k, SLM_DSW::beta) = (dd - aa * dsw_vars(i, j, lsm_k + 1, SLM_DSW::beta)) / (bb - aa * dsw_vars(i, j, lsm_k + 1, SLM_DSW::alpha));
            }
 
            // For bottom layer:
            aa = -1.0 * dt / dsw_vars(i, j, d_klo_lsm, SLM_DSW::sdepth_mm) *
                 (dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::sh_eff_vel) +
                  dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::sh_eff_cond) * two /
                    (dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::sdepth_mm) +
                     dsw_vars(i, j, d_klo_lsm, SLM_DSW::sdepth_mm)));
            cc = zero;
            bb =
              one + (dt / dsw_vars(i, j, d_klo_lsm, SLM_DSW::sdepth_mm) * two *
                     dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::sh_eff_cond) /
                     (dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::sdepth_mm) +
                      dsw_vars(i, j, d_klo_lsm, SLM_DSW::sdepth_mm)));
 
            // drainage when it exceeds 1.0 mm/s
            amrex::Real drainage_flux = std::max(soilw_arr(i, j, d_klo_lsm) - one, amrex::Real(zero))*poro_soil_arr(i, j, d_klo_lsm)*dsw_vars(i, j, d_klo_lsm, SLM_DSW::sdepth_mm)/dt;
            dd = soilw_arr(i, j, d_klo_lsm) - (soil_transp_frac_arr(i, j, d_klo_lsm)*evapo_dry_arr(i, j, 0) + drainage_flux) * dt / poro_soil_arr(i, j, d_klo_lsm) / dsw_vars(i, j, d_klo_lsm, SLM_DSW::sdepth_mm);
 
            slm_diag_arr(i, j, 0, SLM_Diag::drain_flux) = drainage_flux;
 
            dsw_vars(i, j, d_klo_lsm, SLM_DSW::alpha) = zero;
            dsw_vars(i, j, d_klo_lsm, SLM_DSW::beta) = (dd - aa * dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::beta)) / (bb - aa * dsw_vars(i, j, d_klo_lsm + 1, SLM_DSW::alpha));
 
            // (n+1) time step soil wetness:
            soilw_arr(i, j, d_klo_lsm) = dsw_vars(i, j, d_klo_lsm, SLM_DSW::beta);
            for (int k = d_nz_lsm - 2; k >= 0; k--) {
                const int lsm_k = d_khi_lsm - k;
                soilw_arr(i, j, lsm_k) = std::max(amrex::Real(zero), dsw_vars(i, j, lsm_k, SLM_DSW::beta) - dsw_vars(i, j, lsm_k, SLM_DSW::alpha) * soilw_arr(i, j, lsm_k - 1));
            }
 
            bool fix = false;
            for (int k = 0; k < d_nz_lsm; k++) {
                const int lsm_k = d_khi_lsm - k;
                if (soilw_arr(i, j, lsm_k) > one)
                {
                    fix = true;
                    break;
                }
            }
 
            amrex::Real excess_water = zero;
            if (fix) {
                // fix the levels where wetness exceeds 1 preserving total water:
                // compute the excess
                for (int kk = 0; kk < d_nz_lsm; kk++) {
                    const int lsm_kk = d_khi_lsm - kk;
                    if (soilw_arr(i, j, lsm_kk) > one)
                    {
                        excess_water += (soilw_arr(i, j, lsm_kk) - 1.0)*poro_soil_arr(i, j, lsm_kk)*dsw_vars(i, j, lsm_kk, SLM_DSW::sdepth_mm);
                        soilw_arr(i, j, lsm_kk) = one;
                    }
                }
 
                // distribute the excess among layer into deepest layers first:
                for (int kk = d_nz_lsm - 1; kk >= 0; kk--) {
                    const int lsm_kk = d_khi_lsm - kk;
                    if (soilw_arr(i, j, lsm_kk) < one)
                    {
                        cc = std::min(excess_water, (one - soilw_arr(i, j, lsm_kk))*poro_soil_arr(i, j, lsm_kk)*dsw_vars(i, j, lsm_kk, SLM_DSW::sdepth_mm));
                        soilw_arr(i, j, lsm_kk) += cc / (poro_soil_arr(i, j, lsm_kk)*dsw_vars(i, j, lsm_kk, SLM_DSW::sdepth_mm));
                        excess_water -= cc;
                        if (excess_water <= zero)
                        {
                            break;
                        }
                    }
                }
            }
            // fixing the issue with rain infiltration even if soil is completely saturated
            // move all the access to mws and modify the precip_in accordinally
            if (excess_water > zero) {
                // still some water left after saturating all the soil layers
                // modify the precip_in so that the access of water is moved
                // to the surface water
                precip_in -= excess_water/dt;
            }
            slm_diag_arr(i, j, 0, SLM_Diag::precip_in) = precip_in;
            mws_arr(i, j, 0) = std::max(amrex::Real(zero), mws_arr(i, j, 0) + (precip_sfc_loc - precip_in)*dt);
 
            amrex::Real drain = zero;
            if(mws_arr(i, j, 0) > mws_mx_arr(i, j, 0))
            {
                drain = (mws_arr(i, j, 0) - mws_mx_arr(i, j, 0))/dt;
                mws_arr(i, j, 0) = mws_mx_arr(i, j, 0);
            }
            else
            {
                drain = zero;
            }
            slm_diag_arr(i, j, 0, SLM_Diag::drain) = drain;
 
        }
    });
}

Here is the call graph for this function:

solve_ground_skin_temperature()

void SLM::solve_ground_skin_temperature

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const Real dt = m_dt;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
    auto landtype_arr = landtype.const_array(mfi);
 
    auto IMPERV_arr = IMPERV.const_array(mfi);
 
    auto q_cas_arr = q_cas.const_array(mfi);
    auto t_cas_arr = t_cas.const_array(mfi);
    auto t_ground_skin_arr = t_ground_skin.array(mfi);
 
    auto soilt_arr = lsm_fab_vars[LsmVar_SLM::soilt]->const_array(mfi);
    auto soilw_arr = lsm_fab_vars[LsmVar_SLM::soilw]->const_array(mfi);
    auto pref_arr  = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
    auto s_depth_arr = lsm_fab_vars[LsmVar_SLM::s_depth]->const_array(mfi);
    auto sst_cond_arr = lsm_fab_vars[LsmVar_SLM::sst_cond]->const_array(mfi);
    auto poro_soil_arr = lsm_fab_vars[LsmVar_SLM::poro_soil]->const_array(mfi);
 
    auto lhf_canop_arr = lhf_canop.array(mfi);
    auto lhf_soil_arr = lhf_soil.array(mfi);
    auto lhf_air_arr = lhf_air.array(mfi);
 
    auto evp_canop_arr = evp_canop.array(mfi);
    auto evp_soil_arr = evp_soil.array(mfi);
    auto evp_air_arr = evp_air.array(mfi);
 
    auto shf_soil_arr = shf_soil.array(mfi);
    auto shf_canop_arr = shf_canop.array(mfi);
    auto shf_air_arr = shf_air.array(mfi);
 
    auto t_sfc_arr = t_sfc.array(mfi);
    auto q_sfc_arr = q_sfc.array(mfi);
 
    auto q_gr_arr = q_gr.array(mfi);
    auto sdew_arr = sdew.array(mfi);
 
    auto vegetype_arr = vegetype.const_array(mfi);
    auto mws_arr = mws.const_array(mfi);
 
    auto dref_arr = lsm_fab_vars[LsmVar_SLM::dref]->const_array(mfi);
    auto qr_arr = lsm_fab_vars[LsmVar_SLM::qref]->const_array(mfi);
    auto tr_arr = lsm_fab_vars[LsmVar_SLM::tref]->const_array(mfi);
    auto m_pot_sat_arr = lsm_fab_vars[LsmVar_SLM::m_pot_sat]->const_array(mfi);
    auto Bconst_arr = lsm_fab_vars[LsmVar_SLM::Bconst]->const_array(mfi);
    auto w_s_WP_arr = lsm_fab_vars[LsmVar_SLM::w_s_WP]->const_array(mfi);
    auto soil_transp_frac_arr = lsm_fab_vars[LsmVar_SLM::soil_transp_frac]->const_array(mfi);
    auto t_canop_arr = t_canop.const_array(mfi);
 
    auto r_a_arr = r_a.const_array(mfi);
    auto r_d_arr = r_d.const_array(mfi);
    auto r_soil_arr = r_soil.array(mfi);
    auto evapo_dry_arr = evapo_dry.array(mfi);
 
    auto slm_diag_arr = slm_diag.array(mfi);
    auto net_rad_arr = net_rad.array(mfi);
    auto t_skin_arr = t_skin.array(mfi);
    auto lwref_arr = lsm_fab_vars[LsmVar_SLM::lwref]->const_array(mfi);
    auto LAI_arr = LAI.const_array(mfi);
    auto SAI_arr = SAI.const_array(mfi);
 
    const amrex::Real d_eg_soil = eg_soil_rad;
    constexpr int max_iterations = 5;
    constexpr amrex::Real derivative_step = 0.1;
    constexpr amrex::Real correction_limit = 5.0;
    constexpr amrex::Real convergence_tolerance = 0.01;
    const amrex::Real d_rsurf_exp = rsurf_exp;
 
 
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
 
        // SAM rhow[nz] = air density at vertical velocity levels, kg/m^3
        const amrex::Real rhow = dref_arr(i, j, 0); // TODO: double check this
        const bool vegetated = vegetype_arr(i, j, 0) == 1;
        const amrex::Real q_air = vegetated ? q_cas_arr(i, j, 0) : qr_arr(i, j, 0);
        const amrex::Real top_soil_water =
            std::max(amrex::Real(zero), soilw_arr(i, j, d_khi_lsm)) *
            poro_soil_arr(i, j, d_khi_lsm) *
            s_depth_arr(i, j, d_khi_lsm) * 1.0e3;
        const amrex::Real transpiration_top =
            std::max(amrex::Real(zero), soil_transp_frac_arr(i, j, d_khi_lsm)) *
            std::max(amrex::Real(zero), evapo_dry_arr(i, j, 0)) * dt;
        const amrex::Real available_ground_water =
            std::max(amrex::Real(zero), mws_arr(i, j, 0)) +
            std::max(amrex::Real(zero), top_soil_water - transpiration_top);
        const amrex::Real max_ground_evaporation = available_ground_water / dt;
 
        /* Legacy SLM soil diffusion and resistance formulation:
        amrex::Real q_ground_guess;
        if (t_ground_skin_arr(i, j, 0) >= tfriz) {
            erf_qsatw(t_ground_skin_arr(i, j, 0), pref_arr(i, j, 0), q_ground_guess);
            if (mws_arr(i, j, 0) == zero) {
                q_ground_guess *= fh_calc(t_ground_skin_arr(i, j, 0),
                                          m_pot_sat_arr(i, j, d_khi_lsm),
                                          soilw_arr(i, j, d_khi_lsm),
                                          Bconst_arr(i, j, d_khi_lsm));
            }
        } else {
            erf_qsati(t_ground_skin_arr(i, j, 0), pref_arr(i, j, 0), q_ground_guess);
        }
        amrex::Real soil_diff;
        if (soilw_arr(i, j, d_khi_lsm) >= w_s_FC_arr(i,j,d_khi_lsm) ||
            q_air > q_ground_guess) {
            soil_diff = one;
        } else {
            soil_diff = fourth * std::pow(one - std::cos(PI *
                std::max(amrex::Real(0.01), soilw_arr(i, j, d_khi_lsm)) /
                w_s_FC_arr(i, j, d_khi_lsm)), 2);
        }
        amrex::Real totalR_soil;
        if (!vegetated) {
            r_soil_arr(i, j, 0) = std::min(amrex::Real(10000.0), std::max(amrex::Real(100.0),
                r_a_arr(i, j, 0) * (1.0 / soil_diff - 1.0)));
            totalR_soil = r_soil_arr(i, j, 0) + r_a_arr(i, j, 0);
        } else {
            r_soil_arr(i, j, 0) = std::min(amrex::Real(10000.0), std::max(amrex::Real(50.0),
                r_d_arr(i, j, 0) * (1.0 / soil_diff - 1.0)));
            totalR_soil = r_soil_arr(i, j, 0) + r_d_arr(i, j, 0) + r_litter;
        }
        */
 
        // NoahMP option 1 (Sakaguchi and Zeng, 2009) ground resistance.
        const amrex::Real soil_wetness = std::min(amrex::Real(one),
            std::max(amrex::Real(zero), soilw_arr(i, j, d_khi_lsm)));
        const amrex::Real dry_soil_thickness = s_depth_arr(i, j, d_khi_lsm)
            * (std::exp(std::pow(one - soil_wetness, d_rsurf_exp)) - one)
            / (std::exp(one) - one);
        const amrex::Real soil_b = Bconst_arr(i, j, d_khi_lsm);
            const amrex::Real vapor_diffusivity = soil_b > zero
            ? 2.2e-5 * poro_soil_arr(i, j, d_khi_lsm)
              * poro_soil_arr(i, j, d_khi_lsm)
              * std::pow(one - w_s_WP_arr(i, j, d_khi_lsm),
                         two + three / soil_b)
            : 0.0;
        amrex::Real soil_resistance = dry_soil_thickness
            / std::max(vapor_diffusivity, amrex::Real(1.0e-12));
        const amrex::Real theta_liq = soilw_arr(i, j, d_khi_lsm)
            * poro_soil_arr(i, j, d_khi_lsm);
        if (theta_liq < 0.01 || landtype_arr(i, j, 0) == 13 || soil_b <= zero) {
            soil_resistance = 1.0e6;
        }
        r_soil_arr(i, j, 0) = soil_resistance;
 
        const amrex::Real aerodynamic_resistance = vegetated
            ? r_d_arr(i, j, 0) : r_a_arr(i, j, 0);
        const amrex::Real totalR_soil = aerodynamic_resistance + soil_resistance
            + (vegetated ? r_litter : 0.0);
 
        amrex::Real k_dry, k_sat, conductivity;
        if (landtype_arr(i, j, 0) == 15) {
            conductivity = 1.6;
        } else {
            const amrex::Real dry_density = (1.0 - poro_soil_arr(i, j, d_khi_lsm)) * 2700.0;
            k_dry = (0.135 * dry_density + 64.7) / (2700.0 - 0.947 * dry_density);
            k_sat = std::pow(sst_cond_arr(i, j, d_khi_lsm), one - poro_soil_arr(i, j, d_khi_lsm));
            k_sat *= std::pow(soilt_arr(i, j, d_khi_lsm) > tfriz ? amrex::Real(0.57) : amrex::Real(1.60),
                              poro_soil_arr(i, j, d_khi_lsm));
            const amrex::Real ke = std::log10(std::max(amrex::Real(0.1), soilw_arr(i, j, d_khi_lsm))) + one;
            conductivity = ke * (k_sat - k_dry) + k_dry;
        }
        const amrex::Real conduction_coeff = two * conductivity / s_depth_arr(i, j, d_khi_lsm);
        const amrex::Real emv = one - std::exp(-(LAI_arr(i, j, 0) + SAI_arr(i, j, 0)));
        const amrex::Real emg = d_eg_soil;
        const amrex::Real net_sw = net_rad_arr(i, j, 0, SLM_NetRad::net_sw2);
        const amrex::Real lwdn = lwref_arr(i, j, 0);
        const amrex::Real tv = t_canop_arr(i, j, 0);
        const amrex::Real tsoil = soilt_arr(i, j, d_khi_lsm);
        const amrex::Real potential_factor = std::pow(amrex::Real(1000.0) / pref_arr(i, j, 0), R_d / Cp_d);
 
        auto residual = [=] AMREX_GPU_DEVICE (amrex::Real tg) noexcept {
            amrex::Real q_ground;
            amrex::Real dew_factor = one;
            if (tg >= tfriz) {
                erf_qsatw(tg, pref_arr(i, j, 0), q_ground);
                if (mws_arr(i, j, 0) == zero) {
                    const amrex::Real humidity_factor = fh_calc(tg,
                        m_pot_sat_arr(i, j, d_khi_lsm), soilw_arr(i, j, d_khi_lsm),
                        Bconst_arr(i, j, d_khi_lsm));
                    dew_factor = humidity_factor > 0.99 ? one : zero;
                    q_ground *= humidity_factor;
                }
            } else {
                erf_qsati(tg, pref_arr(i, j, 0), q_ground);
            }
            const amrex::Real sensible = vegetated
                ? (tg - t_cas_arr(i, j, 0)) * rhow * cp / r_d_arr(i, j, 0)
                : (tg - tr_arr(i, j, 0)) * potential_factor * rhow * cp / r_a_arr(i, j, 0);
            amrex::Real evaporation = (q_ground - q_air) * rhow / totalR_soil
                                    * (1.0 - IMPERV_arr(i, j, 0));
            if (evaporation > zero) {
                evaporation = std::min(evaporation, max_ground_evaporation);
            }
            if (evaporation < zero) evaporation *= dew_factor;
            const amrex::Real irg = emg * sigma * amrex::Math::powi<4>(tg)
                                  - emg * (1.0 - emv) * lwdn
                                  - emg * emv * sigma * amrex::Math::powi<4>(tv);
            return net_sw - irg - sensible - lcond * evaporation
                   - conduction_coeff * (tg - tsoil);
        };
 
        amrex::Real tg = t_ground_skin_arr(i, j, 0);
        for (int iter = 0; iter < max_iterations; ++iter) {
            const amrex::Real f = residual(tg);
            const amrex::Real fprime = (residual(tg + derivative_step)
                                      - residual(tg - derivative_step)) / (two * derivative_step);
            AMREX_ALWAYS_ASSERT(std::isfinite(f) && std::isfinite(fprime));
            if (std::abs(fprime) < 1.0e-12) break;
            const amrex::Real delta = std::max(-correction_limit,
                std::min(correction_limit, -f / fprime));
            tg += delta;
            if (std::abs(delta) < convergence_tolerance) {
                break;
            }
        }
 
        amrex::Real q_ground;
        amrex::Real dew_factor = one;
        if (tg >= tfriz) {
            erf_qsatw(tg, pref_arr(i, j, 0), q_ground);
            if (mws_arr(i, j, 0) == zero) {
                const amrex::Real humidity_factor = fh_calc(tg,
                    m_pot_sat_arr(i, j, d_khi_lsm), soilw_arr(i, j, d_khi_lsm),
                    Bconst_arr(i, j, d_khi_lsm));
                dew_factor = humidity_factor > 0.99 ? one : zero;
                q_ground *= humidity_factor;
            }
        } else {
            erf_qsati(tg, pref_arr(i, j, 0), q_ground);
        }
        const amrex::Real sensible = vegetated
            ? (tg - t_cas_arr(i, j, 0)) * rhow * cp / r_d_arr(i, j, 0)
            : (tg - tr_arr(i, j, 0)) * potential_factor * rhow * cp / r_a_arr(i, j, 0);
        amrex::Real evaporation = (q_ground - q_air) * rhow / totalR_soil
                                * (1.0 - IMPERV_arr(i, j, 0));
        if (evaporation > zero) {
            evaporation = std::min(evaporation, max_ground_evaporation);
        }
        if (evaporation < zero) evaporation *= dew_factor;
        const amrex::Real irg = emg * sigma * amrex::Math::powi<4>(tg)
                              - emg * (1.0 - emv) * lwdn
                              - emg * emv * sigma * amrex::Math::powi<4>(tv);
        const amrex::Real ground_conduction = conduction_coeff * (tg - tsoil);
 
        t_ground_skin_arr(i, j, 0) = tg;
        q_gr_arr(i, j, 0) = q_ground;
        sdew_arr(i, j, 0) = dew_factor;
        shf_soil_arr(i, j, 0) = sensible;
        evp_soil_arr(i, j, 0) = evaporation;
        lhf_soil_arr(i, j, 0) = lcond * evaporation;
        t_sfc_arr(i, j, 0) = vegetated ? t_cas_arr(i, j, 0) : tg;
        q_sfc_arr(i, j, 0) = vegetated ? q_cas_arr(i, j, 0) : q_ground;
        shf_air_arr(i, j, 0) = vegetated ? shf_canop_arr(i, j, 0) + sensible : sensible;
        evp_air_arr(i, j, 0) = vegetated ? evp_canop_arr(i, j, 0) + evaporation : evaporation;
        lhf_air_arr(i, j, 0) = vegetated ? lhf_canop_arr(i, j, 0) + lcond * evaporation
                                          : lcond * evaporation;
 
        const amrex::Real tir1 = emv * sigma * amrex::Math::powi<4>(tv);
        const amrex::Real tir2 = emg * sigma * amrex::Math::powi<4>(tg);
        const amrex::Real lwdn2 = (1.0 - emv) * lwdn + tir1;
        const amrex::Real lwup2 = tir2 + (1.0 - emg) * lwdn2;
        const amrex::Real irc = -emv * (1.0 + (1.0 - emv) * (1.0 - emg)) * lwdn
                              - emv * emg * sigma * amrex::Math::powi<4>(tg)
                              + (two - emv * (one - emg)) * emv * sigma * amrex::Math::powi<4>(tv);
        const amrex::Real lwup1 = lwdn + irc + irg;
        net_rad_arr(i, j, 0, SLM_NetRad::tir2) = tir2;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwup2) = lwup2;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwdn2) = lwdn2;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lw2) = -irg;
        net_rad_arr(i, j, 0, SLM_NetRad::net_rad2) = net_sw - irg;
        net_rad_arr(i, j, 0, SLM_NetRad::net_lwup1) = lwup1;
        const amrex::Real emiss_sfc = emv + emg * (1.0 - emv)
                                    + emv * (1.0 - emv) * (1.0 - emg);
        t_skin_arr(i, j, 0) = std::pow(std::max(amrex::Real(1.0e-6),
            (lwup1 - (one - emiss_sfc) * lwdn) / (emiss_sfc * sigma)), fourth);
 
        slm_diag_arr(i, j, 0, SLM_Diag::grflux) = -ground_conduction;
    });
}

Here is the call graph for this function:

surrad_noahmp()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE void SLM::surrad_noahmp ( amrex::Real  mpe, amrex::Real  fsun, amrex::Real  fsha, amrex::Real  elai, amrex::Real  vai, amrex::Real  laisun, amrex::Real  laisha, const amrex::Real *  solad, const amrex::Real *  solai, const amrex::Real *  fabd, const amrex::Real *  fabi, const amrex::Real *  ftdd, const amrex::Real *  ftid, const amrex::Real *  ftii, const amrex::Real *  albgrd, const amrex::Real *  albgri, const amrex::Real *  albd, const amrex::Real *  albi, const amrex::Real *  frevd, const amrex::Real *  frevi, const amrex::Real *  fregd, const amrex::Real *  fregi, amrex::Real &  parsun, amrex::Real &  parsha, amrex::Real &  sav, amrex::Real &  sag, amrex::Real &  fsa, amrex::Real &  fsr, amrex::Real &  fsrv, amrex::Real &  fsrg  )

static

{
    // --------------------------------------------------------------------------------------------------
    // input
    //  MPE     !prevents underflow errors if division by zero
    //  FSUN    !sunlit fraction of canopy
    //  FSHA    !shaded fraction of canopy
    //  ELAI    !leaf area, one-sided
    //  VAI     !leaf + stem area, one-sided
    //  LAISUN  !sunlit leaf area index, one-sided
    //  LAISHA  !shaded leaf area index, one-sided
    //  SOLAD   !incoming direct solar radiation (w/m2)
    //  SOLAI   !incoming diffuse solar radiation (w/m2)
    //  FABD    !flux abs by veg (per unit incoming direct flux)
    //  FABI    !flux abs by veg (per unit incoming diffuse flux)
    //  FTDD    !down dir flux below veg (per incoming dir flux)
    //  FTID    !down dif flux below veg (per incoming dir flux)
    //  FTII    !down dif flux below veg (per incoming dif flux)
    //  ALBGRD  !ground albedo (direct)
    //  ALBGRI  !ground albedo (diffuse)
    //  ALBD    !overall surface albedo (direct)
    //  ALBI    !overall surface albedo (diffuse)
    //  FREVD    !overall surface albedo veg (direct)
    //  FREVI    !overall surface albedo veg (diffuse)
    //  FREGD    !overall surface albedo grd (direct)
    //  FREGI    !overall surface albedo grd (diffuse)
 
    // output
    //  PARSUN  !average absorbed par for sunlit leaves (w/m2)
    //  PARSHA  !average absorbed par for shaded leaves (w/m2)
    //  SAV     !solar radiation absorbed by vegetation (w/m2)
    //  SAG     !solar radiation absorbed by ground (w/m2)
    //  FSA     !total absorbed solar radiation (w/m2)
    //  FSR     !total reflected solar radiation (w/m2)
    //  FSRV    !reflected solar radiation by vegetation
    //  FSRG    !reflected solar radiation by ground
 
    // ------------------------ local variables ----------------------------------------------------
    constexpr int NBAND = 2;   //number of solar radiation waveband classes
 
    amrex::Real abs;     //absorbed solar radiation (w/m2)
    amrex::Real rnir;    //reflected solar radiation [nir] (w/m2)
    amrex::Real rvis;    //reflected solar radiation [vis] (w/m2)
    amrex::Real laifra;  //leaf area fraction of canopy
    amrex::Real trd;     //transmitted solar radiation: direct (w/m2)
    amrex::Real tri;     //transmitted solar radiation: diffuse (w/m2)
    amrex::Real cad[2];     //direct beam absorbed by canopy (w/m2)
    amrex::Real cai[2];     //diffuse radiation absorbed by canopy (w/m2)
    // ---------------------------------------------------------------------------------------------
 
    // zero summed solar fluxes
 
    sag = zero;
    sav = zero;
    fsa = zero;
 
    // loop over nband wavebands
 
    for (int ib = 0; ib < NBAND; ib++) {
 
        // absorbed by canopy
 
        cad[ib] = solad[ib]*fabd[ib];
        cai[ib] = solai[ib]*fabi[ib];
        sav     = sav + cad[ib] + cai[ib];
        fsa     = fsa + cad[ib] + cai[ib];
 
        // transmitted solar fluxes incident on ground
 
        trd = solad[ib]*ftdd[ib];
        tri = solad[ib]*ftid[ib] + solai[ib]*ftii[ib];
 
        // solar radiation absorbed by ground surface
 
        abs = trd*(1.0-albgrd[ib]) + tri*(1.0-albgri[ib]);
        sag = sag + abs;
        fsa = fsa + abs;
    }
 
    // partition visible canopy absorption to sunlit and shaded fractions
    // to get average absorbed par for sunlit and shaded leaves
 
    laifra = elai / std::max(vai,mpe);
    if (fsun > zero) {
        parsun = (cad[0]+fsun*cai[0]) * laifra / std::max(laisun,mpe);
        parsha = (fsha*cai[0])*laifra / std::max(laisha,mpe);
    } else {
        parsun = zero;
        parsha = (cad[0]+cai[0])*laifra / std::max(laisha,mpe);
    }
 
    // reflected solar radiation
 
    rvis = albd[0]*solad[0] + albi[0]*solai[0];
    rnir = albd[1]*solad[1] + albi[1]*solai[1];
    fsr  = rvis + rnir;
 
    // reflected solar radiation of veg. and ground (combined ground)
    fsrv = frevd[0]*solad[0]+frevi[0]*solai[0]+frevd[1]*solad[1]+frevi[1]*solai[1];
    fsrg = fregd[0]*solad[0]+fregi[0]*solai[0]+fregd[1]*solad[1]+fregi[1]*solai[1];
}

transfer_coeff()

void SLM::transfer_coeff

(

const amrex::MFIter &

mfi

)

{
    const int d_khi_lsm = khi_lsm;
    const Real dt = m_dt;
 
    auto box = mfi.tilebox();
 
    auto landmask_arr = landmask.const_array(mfi);
 
    auto t_sfc_arr = t_sfc.const_array(mfi);
    auto q_sfc_arr = q_sfc.const_array(mfi);
 
    auto disp_hgt_arr = disp_hgt.const_array(mfi);
    auto z0_sfc_arr = z0_sfc.const_array(mfi);
 
    auto qr_arr = lsm_fab_vars[LsmVar_SLM::qref]->const_array(mfi);
 
    auto ustar_arr = lsm_fab_vars[LsmVar_SLM::ustar]->array(mfi);
    auto tstar_arr = lsm_fab_vars[LsmVar_SLM::tstar]->array(mfi);
 
    auto tref_arr  = lsm_fab_vars[LsmVar_SLM::tref]->const_array(mfi);
    auto ur_arr  = lsm_fab_vars[LsmVar_SLM::uref]->const_array(mfi);
    auto vr_arr  = lsm_fab_vars[LsmVar_SLM::vref]->const_array(mfi);
    auto pref_arr  = lsm_fab_vars[LsmVar_SLM::pref]->const_array(mfi);
 
    auto r_a_arr = r_a.array(mfi);
 
    auto zref_arr = zrefxy.array(mfi);
 
    auto flbu_arr  = lsm_fab_vars[LsmVar_SLM::flbu]->array(mfi);
    auto flbv_arr  = lsm_fab_vars[LsmVar_SLM::flbv]->array(mfi);
 
    constexpr amrex::Real xsim = -1.574;
    constexpr amrex::Real xsih = -0.465;
    const amrex::Real xm = std::sqrt(std::sqrt(one - amrex::Real(16.0)*xsim));
    const amrex::Real xh = std::sqrt(std::sqrt(one - amrex::Real(16.0)*xsih));
 
    constexpr amrex::Real errormax = 0.01;
    constexpr amrex::Real kk = 0.4;
    constexpr int nitermax = 10;
 
    auto xx = [] AMREX_GPU_DEVICE (const amrex::Real &yy) -> amrex::Real {
        return std::sqrt(std::sqrt(one - amrex::Real(16.0) * yy));
    };
    // unstable: -1.574<xsi<0
    auto psim1 = [] AMREX_GPU_DEVICE (const amrex::Real &x, const amrex::Real &x0) -> amrex::Real {
        return two * std::log((one + x) / (one + x0)) + std::log((one + x*x) / (one + x0*x0)) - two*(std::atan(x)-std::atan(x0));
    };
    auto psih1 = [] AMREX_GPU_DEVICE (const amrex::Real &x, const amrex::Real &x0) -> amrex::Real {
        return two * std::log((one + x*x) / (one + x0*x0));
    };
    // very unstable: xsi < -1.574
    auto const psim2 = [=] AMREX_GPU_DEVICE (const amrex::Real &xsi, const amrex::Real &xsim0, const amrex::Real &xm0) -> amrex::Real {
        return std::log(xsim / xsim0) - psim1(xm, xm0) + amrex::Real(1.14)*(std::pow(-xsi, amrex::Real(0.3333)) - std::pow(-xsim, amrex::Real(0.3333)));
    };
    auto const psih2 = [=] AMREX_GPU_DEVICE (const amrex::Real &xsi, const amrex::Real &xsih0, const amrex::Real &xh0) -> amrex::Real {
        return std::log(xsih / xsih0) - psih1(xh, xh0) + amrex::Real(0.8)*(std::pow(-xsi, amrex::Real(0.3333)) - std::pow(-xsih, amrex::Real(0.3333)));
    };
    // stable: 0 < xsi < 1
    auto psim3 = [] AMREX_GPU_DEVICE (const amrex::Real &xsi, const amrex::Real &xsim0) -> amrex::Real {
        return -amrex::Real(5.0) * (xsi - xsim0);
    };
    auto psih3 = [] AMREX_GPU_DEVICE (const amrex::Real &xsi, const amrex::Real &xsih0) -> amrex::Real {
        return -amrex::Real(5.0) * (xsi - xsih0);
    };
    // very stable: 0 < xsi < 1
    auto psim4 = [] AMREX_GPU_DEVICE (const amrex::Real &xsi, const amrex::Real &xsim0) -> amrex::Real {
        return std::log(amrex::Math::powi<5>(xsi) / xsim0) + amrex::Real(5.0) * (one - xsim0) + xsi - one;
    };
    auto psih4 = [] AMREX_GPU_DEVICE (const amrex::Real &xsi, const amrex::Real &xsih0) -> amrex::Real {
        return std::log(amrex::Math::powi<5>(xsi) / xsih0) + amrex::Real(5.0) * (one - xsih0) + xsi - one;
    };
 
 
    ParallelFor( box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) != 1) {
            return;
        }
 
        // Inputs:
        // ts = t_sfc
        // th = tref
        // qh = qr
        // qs = q_sfc
        // h = zref = height of ref level
        // z0 = z0_sfc = surface roughness length
        // disp = disp_hgt
 
        amrex::Real tsp = t_sfc_arr(i, j, 0) * std::pow(amrex::Real(1000.0)/pref_arr(i, j, 0), R_d / Cp_d);
        amrex::Real thp = tref_arr(i, j, 0) * std::pow(amrex::Real(1000.0) / pref_arr(i, j, 0), R_d / Cp_d);
 
        amrex::Real vel;
        // Add additional velocity depending on the stratification
        if ((thp - tsp) >= zero)
        {
            vel = std::max(amrex::Real(myhalf), std::sqrt(amrex::Math::powi<2>(ur_arr(i, j, 0)) + amrex::Math::powi<2>(vr_arr(i, j, 0))));
        }
        else
        {
            vel = std::max(amrex::Real(myhalf), std::sqrt(amrex::Math::powi<2>(ur_arr(i, j, 0)) + amrex::Math::powi<2>(vr_arr(i, j, 0))));
        }
        const Real d_zref = zref_arr(i,j,0);
 
        amrex::Real r = 9.81 / tsp * (thp * (1.0 + epsv * qr_arr(i, j, 0)) - tsp * (1.0 + epsv * q_sfc_arr(i, j, 0))) * (d_zref - disp_hgt_arr(i, j, 0)) / (vel*vel);
        r = std::max(amrex::Real(-10.0), std::min(r, amrex::Real(myhalf))); // cap r for stability of iterations
        // initial guess
        amrex::Real xsi, fm, fh, xsi1;
        amrex::Real xsim0, xsih0;
        amrex::Real mom_trans_coef, heat_trans_coef;
 
        //adjust z0 for high wind - gSAM-SLM
        amrex::Real z0_adjusted = z0_sfc_arr(i, j, 0) * std::pow(one + vel/amrex::Real(10.0), amrex::Real(-0.6));
        amrex::Real zt0 = 0.135 * z0_adjusted; // roughness length for scalars: ln(z0/zt0)=2 (from Garatte BL textbook, p.93)
 
        amrex::Real z0h = z0_adjusted / (d_zref - disp_hgt_arr(i, j, 0));
        // make sure (h - disp) is not negative, otherwise z0dym,z0dyh become nan
        AMREX_ALWAYS_ASSERT(d_zref - disp_hgt_arr(i, j, 0) > zero);
        amrex::Real zTh = zt0 / (d_zref - disp_hgt_arr(i, j, 0));
 
        amrex::Real zodym = std::log(one / z0h);
        amrex::Real zodyh = std::log(one / zTh);
 
        // first guess for xsi
        if (r > zero)
        {
            xsi = r * zodym / (one - amrex::Real(5.0) * std::min(amrex::Real(0.19),r));
        }
        else
        {
            xsi = r*zodym;
        }
 
        int niter = 0;
        amrex::Real error = 1000.0;
 
        while (error > errormax && niter < nitermax)
        {
            xsi1 = xsi;
            niter++;
            xsim0 = z0h * xsi;
            xsih0 = zTh * xsi;
 
            if (xsi < -0.01)
            {
                if (xsi >= xsim)
                {
                    fm = zodym - psim1(xx(xsi), xx(xsim0));
                }
                else
                {
                    fm = psim2(xsi, xsim0, xx(xsim0));
                }
 
                if (xsi >= xsih)
                {
                    fh = zodyh - psih1(xx(xsi), xx(xsih0));
                }
                else
                {
                    fh = psih2(xsi, xsih0, xx(xsih0));
                }
            }
            else if (xsi > 0.01)
            {
                if (xsi <= one)
                {
                    fm = zodym - psim3(xsi, xsim0);
                    fh = zodyh - psih3(xsi, xsih0);
                }
                else
                {
                    fm = psim4(xsi, xsim0);
                    fh = psih4(xsi, xsih0);
                }
            }
            else
            {
                fm = zodym;
                fh = zodyh;
            }
 
            xsi = r * fm * fm / fh;
            error = std::abs(xsi - xsi1);
        }
 
        // limit fm and fh to avoid too large fluxes especially over large surface roughness.
        // Basically, make the maximum slowdown of the velocity not bigger than 50% in one timestep
        amrex::Real fm0 = std::sqrt((kk*kk)*vel*dt / myhalf / d_zref);
        fm = std::max(fm0, fm);
        fh = std::max(fh, fh/fm*fm0);
 
        // drag coefficient C_D = k**2/fm**2
        // heat transfer coefficient C_H = k**2/fm/fh
        mom_trans_coef = (kk*kk) / (fm*fm);
        heat_trans_coef = (kk*kk) / fm / fh;
        ustar_arr(i, j, 0) = std::sqrt(mom_trans_coef) * vel;
 
        // set ustar > 0.2 to avoid too calm conditions at night for the turbulent transfer
        //ustar_arr(i, j, 0) = std::max(0.2, ustar_arr(i, j, 0));
        ustar_arr(i, j, 0) = std::sqrt(ustar_arr(i, j, 0) * ustar_arr(i, j, 0)+amrex::Real(0.05)*amrex::Real(0.05)); // following gSAM-SLM
        tstar_arr(i, j, 0) = -kk * (thp - tsp) / fh;
 
        // recompute Ch and Cd for onsistency
        mom_trans_coef = amrex::Math::powi<2>(ustar_arr(i, j, 0)/vel);
        heat_trans_coef = (kk/fh) * (ustar_arr(i, j, 0)/vel);
        amrex::ignore_unused(heat_trans_coef);
 
        // aerodynamic resistance between surface and reference level
        r_a_arr(i, j, 0) = fh / kk / ustar_arr(i, j, 0);
 
 
        amrex::Real vel_m = vel;
        amrex::Real taux_sfc = -1.0 * mom_trans_coef * vel_m * ur_arr(i, j, 0) * (100.0 * pref_arr(i, j, 0) / 287.0 / tref_arr(i, j, 0));
        amrex::Real tauy_sfc = -1.0 * mom_trans_coef * vel_m * vr_arr(i, j, 0) * (100.0 * pref_arr(i, j, 0) / 287.0 / tref_arr(i, j, 0));
 
        // Output variables
        flbu_arr(i, j, d_khi_lsm) = taux_sfc;
        flbv_arr(i, j, d_khi_lsm) = tauy_sfc;
        ustar_arr(i, j, d_khi_lsm) = ustar_arr(i, j, 0);
        tstar_arr(i, j, d_khi_lsm) = tstar_arr(i, j, 0);
    });
}

Here is the call graph for this function:

twostream_noahmp()

AMREX_GPU_HOST_DEVICE AMREX_FORCE_INLINE void SLM::twostream_noahmp ( int  ib, int  ic, int  vegtyp, amrex::Real  cosz, amrex::Real  vai, amrex::Real  fwet, amrex::Real  t, const amrex::Real *  albgrd, const amrex::Real *  albgri, const amrex::Real *  rho, const amrex::Real *  tau, amrex::Real  fveg, int  ist, amrex::Real  xl, amrex::Real  omegas_param, amrex::Real  betads, amrex::Real  betais, int  opt_rad, amrex::Real  rc, amrex::Real  hvt, amrex::Real  hvb, amrex::Real  den, amrex::Real *  fab, amrex::Real *  fre, amrex::Real *  ftd, amrex::Real *  fti, amrex::Real &  gdir, amrex::Real *  frev, amrex::Real *  freg, amrex::Real &  bgap, amrex::Real &  wgap, amrex::Real &  xl_out, amrex::Real &  chil_out, amrex::Real &  phi1_out, amrex::Real &  phi2_out  )

static

{
    // --------------------------------------------------------------------------------------------------
    // input
    //   IST     !surface type
    //   IB      !waveband number
    //   IC      !0=unit incoming direct; 1=unit incoming diffuse
    //   VEGTYP  !vegetation type
    //   COSZ    !cosine of direct zenith angle (0-1)
    //   VAI     !one-sided leaf+stem area index (m2/m2)
    //   FWET    !fraction of lai, sai that is wetted (-)
    //   T       !surface temperature (k)
    //   ALBGRD  !direct  albedo of underlying surface (-)
    //   ALBGRI  !diffuse albedo of underlying surface (-)
    //   RHO     !leaf+stem reflectance
    //   TAU     !leaf+stem transmittance
    //   FVEG    !green vegetation fraction [0.0-1.0]
 
    // output
    //   FAB     !flux abs by veg layer (per unit incoming flux)
    //   FRE     !flux refl above veg layer (per unit incoming flux)
    //   FTD     !down dir flux below veg layer (per unit in flux)
    //   FTI     !down dif flux below veg layer (per unit in flux)
    //   GDIR    !projected leaf+stem area in solar direction
    //   FREV    !flux reflected by veg layer   (per unit incoming flux)
    //   FREG    !flux reflected by ground (per unit incoming flux)
    //   BGAP    !between canopy gap fraction for beam (-)
    //   WGAP    !within canopy gap fraction for beam (-)
 
    // local
    amrex::Real omega;   //fraction of intercepted radiation that is scattered
    amrex::Real omegal;  //omega for leaves
    amrex::Real betai;   //upscatter parameter for diffuse radiation
    amrex::Real betail;  //betai for leaves
    amrex::Real betad;   //upscatter parameter for direct beam radiation
    amrex::Real betadl;  //betad for leaves
    amrex::Real ext;     //optical depth of direct beam per unit leaf area
    amrex::Real avmu;    //average diffuse optical depth
    amrex::Real coszi;   //0.001 <= cosz <= 1.000
    amrex::Real asu;     //single scattering albedo
    amrex::Real chil;    // -0.4 <= xl <= 0.6
 
    amrex::Real tmp0,tmp1,tmp2,tmp3,tmp4,tmp5,tmp6,tmp7,tmp8,tmp9;
    amrex::Real p1,p2,p3,p4,s1,s2,u1,u2,u3;
    amrex::Real b,c,d,d1,d2,f,h,h1,h2,h3,h4,h5,h6,h7,h8,h9,h10;
    amrex::Real phi1,phi2,sigma_ts;
    amrex::Real ftds,ftis,fres;
    amrex::Real denfveg;
    //jref:start
    amrex::Real freveg,frebar;
    //jref:end
 
    //  variables for the modified two-stream scheme
    //  Niu and Yang (2004), JGR
    constexpr amrex::Real PAI = 3.14159265;
    constexpr amrex::Real TFRZ = 273.16; // freezing/melting point (k)
    amrex::Real hd;       //crown depth (m)
    amrex::Real bb;       //vertical crown radius (m)
    amrex::Real thetap;   //angle conversion from SZA
    amrex::Real fa;       //foliage volume density (m-1)
    amrex::Real newvai;   //effective LSAI (-)
    // Set below for opt_rad = 1, 2 or 3 (the only values); initialised so that no
    // path reads them unset.
    amrex::Real kopen = one; //gap fraction for diffue light (-)
    amrex::Real gap   = one; //total gap fraction for beam ( <=1-shafac )
 
    // -----------------------------------------------------------------
    // compute within and between gaps
    if(vai == zero) {
            gap     = one;
            kopen   = one;
    } else {
        if(opt_rad == 1) {
            denfveg = -std::log(std::max(one-fveg,amrex::Real(0.01)))/(PAI*rc*rc);
            hd      = hvt - hvb;
            bb      = myhalf * hd;
            thetap  = std::atan(bb/rc * std::tan(std::acos(std::max(amrex::Real(0.01),cosz))) );
            // BGAP    = EXP(-parameters%DEN * PAI * parameters%RC**2/COS(THETAP) )
            bgap    = std::exp(-denfveg * PAI * rc*rc/std::cos(thetap) );
            fa      = vai/(1.33 * PAI * rc*rc*rc *(bb/rc)*denfveg);
            newvai  = hd*fa;
            wgap    = (one-bgap) * std::exp(-myhalf*newvai/cosz);
            gap     = std::min(one-fveg, bgap+wgap);
 
            kopen   = 0.05;
        }
 
        if(opt_rad == 2) {
            gap     = zero;
            kopen   = zero;
        }
 
        if(opt_rad == 3) {
            gap     = 1.0-fveg;
            kopen   = 1.0-fveg;
        }
    }
 
    // calculate two-stream parameters OMEGA, BETAD, BETAI, AVMU, GDIR, EXT.
    // OMEGA, BETAD, BETAI are adjusted for snow. values for OMEGA*BETAD
    // and OMEGA*BETAI are calculated and then divided by the new OMEGA
    // because the product OMEGA*BETAI, OMEGA*BETAD is used in solution.
    // also, the transmittances and reflectances (TAU, RHO) are linear
    // weights of leaf and stem values.
 
    coszi  = std::max(amrex::Real(0.001), cosz);
    chil   = std::min( std::max(xl, amrex::Real(-0.4)), amrex::Real(0.6));
    if (std::abs(chil) <= 0.01) chil = 0.01;
    phi1   = myhalf - 0.633*chil - 0.330*chil*chil;
    phi2   = 0.877 * (one-two*phi1);
    gdir   = phi1 + phi2*coszi;
 
    // Output diagnostics
    xl_out = xl;
    chil_out = chil;
    phi1_out = phi1;
    phi2_out = phi2;
    ext    = gdir/coszi;
    avmu   = ( one - phi1/phi2 * std::log((phi1+phi2)/phi1) ) / phi2;
    omegal = rho[ib] + tau[ib];
    tmp0   = gdir + phi2*coszi;
    tmp1   = phi1*coszi;
    asu    = myhalf*omegal*gdir/tmp0 * ( one-tmp1/tmp0*std::log((tmp1+tmp0)/tmp1) );
    betadl = (1.0+avmu*ext)/(omegal*avmu*ext)*asu;
    betail = myhalf * ( rho[ib]+tau[ib] + (rho[ib]-tau[ib])
                    * ((one+chil)/two)*((one+chil)/two) ) / omegal;
 
    // adjust omega, betad, and betai for intercepted snow
 
    if (t > TFRZ) {                                //no snow
        tmp0 = omegal;
        tmp1 = betadl;
        tmp2 = betail;
    } else {
        tmp0 =   (1.0-fwet)*omegal        + fwet*omegas_param;
        tmp1 = ( (1.0-fwet)*omegal*betadl + fwet*omegas_param*betads ) / tmp0;
        tmp2 = ( (1.0-fwet)*omegal*betail + fwet*omegas_param*betais ) / tmp0;
    }
 
    omega = tmp0;
    betad = tmp1;
    betai = tmp2;
 
    // absorbed, reflected, transmitted fluxes per unit incoming radiation
 
    b = 1.0 - omega + omega*betai;
    c = omega*betai;
    tmp0 = avmu*ext;
    d = tmp0 * omega*betad;
    f = tmp0 * omega*(1.0-betad);
    tmp1 = b*b - c*c;
    h = std::sqrt(tmp1) / avmu;
    sigma_ts = tmp0*tmp0 - tmp1;
        if ( std::abs(sigma_ts) < 1.0e-6 ) sigma_ts = (sigma_ts >= zero) ? 1.0e-6 : -1.0e-6;
    p1 = b + avmu*h;
    p2 = b - avmu*h;
    p3 = b + tmp0;
    p4 = b - tmp0;
    s1 = std::exp(-h*vai);
    s2 = std::exp(-ext*vai);
    if (ic == 0) {
        u1 = b - c/albgrd[ib];
        u2 = b - c*albgrd[ib];
        u3 = f + c*albgrd[ib];
    } else {
        u1 = b - c/albgri[ib];
        u2 = b - c*albgri[ib];
        u3 = f + c*albgri[ib];
    }
    tmp2 = u1 - avmu*h;
    tmp3 = u1 + avmu*h;
    d1 = p1*tmp2/s1 - p2*tmp3*s1;
    tmp4 = u2 + avmu*h;
    tmp5 = u2 - avmu*h;
    d2 = tmp4/s1 - tmp5*s1;
    h1 = -d*p4 - c*f;
    tmp6 = d - h1*p3/sigma_ts;
    tmp7 = ( d - c - h1/sigma_ts*(u1+tmp0) ) * s2;
    h2 = ( tmp6*tmp2/s1 - p2*tmp7 ) / d1;
    h3 = - ( tmp6*tmp3*s1 - p1*tmp7 ) / d1;
    h4 = -f*p3 - c*d;
    tmp8 = h4/sigma_ts;
    tmp9 = ( u3 - tmp8*(u2-tmp0) ) * s2;
    h5 = - ( tmp8*tmp4/s1 + tmp9 ) / d2;
    h6 = ( tmp8*tmp5*s1 + tmp9 ) / d2;
    h7 = (c*tmp2) / (d1*s1);
    h8 = (-c*tmp3*s1) / d1;
    h9 = tmp4 / (d2*s1);
    h10 = (-tmp5*s1) / d2;
 
    // downward direct and diffuse fluxes below vegetation
    // Niu and Yang (2004), JGR.
 
    if (ic == 0) {
        ftds = s2                           *(1.0-gap) + gap;
        ftis = (h4*s2/sigma_ts + h5*s1 + h6/s1)*(1.0-gap);
    } else {
        ftds = zero;
        ftis = (h9*s1 + h10/s1)*(1.0-kopen) + kopen;
    }
    ftd[ib] = ftds;
    fti[ib] = ftis;
 
    // flux reflected by the surface (veg. and ground)
 
    if (ic == 0) {
        fres   = (h1/sigma_ts + h2 + h3)*(1.0-gap  ) + albgrd[ib]*gap;
        freveg = (h1/sigma_ts + h2 + h3)*(1.0-gap  );
        frebar = albgrd[ib]*gap;                   //jref - separate veg. and ground reflection
    } else {
        fres   = (h7 + h8) *(1.0-kopen) + albgri[ib]*kopen;
        freveg = (h7 + h8) *(1.0-kopen) + albgri[ib]*kopen;
        frebar = zero;                                //jref - separate veg. and ground reflection
    }
    fre[ib] = fres;
 
    frev[ib] = freveg;
    freg[ib] = frebar;
 
    // flux absorbed by vegetation
 
    fab[ib] = 1.0 - fre[ib] - (1.0-albgrd[ib])*ftd[ib]
                            - (1.0-albgri[ib])*fti[ib];
}

Update_Lsm_Vars()

void SLM::Update_Lsm_Vars ( amrex::MultiFab &  cons_in, amrex::MultiFab &  u_in, amrex::MultiFab &  v_in  )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        this->Copy_State_to_Lsm(cons_in, u_in, v_in);
        if (first_step) {
            if (use_wrfinput && !wrfinput_initialized) {
                this->init_wrfinput_vars();
            } else if (!use_wrfinput) {
                this->init_slm_vars();
            }
        }
    }

Here is the call graph for this function:

Update_State_Vars()

void SLM::Update_State_Vars ( amrex::MultiFab &  cons_in )

inlineoverridevirtual

Reimplemented from NullSurf.

    {
        this->Copy_Lsm_to_State(cons_in);
    }

Here is the call graph for this function:

UpdateLAI()

void SLM::UpdateLAI

(

const amrex::MFIter &

mfi

)

Updates LAI and SAI based on the current simulation time and monthly values from the LAI and SAI tables.

{
    if (interpolate_lai) {
        Box box = mfi.tilebox();
        box.makeSlab(2, 0);
 
        auto landmask_arr = landmask.const_array(mfi);
        auto landtype_arr = landtype.const_array(mfi);
        // auto vegetype_arr = vegetype.const_array(mfi);
        auto LAI_arr = LAI.array(mfi);
        auto SAI_arr = SAI.array(mfi);
 
        // Update the day and month
        time_t timestamp = time_t(time + start_time);
        struct tm *timeinfo = gmtime(&timestamp);
 
        m_orbital_year = timeinfo->tm_year + 1900;
        m_orbital_mon  = timeinfo->tm_mon  + 1;
        m_orbital_day  = timeinfo->tm_mday;
        m_orbital_sec  = timeinfo->tm_hour*3600 + timeinfo->tm_min*60 + timeinfo->tm_sec;
 
        static constexpr double dpy[] = {0.0  ,  31.0,  59.0,  90.0, 120.0, 151.0,
                                        181.0, 212.0, 243.0, 273.0, 304.0, 334.0};
        bool leap = (m_orbital_year % 4 == 0 && (!(m_orbital_year % 100 == 0) || (m_orbital_year % 400 == 0))) ? true : false;
        m_calday = dpy[m_orbital_mon-1] + (m_orbital_day-1.0) + m_orbital_sec/86400.0;
        // add extra day if leap year
        if (leap) { m_calday += one; }
 
        int curr_mon = m_orbital_mon - 1;
        int next_mon = curr_mon + 1;
        Real t0 = dpy[curr_mon];
        Real t1;
        if (next_mon >= 11) {
            next_mon = 0;
            t1 = 365.0;
        } else {
            t1 = dpy[next_mon];
        }
 
        const Real d_calday = m_calday;
 
        // Setup device interpolation points
        Real *d_lai_curr_ptr = d_lai_curr.data();
        Real *d_lai_next_ptr = d_lai_next.data();
        Real *d_sai_curr_ptr = d_sai_curr.data();
        Real *d_sai_next_ptr = d_sai_next.data();
        Gpu::copyAsync(Gpu::hostToDevice, lai_table[curr_mon].data(), lai_table[curr_mon].data()+num_landtypes, d_lai_curr_ptr);
        Gpu::copyAsync(Gpu::hostToDevice, lai_table[next_mon].data(), lai_table[next_mon].data()+num_landtypes, d_lai_next_ptr);
        Gpu::copyAsync(Gpu::hostToDevice, sai_table[curr_mon].data(), sai_table[curr_mon].data()+num_landtypes, d_sai_curr_ptr);
        Gpu::copyAsync(Gpu::hostToDevice, sai_table[next_mon].data(), sai_table[next_mon].data()+num_landtypes, d_sai_next_ptr);
        Gpu::streamSynchronize();
 
        // Update LAI and SAI
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            if (landmask_arr(i, j, 0) == 1) {
                //if (vegetype_arr(i, j, 0) == 0) { // todo: check, urban cells are not "vegetated", so LAI is incorrect there?
                if (landtype_arr(i,j,0) == 16) {
                    // baresoil point, so no LAI or SAI
                    LAI_arr(i,j,0) = zero;
                    SAI_arr(i,j,0) = zero;
                //} else if (vegetype_arr(i, j, 0) == 1) {
                } else {
                    // vegetation
                    const int ltype = landtype_arr(i,j,0) - 1;
 
                    const Real lai_x = d_lai_curr_ptr[ltype];
                    const Real lai_y = d_lai_next_ptr[ltype];
 
                    const Real sai_x = d_sai_curr_ptr[ltype];
                    const Real sai_y = d_sai_next_ptr[ltype];
 
                    // Update the LAI and SAI using interpolated values from the monthly tables
                    // NOTE: LAI + SAI is computed later when needed
                    LAI_arr(i,j,0) = linear_interp(t0, t1, d_calday, lai_x, lai_y);
                    SAI_arr(i,j,0) = linear_interp(t0, t1, d_calday, sai_x, sai_y);
                }
            }
        });
 
        UpdateLAIParameters(mfi);
    } else if (use_wrf_lai) {
 
        Box box = mfi.tilebox();
        box.makeSlab(2, 0);
 
        auto landmask_arr = landmask.const_array(mfi);
        auto landtype_arr = landtype.const_array(mfi);
        auto veg_frac_arr = lsm_fab_vars[LsmVar_SLM::veg_frac]->array(mfi);
        auto veg_frac_min_arr = lsm_fab_vars[LsmVar_SLM::veg_frac_min]->const_array(mfi);
        auto veg_frac_max_arr = lsm_fab_vars[LsmVar_SLM::veg_frac_max]->const_array(mfi);
 
        auto LAI_arr = LAI.array(mfi);
 
        auto const& d_params = d_param_table.const_table();
 
        // Update LAI from vegetation fraction.
        ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
        {
            if (landmask_arr(i, j, 0) == 1) {
 
                const int ltype = landtype_arr(i,j,0) - 1; // shift by one to match table index (i.e, types 1-20 -> 0-19)
 
                if (ltype + 1 == 13) { // urban cells
                    veg_frac_arr(i,j,0) = d_params(ltype,1);
                }
 
                //    LAI min = col 8, lai max = col 9
                //  emiss min = col 10,    max = col 11
                // albedo min = col 12,    max = col 13
 
                if (veg_frac_arr(i,j,0) >= veg_frac_max_arr(i,j,0)) {
                    //emis_sfc_arr(i,j,0) = emissmax;
                    LAI_arr(i,j,0) = d_params(ltype, 9);
                } else if (veg_frac_arr(i,j,0) <= veg_frac_min_arr(i,j,0)) {
                    //emis_sfc_arr(i,j,0) = emissmin;
                    LAI_arr(i,j,0) = d_params(ltype, 8);
                } else {
                    if (veg_frac_max_arr(i,j,0) > veg_frac_min_arr(i,j,0)) {
 
                        Real interp_frac = (veg_frac_arr(i,j,0) - veg_frac_min_arr(i,j,0)) / (veg_frac_max_arr(i,j,0) - veg_frac_min_arr(i,j,0));
                        interp_frac = std::min(std::max(interp_frac, amrex::Real(zero)), amrex::Real(one)); // bound between 0.0 and 1.0
 
                        // Scale emissivitiy and LAI between min/max by interp_frac
                        //emis_sfc_arr(i,j,0) = ( (1.0 - interp_frac) * d_params(ltype, 10)) + interp_frac * d_params(ltype, 11);
 
                        LAI_arr(i,j,0) = ( (1.0 - interp_frac) * d_params(ltype, 8)) + interp_frac * d_params(ltype, 9);
                    } else {
                        // emis_sfc_arr(i,j,0) = 0.5 * d_params(ltype,10) + 0.5 * d_params(ltype, 11);
                        LAI_arr(i,j,0) = myhalf * d_params(ltype, 8) + myhalf * d_params(ltype, 9);
                    }
                }
 
            }
        });
 
        UpdateLAIParameters(mfi);
    }
}

Here is the call graph for this function:

UpdateLAIParameters()

void SLM::UpdateLAIParameters

(

const amrex::MFIter &

mfi

)

Updates radiation parameters related to LAI

{
    Box box = mfi.tilebox();
    box.makeSlab(2, 0);
 
    auto IR_emis_vege_arr = IR_emis_vege.array(mfi);
    auto phi_1_arr = phi_1.array(mfi);
    auto phi_2_arr = phi_2.array(mfi);
    auto precip_extinc_arr = precip_extinc.array(mfi);
    auto mw_mx_arr = mw_mx.array(mfi);
    auto LAI_arr = LAI.array(mfi);
    auto BAI_arr = BAI.array(mfi);
    auto ztop_arr = ztop.array(mfi);
    auto Khai_L_arr = Khai_L.array(mfi);
    auto landmask_arr = landmask.const_array(mfi);
    auto vegetype_arr = vegetype.const_array(mfi);
 
    ParallelFor(box, [=] AMREX_GPU_DEVICE (int i, int j, int)
    {
        if (landmask_arr(i, j, 0) == 1) {
            if (vegetype_arr(i, j, 0) == 1) {
                // set minimum LAI for vegetated land
                LAI_arr(i, j, 0) = std::max(LAI_arr(i, j, 0), amrex::Real(0.001));
            }
 
            phi_1_arr(i, j, 0) = myhalf - 0.633 * Khai_L_arr(i, j, 0) - 0.33 * amrex::Math::powi<2>(Khai_L_arr(i, j, 0));
            phi_2_arr(i, j, 0) = 0.877 * (one - two * phi_1_arr(i, j, 0));
            IR_emis_vege_arr(i, j, 0) = 0.97 * (one - std::exp(-(phi_1_arr(i, j, 0) + phi_2_arr(i, j, 0)) * LAI_arr(i, j, 0)));
            precip_extinc_arr(i, j, 0) = phi_1_arr(i, j, 0) + phi_2_arr(i, j, 0);
            //mw_mx_arr(i, j, 0) = 0.1 * LAI_arr(i, j, 0);
            mw_mx_arr(i, j, 0) = 0.1 * LAI_arr(i, j, 0) + ztop_arr(i, j, 0) * std::pow(four * PI * BAI_arr(i, j, 0) / amrex::Real(43560.0), myhalf);
        }
    });
}

Here is the call graph for this function:

validate_parameter_tables()

void SLM::validate_parameter_tables

(

)

Validates the selected Noah-MP parameter blocks before copying them to the device.

{
    using ParameterBlock = SLMParameterTable::mapped_type;
 
    const std::string soil_dataset_lower = amrex::toLower(soil_dataset);
    const std::string veg_dataset_lower = amrex::toLower(veg_dataset);
 
    std::string soil_param_key;
    if (soil_dataset_lower == "stas_ruc") {
        soil_param_key = "noahmp_soil_stas_ruc_parameters";
    } else if (soil_dataset_lower == "stas") {
        soil_param_key = "noahmp_soil_stas_parameters";
    } else {
        amrex::Abort("SLM: unrecognized soil dataset type '" + soil_dataset + "'");
    }
 
    std::string veg_param_key;
    std::string veg_category_key;
    if (veg_dataset_lower == "usgs") {
        veg_param_key = "noahmp_usgs_parameters";
        veg_category_key = "noahmp_usgs_veg_categories";
    } else if (veg_dataset_lower == "modis") {
        veg_param_key = "noahmp_modis_parameters";
        veg_category_key = "noahmp_modis_veg_categories";
    } else {
        amrex::Abort("SLM: unrecognized vegetation dataset type '" + veg_dataset + "'");
    }
 
    auto require_block = [this](const std::string& block_name) -> const ParameterBlock& {
        auto block = full_params.find(block_name);
        if (block == full_params.end()) {
            amrex::Abort("SLM: parameter file is missing block '" + block_name + "'");
        }
        return block->second;
    };
 
    auto find_parameter = [](const ParameterBlock& block, const std::string& block_name,
                             const std::string& parameter_name) -> const Vector<Real>*
    {
        const Vector<Real>* values = nullptr;
        for (const auto& parameter : block) {
            if (parameter.first == parameter_name) {
                if (values != nullptr) {
                    amrex::Abort("SLM: parameter '" + parameter_name + "' is duplicated in block '" + block_name + "'");
                }
                values = &parameter.second;
            }
        }
        return values;
    };
 
    auto require_parameter = [&find_parameter](const ParameterBlock& block, const std::string& block_name,
                                               const std::string& parameter_name, int expected_size) -> const Vector<Real>& {
        const Vector<Real>* values = find_parameter(block, block_name, parameter_name);
        if (values == nullptr || values->empty()) {
            amrex::Abort("SLM: parameter file is missing nonempty parameter '" + parameter_name +
                         "' in block '" + block_name + "'");
        }
        if (expected_size >= 0 && static_cast<int>(values->size()) != expected_size) {
            amrex::Abort("SLM: parameter '" + parameter_name + "' in block '" + block_name +
                         "' has " + std::to_string(values->size()) +
                         " values; expected " + std::to_string(expected_size));
        }
        return *values;
    };
 
    auto validate_parameter_value = [](const std::string& block_name,
                                       const std::string& parameter_name,
                                       const Real value,
                                       const std::optional<Real> lower = std::nullopt,
                                       const std::optional<Real> upper = std::nullopt,
                                       const bool lower_strict = false)
    {
        if (!std::isfinite(value) ||
            (lower && (lower_strict ? value <= *lower : value < *lower)) ||
            (upper && value > *upper)) {
            amrex::Abort("SLM: invalid value for parameter '" + parameter_name +
                         "' in block '" + block_name + "'");
        }
    };
 
    const ParameterBlock& veg_categories = require_block(veg_category_key);
    const Vector<Real>& nveg_values = require_parameter(veg_categories, veg_category_key, "nveg", 1);
    if (nveg_values[0] < one || nveg_values[0] != std::floor(nveg_values[0])) {
        amrex::Abort("SLM: parameter 'nveg' in block '" + veg_category_key + "' must be a positive integer");
    }
    num_veg_params = static_cast<int>(nveg_values[0]);
 
    const ParameterBlock& veg_params = require_block(veg_param_key);
    for (const auto& parameter : veg_params) {
        if (parameter.second.empty()) {
            amrex::Abort("SLM: parameter '" + parameter.first + "' in block '" + veg_param_key + "' is empty");
        }
        if (parameter.first != "nveg" && static_cast<int>(parameter.second.size()) > 1 &&
            static_cast<int>(parameter.second.size()) != num_veg_params) {
            amrex::Abort("SLM: parameter '" + parameter.first + "' in block '" + veg_param_key +
                         "' has " + std::to_string(parameter.second.size()) +
                         " values; expected " + std::to_string(num_veg_params) +
                         " vegetation-category values");
        }
        std::optional<Real> lower;
        std::optional<Real> upper;
        if (parameter.first == "rhol_vis" || parameter.first == "rhol_nir" ||
            parameter.first == "rhos_vis" || parameter.first == "rhos_nir" ||
            parameter.first == "taul_vis" || parameter.first == "taul_nir" ||
            parameter.first == "taus_vis" || parameter.first == "taus_nir") {
            lower = zero;
            upper = one;
        } else if (parameter.first == "rs" || parameter.first == "rgl" ||
                   parameter.first == "nroot" || parameter.first == "hvt" ||
                   parameter.first == "hvb" || parameter.first == "z0mvt" ||
                   parameter.first == "cbiom" || parameter.first == "dleaf" ||
                   parameter.first == "rc" || parameter.first == "den" ||
                   parameter.first == "cwpvt") {
            lower = zero;
        }
        for (const Real value : parameter.second) {
            validate_parameter_value(veg_param_key, parameter.first, value, lower, upper);
        }
    }
 
    const Vector<Real>* hvt_values = find_parameter(veg_params, veg_param_key, "hvt");
    if (hvt_values != nullptr && static_cast<int>(hvt_values->size()) == num_veg_params) {
        const Vector<Real>* hvb_values = find_parameter(veg_params, veg_param_key, "hvb");
        if (hvb_values != nullptr && static_cast<int>(hvb_values->size()) == num_veg_params) {
            for (int i = 0; i < num_veg_params; ++i) {
                if ((*hvt_values)[i] > zero && (*hvt_values)[i] <= (*hvb_values)[i]) {
                    amrex::Abort("SLM: HVT must be greater than HVB for canopy categories in block '" +
                                 veg_param_key + "'");
                }
            }
        }
        const Vector<std::string> canopy_parameters = {
            "rgl", "z0mvt", "cwpvt", "dleaf", "rc", "den"
        };
        for (const std::string& parameter_name : canopy_parameters) {
            const Vector<Real>* values = find_parameter(veg_params, veg_param_key, parameter_name);
            if (values == nullptr || static_cast<int>(values->size()) != num_veg_params) {
                continue;
            }
            for (int i = 0; i < num_veg_params; ++i) {
                if ((*hvt_values)[i] > zero) {
                    validate_parameter_value(veg_param_key, parameter_name, (*values)[i], 0.0,
                                             std::nullopt, true);
                }
            }
        }
    }
 
    const ParameterBlock& soil_categories = require_block("noahmp_stas_soil_categories");
    const Vector<Real>& slcats_values = require_parameter(
        soil_categories, "noahmp_stas_soil_categories", "slcats", 1);
    if (slcats_values[0] < one || slcats_values[0] != std::floor(slcats_values[0])) {
        amrex::Abort("SLM: parameter 'slcats' in block 'noahmp_stas_soil_categories' must be a positive integer");
    }
    num_soil_params = static_cast<int>(slcats_values[0]);
 
    const ParameterBlock& soil_params = require_block(soil_param_key);
    require_parameter(soil_params, soil_param_key, "maxsmc", num_soil_params);
 
    const Vector<std::string> required_soil_parameters = {
        "maxsmc", "refsmc", "wltsmc", "satpsi", "bb", "satdk"
    };
    for (const std::string& parameter_name : required_soil_parameters) {
        require_parameter(soil_params, soil_param_key, parameter_name, num_soil_params);
    }
    for (const auto& parameter : soil_params) {
        if (parameter.second.empty()) {
            amrex::Abort("SLM: parameter '" + parameter.first + "' in block '" + soil_param_key + "' is empty");
        }
        if (static_cast<int>(parameter.second.size()) > 1 && static_cast<int>(parameter.second.size()) != num_soil_params) {
            amrex::Abort("SLM: parameter '" + parameter.first + "' in block '" + soil_param_key +
                         "' has " + std::to_string(parameter.second.size()) +
                         " values; expected " + std::to_string(num_soil_params) +
                         " soil-category values");
        }
        for (const Real value : parameter.second) {
            validate_parameter_value(soil_param_key, parameter.first, value, 0.0);
        }
    }
 
    const ParameterBlock& rad_params = require_block("noahmp_rad_parameters");
    const Vector<std::pair<std::string, int>> required_rad_parameters = {
        {"albsat_vis", 8}, {"albsat_nir", 8},
        {"albdry_vis", 8}, {"albdry_nir", 8},
        {"alblak", 2}, {"omegas", 2},
        {"betads", 1}, {"betais", 1}
    };
    for (const auto& parameter : required_rad_parameters) {
        require_parameter(rad_params, "noahmp_rad_parameters", parameter.first, parameter.second);
    }
    for (const auto& parameter : rad_params) {
        if (parameter.second.empty()) {
            amrex::Abort("SLM: parameter '" + parameter.first + "' in block 'noahmp_rad_parameters' is empty");
        }
        for (const Real value : parameter.second) {
            validate_parameter_value("noahmp_rad_parameters", parameter.first, value, 0.0, 1.0);
        }
    }
 
    const Vector<std::string> required_veg_parameters = {
        "rhol_vis", "rhol_nir", "rhos_vis", "rhos_nir",
        "taul_vis", "taul_nir", "taus_vis", "taus_nir",
        "rc", "hvb", "den"
    };
    for (const std::string& parameter_name : required_veg_parameters) {
        require_parameter(veg_params, veg_param_key, parameter_name, num_veg_params);
    }
}

WriteCheckpoint()

void SLM::WriteCheckpoint ( const int &  lev, const std::string &  checkpointname  ) const

overridevirtual

Reimplemented from NullSurf.

{
    auto check_start = amrex::second();
 
    // write SLM header
    if (ParallelDescriptor::IOProcessor()) {
 
        amrex::Print() << " Writing SLM checkpoint at level " << lev << std::endl;
 
        std::string HeaderFileName(checkpointname + "/Level_" + std::to_string(lev) + "/SLM_Header");
        VisMF::IO_Buffer io_buffer(VisMF::IO_Buffer_Size);
        std::ofstream HeaderFile;
        HeaderFile.rdbuf()->pubsetbuf(io_buffer.dataPtr(), io_buffer.size());
        HeaderFile.open(HeaderFileName.c_str(), std::ofstream::out   |
                                                std::ofstream::trunc |
                                                std::ofstream::binary);
        if(! HeaderFile.good()) {
            FileOpenFailed(HeaderFileName);
        }
 
        HeaderFile.precision(17);
 
        // write out title line
        HeaderFile << "Checkpoint file for SLM\n";
 
        // write out number of soil layers
        HeaderFile << m_nz_lsm << "\n";
 
        // write out array of dz
        for (int i = 0; i < static_cast<int>(m_dz_lsm.size()); ++i) {
            HeaderFile << m_dz_lsm[i] << " ";
        }
        HeaderFile << "\n";
        HeaderFile << "\n";
 
        // write out timestep and cal day
        HeaderFile << m_dt << "\n";
        HeaderFile << time << "\n";
        HeaderFile << start_time << "\n";
        HeaderFile << m_calday << "\n";
        HeaderFile << m_orbital_year << "\n";
        HeaderFile << m_orbital_mon << "\n";
        HeaderFile << m_orbital_day << "\n";
        HeaderFile << m_orbital_sec << "\n";
        HeaderFile << "\n";
 
        // write out constants
        //  - tabs_s
        //  - t00
        //  - LAI0
        //  - tausoil
        //  - zref
        //  - z0_soil
        //  - mws_mx0
        HeaderFile << tabs_s << "\n";
        HeaderFile << t00 << "\n";
        HeaderFile << LAI0 << "\n";
        HeaderFile << tausoil << "\n";
        HeaderFile << zref << "\n";
        HeaderFile << z0_soil << "\n";
        HeaderFile << mws_mx0 << "\n";
        HeaderFile << Rc_max << "\n";
        HeaderFile << T_opt << "\n";
        HeaderFile << "\n";
 
        // write out flags
        //  - dosoiltnudge
        //  - dosoilwnudge
        //  - reserved compatibility slot for the removed set_from_file flag
        //  - use_param_file
        //  - interpolate_lai
        //  - use_wrf_lai
        //  - use_wrfinput
        HeaderFile << dosoiltnudging << "\n";
        HeaderFile << dosoilwnudging << "\n";
        HeaderFile << 0 << "\n";
        HeaderFile << use_param_file << "\n";
        HeaderFile << interpolate_lai << "\n";
        HeaderFile << use_wrf_lai << "\n";
        HeaderFile << use_wrfinput << "\n";
        HeaderFile << "\n";
 
        // Write box arrays for SLM
        ba_lsm_2d.writeOn(HeaderFile);
        HeaderFile << '\n';
 
        //
        // Where SLM is in its lifecycle.  With a wrfinput run the surface fields and
        // the canopy-adjusted reference height are not built in Init -- they need the
        // file, and are deferred to the first Advance -- so a checkpoint written
        // before any step has been taken holds zrefxy at the scalar slm.zref
        // placeholder rather than ztop + dz0.  The reader used to declare the model
        // initialized unconditionally, which is right for every later checkpoint and
        // wrong for that one.  Written last so a checkpoint from before this simply
        // ends after the BoxArray and the reader keeps its old default.
        //
        HeaderFile << first_step << " " << wrfinput_initialized << "\n";
    }
 
    amrex::ParallelDescriptor::Barrier();
 
    const std::string prefix = "SLM_";
 
    // Use distribution map from data vars, since those are already created and loaded by ERF
    const DistributionMapping& dm = lsm_fab_vars[0]->DistributionMap();
    IntVect ng = IntVect(0,0,0);
    {
        MultiFab imf_lm = amrex::ToMultiFab(landmask);
        VisMF::Write(imf_lm, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "landmask"));
 
        MultiFab imf_lt = amrex::ToMultiFab(landtype);
        VisMF::Write(imf_lt, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "landtype"));
 
        MultiFab imf_vt = amrex::ToMultiFab(vegetype);
        VisMF::Write(imf_vt, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "vegetype"));
    }
 
    {
        // DST
        MultiFab mf(soilt_vars.boxArray(),dm,SLM_DST::NumVars,0);
        MultiFab::Copy(mf,soilt_vars,0,0,SLM_DST::NumVars,ng);
        VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "DST"));
    }
 
    {
        // DSW
        MultiFab mf(soilw_vars.boxArray(),dm,SLM_DSW::NumVars,0);
        MultiFab::Copy(mf,soilw_vars,0,0,SLM_DSW::NumVars,ng);
        VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "DSW"));
    }
 
    {
        // net_rad
        MultiFab mf(net_rad.boxArray(),dm,SLM_NetRad::NumVars,0);
        MultiFab::Copy(mf,net_rad,0,0,SLM_NetRad::NumVars,ng);
        VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "net_rad"));
    }
 
    {
        // slm_diag
        MultiFab mf(slm_diag.boxArray(),dm,SLM_Diag::NumVars,0);
        MultiFab::Copy(mf,slm_diag,0,0,SLM_Diag::NumVars,ng);
        VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "slm_diag"));
    }
 
    MultiFab mf(ba_lsm_2d,dm,1,ng);
 
    MultiFab::Copy(mf,LAI,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "LAI"));
 
    MultiFab::Copy(mf,SAI,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "SAI"));
 
    MultiFab::Copy(mf,sstxy,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "sstxy"));
 
    MultiFab::Copy(mf,t_canop,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_canop"));
 
    MultiFab::Copy(mf,mw,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mw"));
 
    MultiFab::Copy(mf,mws,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mws"));
 
    MultiFab::Copy(mf,t_skin,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_skin"));
 
    MultiFab::Copy(mf,t_ground_skin,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_ground_skin"));
 
    MultiFab::Copy(mf,t_cas,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "t_cas"));
 
    MultiFab::Copy(mf,q_cas,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "q_cas"));
 
    MultiFab::Copy(mf,vege_YES,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "vege_YES"));
 
    MultiFab::Copy(mf,cp_vege,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "cp_vege"));
 
    MultiFab::Copy(mf,z0_sfc,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "z0_sfc"));
 
    MultiFab::Copy(mf,Khai_L,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Khai_L"));
 
    MultiFab::Copy(mf,phi_1,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "phi_1"));
 
    MultiFab::Copy(mf,phi_2,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "phi_2"));
 
    MultiFab::Copy(mf,IR_emis_vege,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "IR_emis_vege"));
 
    MultiFab::Copy(mf,IR_emis_soil,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "IR_emis_soil"));
 
    MultiFab::Copy(mf,ztop,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "ztop"));
 
    MultiFab::Copy(mf,disp_hgt,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "disp_hgt"));
 
    MultiFab::Copy(mf,Rgl,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Rgl"));
 
    MultiFab::Copy(mf,Rc_min,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Rc_min"));
 
    MultiFab::Copy(mf,hs_rc,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "hs_rc"));
 
    MultiFab::Copy(mf,precip_extinc,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "precip_extinc"));
 
    MultiFab::Copy(mf,mw_mx,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mw_mx"));
 
    MultiFab::Copy(mf,mws_mx,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mws_mx"));
 
    MultiFab::Copy(mf,BAI,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "BAI"));
 
    MultiFab::Copy(mf,mw_inc,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "mw_inc"));
 
    MultiFab::Copy(mf,evapo_dry,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "evapo_dry"));
 
    MultiFab::Copy(mf,shf_canop,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "shf_canop"));
 
    MultiFab::Copy(mf,shf_soil,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "shf_soil"));
 
    MultiFab::Copy(mf,shf_air,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "shf_air"));
 
    MultiFab::Copy(mf,lhf_canop,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "lhf_canop"));
 
    MultiFab::Copy(mf,lhf_soil,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "lhf_soil"));
 
    MultiFab::Copy(mf,lhf_air,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "lhf_air"));
 
    MultiFab::Copy(mf,albedovis_v,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedovis_v"));
 
    MultiFab::Copy(mf,albedonir_v,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedonir_v"));
 
    MultiFab::Copy(mf,albedovis_s,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedovis_s"));
 
    MultiFab::Copy(mf,albedonir_s,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albedonir_s"));
 
    MultiFab::Copy(mf,r_a,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_a"));
 
    MultiFab::Copy(mf,r_b,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_b"));
 
    MultiFab::Copy(mf,r_c,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_c"));
 
    MultiFab::Copy(mf,r_d,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_d"));
 
    MultiFab::Copy(mf,r_soil,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "r_soil"));
 
    MultiFab::Copy(mf,wet_canop,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "wet_canop"));
 
    MultiFab::Copy(mf,zrefxy,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "zrefxy"));
 
    MultiFab::Copy(mf,albold_noahmp,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "albold_noahmp"));
 
    MultiFab::Copy(mf,tauss_noahmp,0,0,1,ng);
    VisMF::Write(mf, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "tauss_noahmp"));
 
    for (int i = 0; i < static_cast<int>(unmapped_fields.size()); i++) {
        MultiFab mf_unmapped(lsm_fab_vars[unmapped_fields[i]]->boxArray(),dm,1,IntVect(1,1,1));
        MultiFab::Copy(mf_unmapped,*(lsm_fab_vars[unmapped_fields[i]]),0,0,1,IntVect(1,1,1));
        VisMF::Write(mf_unmapped, MultiFabFileFullPrefix(lev, checkpointname, "Level_", prefix + "Data" + std::to_string(unmapped_fields[i])));
    }
 
    auto check_end = amrex::second() - check_start;
    ParallelDescriptor::ReduceRealMax(check_end,ParallelDescriptor::IOProcessorNumber());
    amrex::Print() << "    SLM Checkpoint write time = " << check_end << " seconds." << '\n';
}

writeSLM_Data()

void SLM::writeSLM_Data	(	const PlotFileType	plotfile_type,
		const amrex::Real	cur_time,
		const std::string	plot_prefix,
		const int	level_step,
		const int	lev,
		const int	finest_lev,
		amrex::MultiFab &	fab,
		amrex::Geometry &	geom,
		amrex::Vector< std::string > &	varnames
	)

{
#ifndef ERF_USE_NETCDF
    amrex::ignore_unused(cur_time, plot_prefix, level_step);
#endif
    geom.define(amrex::makeSlab(m_lsm_geom.Domain(), 2, 0), m_lsm_geom.ProbDomain(), m_lsm_geom.Coord(), m_lsm_geom.isPeriodic());
 
    amrex::Vector<amrex::MultiFab*> mf_data;
 
    mf_data.push_back(&net_rad);
 
    mf_data.push_back(&mw);
    mf_data.push_back(&mws);
    mf_data.push_back(&t_canop);
    mf_data.push_back(&t_skin);
    mf_data.push_back(&t_ground_skin);
    mf_data.push_back(&t_cas);
    mf_data.push_back(&q_cas);
    mf_data.push_back(&mw_inc);
 
    mf_data.push_back(&evapo_dry);
    mf_data.push_back(&shf_air);
    mf_data.push_back(&shf_canop);
    mf_data.push_back(&shf_soil);
    mf_data.push_back(&lhf_air);
    mf_data.push_back(&lhf_canop);
    mf_data.push_back(&lhf_soil);
 
    //mf_data.push_back(&ustar);
    //mf_data.push_back(&tstar);
 
    mf_data.push_back(&r_a);
    mf_data.push_back(&r_b);
    mf_data.push_back(&r_c);
    mf_data.push_back(&r_d);
    mf_data.push_back(&r_soil);
 
    mf_data.push_back(&wet_canop);
 
    mf_data.push_back(&albedovis_v);
    mf_data.push_back(&albedovis_s);
    mf_data.push_back(&albedonir_v);
    mf_data.push_back(&albedonir_s);
    mf_data.push_back(&IR_emis_vege);
    mf_data.push_back(&IR_emis_soil);
    mf_data.push_back(&zrefxy);
    mf_data.push_back(&vege_YES);
 
    mf_data.push_back(&LAI);
    mf_data.push_back(&SAI);
 
    MultiFab tmp_landtype = amrex::ToMultiFab(landtype);
    MultiFab tmp_landmask = amrex::ToMultiFab(landmask);
 
    mf_data.push_back(&tmp_landtype);
    mf_data.push_back(&tmp_landmask);
 
    IntVect ng(0, 0, 0);
 
    // Total number of output MFs: net_rad components + mf_data size - 1 + diag vars + olen
    const int output_size = SLM_NetRad::NumVars + static_cast<int>(mf_data.size()) - 1 + SLM_Diag::NumVars + 1;
    fab.define(ba_lsm_2d, net_rad.DistributionMap(), output_size, ng);
    MultiFab::Copy(fab, *(mf_data[0]), 0, 0, SLM_NetRad::NumVars, 0);
    for (int i = 1; i < static_cast<int>(mf_data.size()); ++i)
    {
        MultiFab::Copy(fab, *(mf_data[i]), 0, i + SLM_NetRad::NumVars - 1, 1, 0);
    }
    MultiFab::Copy(fab, slm_diag, 0, output_size - SLM_Diag::NumVars - 1, SLM_Diag::NumVars, 0);
    MultiFab::Copy(fab, *(lsm_fab_flux[LsmFlux_SLM::olen]), 0, output_size - 1, 1, 0);
 
 
    varnames = amrex::Vector<std::string>();
    // net_rad component names:
    varnames.push_back("net_swup1");
    varnames.push_back("net_swup2");
    varnames.push_back("net_swdn1");
    varnames.push_back("net_swdn2");
    varnames.push_back("net_sw1");
    varnames.push_back("net_sw2");
    varnames.push_back("tir1");
    varnames.push_back("tir2");
    varnames.push_back("net_lwup1");
    varnames.push_back("net_lwup2");
    varnames.push_back("net_lwdn1");
    varnames.push_back("net_lwdn2");
    varnames.push_back("net_lw1");
    varnames.push_back("net_lw2");
    varnames.push_back("net_rad1");
    varnames.push_back("net_rad2");
    // ----------------------------
 
    varnames.push_back("mw");
    varnames.push_back("mws");
    varnames.push_back("t_canop");
    varnames.push_back("t_skin");
    varnames.push_back("t_ground_skin");
    varnames.push_back("t_cas");
    varnames.push_back("q_cas");
    varnames.push_back("mw_inc");
 
    varnames.push_back("evapo_dry");
    varnames.push_back("shf_air");
    varnames.push_back("shf_canop");
    varnames.push_back("shf_soil");
    varnames.push_back("lhf_air");
    varnames.push_back("lhf_canop");
    varnames.push_back("lhf_soil");
 
    //varnames.push_back("ustar");
    //varnames.push_back("tstar");
 
    varnames.push_back("r_a");
    varnames.push_back("r_b");
    varnames.push_back("r_c");
    varnames.push_back("r_d");
    varnames.push_back("r_soil");
 
    varnames.push_back("wet_canop");
 
    varnames.push_back("albedovis_veg");
    varnames.push_back("albedovis_soil");
    varnames.push_back("albedonir_veg");
    varnames.push_back("albedonir_soil");
    varnames.push_back("IR_emis_veg");
    varnames.push_back("IR_emis_soil");
    varnames.push_back("zrefxy");
    varnames.push_back("veg_flag");
 
    varnames.push_back("LAI");
    varnames.push_back("SAI");
 
    varnames.push_back("vegtype");
    varnames.push_back("landmask");
 
    for (int i = 0; i < static_cast<int>(diag_names.size()); ++i)
    {
        varnames.push_back(diag_names[i]);
    }
 
    varnames.push_back("olen");
 
    AMREX_ALWAYS_ASSERT(static_cast<int>(varnames.size()) == output_size);
 
    if (plotfile_type == PlotFileType::Amrex) {
        //amrex::WriteSingleLevelPlotfile(plotfilename, fab, varnames, lsm_2d_geom, cur_time, level_step);
#ifdef ERF_USE_NETCDF
        // Temporarily write NetCDF always
        //writeSLM_NetCDF(fab, varnames, cur_time, plot_prefix, level_step);
#endif
#ifdef ERF_USE_NETCDF
    } else if (plotfile_type == PlotFileType::Netcdf) {
        writeSLM_NetCDF(fab, varnames, cur_time, plot_prefix, level_step);
#endif
    } else {
        Abort("Dont know this plot_filetype");
    }
}

Here is the call graph for this function:

Member Data Documentation

albedonir_s

amrex::MultiFab SLM::albedonir_s

private

albedonir_v

amrex::MultiFab SLM::albedonir_v

private

albedovis_s

amrex::MultiFab SLM::albedovis_s

private

albedovis_v

amrex::MultiFab SLM::albedovis_v

private

albold_noahmp

amrex::MultiFab SLM::albold_noahmp

private

ba_lsm_2d

amrex::BoxArray SLM::ba_lsm_2d

private

BAI

amrex::MultiFab SLM::BAI

private

bats_cosz_rad

amrex::Real SLM::bats_cosz_rad = two

private

bats_nir_age_rad

amrex::Real SLM::bats_nir_age_rad = myhalf

private

bats_nir_dir_rad

amrex::Real SLM::bats_nir_dir_rad = 0.4

private

bats_nir_new_rad

amrex::Real SLM::bats_nir_new_rad = 0.65

private

bats_vis_age_rad

amrex::Real SLM::bats_vis_age_rad = 0.2

private

bats_vis_dir_rad

amrex::Real SLM::bats_vis_dir_rad = 0.4

private

bats_vis_new_rad

amrex::Real SLM::bats_vis_new_rad = 0.95

private

betads_rad

amrex::Real SLM::betads_rad = myhalf

private

betais_rad

amrex::Real SLM::betais_rad = myhalf

private

cbiom

amrex::MultiFab SLM::cbiom

private

clay0

amrex::Vector<amrex::Real> SLM::clay0

private

cp

constexpr amrex::Real SLM::cp = 1004.0

staticconstexprprivate

cp_vege

amrex::MultiFab SLM::cp_vege

private

cp_water

constexpr amrex::Real SLM::cp_water = 4.1796e6

staticconstexprprivate

d_lai_curr

amrex::Gpu::DeviceVector<amrex::Real> SLM::d_lai_curr

private

d_lai_next

amrex::Gpu::DeviceVector<amrex::Real> SLM::d_lai_next

private

d_param_table

amrex::TableData<amrex::Real, 2> SLM::d_param_table

private

d_rad_params

std::unordered_map<std::string, std::unique_ptr<amrex::Gpu::DeviceVector<amrex::Real> > > SLM::d_rad_params

private

d_sai_curr

amrex::Gpu::DeviceVector<amrex::Real> SLM::d_sai_curr

private

d_sai_next

amrex::Gpu::DeviceVector<amrex::Real> SLM::d_sai_next

private

d_soil_params

std::unordered_map<std::string, std::unique_ptr<amrex::Gpu::DeviceVector<amrex::Real> > > SLM::d_soil_params

private

d_veg_params

std::unordered_map<std::string, std::unique_ptr<amrex::Gpu::DeviceVector<amrex::Real> > > SLM::d_veg_params

private

diag_names

const std::vector<std::string> SLM::diag_names

inlinestaticprivate

Initial value:

= {
        "precip",
        "precip_in",
        "precip_sfc",
        "runoff_sfc",
        "drain",
        "drain_flux",
        "evapo_wet",
        "grflux"
    }

dirt_soot_rad

amrex::Real SLM::dirt_soot_rad = 0.3

private

disp_hgt

amrex::MultiFab SLM::disp_hgt

private

dleaf

amrex::MultiFab SLM::dleaf

private

dosoiltnudging

bool SLM::dosoiltnudging = false

private

dosoilwnudging

bool SLM::dosoilwnudging = false

private

eg_lake_rad

amrex::Real SLM::eg_lake_rad = 0.98

private

eg_soil_rad

amrex::Real SLM::eg_soil_rad = 0.97

private

epsv

constexpr amrex::Real SLM::epsv = 0.61

staticconstexprprivate

evapo_dry

amrex::MultiFab SLM::evapo_dry

private

evapo_wet

amrex::MultiFab SLM::evapo_wet

private

evp_air

amrex::MultiFab SLM::evp_air

private

evp_canop

amrex::MultiFab SLM::evp_canop

private

evp_soil

amrex::MultiFab SLM::evp_soil

private

extra_growth_rad

amrex::Real SLM::extra_growth_rad = 10.

private

first_step

bool SLM::first_step = true

private

Referenced by Advance(), and Update_Lsm_Vars().

full_params

SLMParameterTable SLM::full_params

private

grain_growth_rad

amrex::Real SLM::grain_growth_rad = 5000.

private

hs_rc

amrex::MultiFab SLM::hs_rc

private

IMPERV

amrex::MultiFab SLM::IMPERV

private

interpolate_lai

bool SLM::interpolate_lai = false

private

IR_emis_grnd

amrex::MultiFab SLM::IR_emis_grnd

private

IR_emis_soil

amrex::MultiFab SLM::IR_emis_soil

private

IR_emis_urban

constexpr amrex::Real SLM::IR_emis_urban = 0.9

staticconstexprprivate

IR_emis_vege

amrex::MultiFab SLM::IR_emis_vege

private

Khai_L

amrex::MultiFab SLM::Khai_L

private

khi_lsm

int SLM::khi_lsm

private

klo_lsm

int SLM::klo_lsm

private

LAI

amrex::MultiFab SLM::LAI

private

LAI0

amrex::Real SLM::LAI0 = zero

private

lai_table

std::vector<std::vector<amrex::Real> > SLM::lai_table

private

landmask

amrex::iMultiFab SLM::landmask

private

landtype

amrex::iMultiFab SLM::landtype

private

landtype0

int SLM::landtype0 = 16

private

lhf_air

amrex::MultiFab SLM::lhf_air

private

lhf_canop

amrex::MultiFab SLM::lhf_canop

private

lhf_soil

amrex::MultiFab SLM::lhf_soil

private

lsm_fab_flux

amrex::Array<FabPtr, LsmFlux_SLM::NumVars> SLM::lsm_fab_flux

private

Referenced by Lsm_Flux_Ptr().

lsm_fab_vars

amrex::Array<FabPtr, LsmVar_SLM::NumVars> SLM::lsm_fab_vars

private

Referenced by Lsm_Data_Ptr(), and Lsm_Unmapped_Ptr().

LsmDataMap

amrex::Vector<int> SLM::LsmDataMap

private

Referenced by Lsm_Data_Ptr().

LsmDataName

amrex::Vector<std::string> SLM::LsmDataName

private

Referenced by Lsm_DataName().

LsmFluxMap

amrex::Vector<int> SLM::LsmFluxMap

private

Referenced by Lsm_Flux_Ptr().

LsmFluxName

amrex::Vector<std::string> SLM::LsmFluxName

private

Referenced by Lsm_FluxName().

LsmVarName_Full

constexpr const char* SLM::LsmVarName_Full[]

staticconstexprprivate

Initial value:

= {
      "tsurf", "ustar", "tstar", "qstar", "ref_t", "ref_q", "ref_p", "ref_d", "ref_u", "ref_v", "ref_precip",
      "SW_dw_dir_vis", "SW_dw_dir_nir", "SW_dw_dif_vis", "SW_dw_dif_nir", "LW_dw", "zenith",
      "tveg", "mv", "tsoil", "wsoil", "sand", "clay", "soil_thickness", "node_z", "interface_z",
      "soilw_nudge", "soilt_nudge", "sw_over_sat", "soil_relax_hgt", "soilt_obs", "soilw_obs", "soil_transp_frac", "w_s_FC", "w_s_WP",
      "sst_capa", "sst_cond", "poro_soil", "theta_FC", "theta_WP", "m_pot_sat", "Bconst", "ks","lai","vegtype","soiltype",
      "veg_frac", "veg_frac_min", "veg_frac_max", "surface_u", "surface_v", "surface_vapor", "surface_heat", "precip_soil", "emis_sfc", "alb_nir_sfc", "alb_vis_sfc", "alb_nir_sfc_diff", "alb_vis_sfc_diff"
    }

m_calday

amrex::Real SLM::m_calday = -1.0

private

m_domain_bcs_type

amrex::Vector<amrex::BCRec> SLM::m_domain_bcs_type

private

m_dt

amrex::Real SLM::m_dt

private

Referenced by Advance(), and set_dt().

m_dz_lsm

std::vector<amrex::Real> SLM::m_dz_lsm

private

m_geom

amrex::Geometry SLM::m_geom

private

Referenced by Lsm_Atmos_Geom().

m_geom0

amrex::Geometry SLM::m_geom0

private

m_lsm_data_size

int SLM::m_lsm_data_size = 44

private

Referenced by Lsm_Data_Size(), Lsm_DataIndex(), and Lsm_Set_Source_Data_Ptr().

m_lsm_flux_size

int SLM::m_lsm_flux_size = 5

private

Referenced by Lsm_Flux_Size(), Lsm_FluxIndex(), and Lsm_Set_Source_Flux_Ptr().

m_lsm_geom

amrex::Geometry SLM::m_lsm_geom

private

Referenced by Lsm_Geom().

m_lsm_geom0

amrex::Geometry SLM::m_lsm_geom0

private

m_nz_lsm

int SLM::m_nz_lsm = 7

private

m_orbital_day

int SLM::m_orbital_day = -1

private

m_orbital_mon

int SLM::m_orbital_mon = -1

private

m_orbital_sec

int SLM::m_orbital_sec = -1

private

m_orbital_year

int SLM::m_orbital_year = -1

private

m_updated

bool SLM::m_updated = false

private

Referenced by Advance(), and Get_Update_Status().

mw

amrex::MultiFab SLM::mw

private

mw_inc

amrex::MultiFab SLM::mw_inc

private

mw_mx

amrex::MultiFab SLM::mw_mx

private

mws

amrex::MultiFab SLM::mws

private

mws_mx

amrex::MultiFab SLM::mws_mx

private

mws_mx0

amrex::Real SLM::mws_mx0 = 50.0

private

net_rad

amrex::MultiFab SLM::net_rad

private

nroot

amrex::iMultiFab SLM::nroot

private

num_landtypes

int SLM::num_landtypes = -1

private

num_soil_params

int SLM::num_soil_params = -1

private

num_veg_params

int SLM::num_veg_params = -1

private

opt_alb

int SLM::opt_alb = 1

private

opt_rad

int SLM::opt_rad = 1

private

param_soil_categories

amrex::Vector<std::string> SLM::param_soil_categories

private

param_table

std::vector<std::vector<amrex::Real> > SLM::param_table

private

param_veg_categories

amrex::Vector<std::string> SLM::param_veg_categories

private

parameter_file

std::string SLM::parameter_file = "NoahmpTable.TBL"

private

params_updated

bool SLM::params_updated = false

private

phi_1

amrex::MultiFab SLM::phi_1

private

phi_2

amrex::MultiFab SLM::phi_2

private

precip_extinc

amrex::MultiFab SLM::precip_extinc

private

precip_sfc

amrex::MultiFab SLM::precip_sfc

private

q_cas

amrex::MultiFab SLM::q_cas

private

q_gr

amrex::MultiFab SLM::q_gr

private

q_sfc

amrex::MultiFab SLM::q_sfc

private

r_a

amrex::MultiFab SLM::r_a

private

r_b

amrex::MultiFab SLM::r_b

private

r_c

amrex::MultiFab SLM::r_c

private

r_d

amrex::MultiFab SLM::r_d

private

r_litter

constexpr amrex::Real SLM::r_litter = zero

staticconstexprprivate

r_soil

amrex::MultiFab SLM::r_soil

private

rad_input_file

std::string SLM::rad_input_file

private

rad_output_map

std::unordered_map<std::string, std::string> SLM::rad_output_map

inlinestaticprivate

Initial value:

= {
        {"cos_zenith_angle",   "cos_zenith"},
        {"sw_flux_dn", ""},
        {"sw_flux_dn_dir_vis", "SW_dw_dir_vis"},
        {"sw_flux_dn_dir_nir", "SW_dw_dir_nir"},
        {"sw_flux_dn_dif_vis", "SW_dw_dif_vis"},
        {"sw_flux_dn_dif_nir", "SW_dw_dif_nir"},
        {"lw_flux_dn", "LW_dw"}
    }

Referenced by get_rad_output_map().

Rc_max

amrex::Real SLM::Rc_max = 5000.0

private

Rc_min

amrex::MultiFab SLM::Rc_min

private

relax_hgt

amrex::Vector<amrex::Real> SLM::relax_hgt

private

Rgl

amrex::MultiFab SLM::Rgl

private

rsurf_exp

amrex::Real SLM::rsurf_exp = 5.0

private

SAI

amrex::MultiFab SLM::SAI

private

sai_table

std::vector<std::vector<amrex::Real> > SLM::sai_table

private

sand0

amrex::Vector<amrex::Real> SLM::sand0

private

sdew

amrex::MultiFab SLM::sdew

private

shf_air

amrex::MultiFab SLM::shf_air

private

shf_canop

amrex::MultiFab SLM::shf_canop

private

shf_soil

amrex::MultiFab SLM::shf_soil

private

sigma

constexpr amrex::Real SLM::sigma = 5.67e-8

staticconstexprprivate

slm_diag

amrex::MultiFab SLM::slm_diag

private

slm_to_rad_vars

amrex::Vector<const amrex::MultiFab*> SLM::slm_to_rad_vars

private

Referenced by export_to_RRTMGP().

snow_emis_rad

amrex::Real SLM::snow_emis_rad = 0.95

private

soil_dataset

std::string SLM::soil_dataset = "stas"

private

soilt_vars

amrex::MultiFab SLM::soilt_vars

private

soilw_vars

amrex::MultiFab SLM::soilw_vars

private

source_data

amrex::Vector<amrex::MultiFab*> SLM::source_data

private

Referenced by Lsm_Set_Source_Data_Ptr().

source_flux

amrex::Vector<amrex::MultiFab*> SLM::source_flux

private

Referenced by Lsm_Set_Source_Flux_Ptr().

source_unmapped

amrex::Vector<amrex::MultiFab*> SLM::source_unmapped

private

Referenced by Lsm_Set_Source_Unmapped_Ptr().

sstxy

amrex::MultiFab SLM::sstxy

private

st0

amrex::Vector<amrex::Real> SLM::st0

private

start_time

amrex::Real SLM::start_time = -1.0

private

Referenced by Advance().

surf_vars

const std::unordered_set<int> SLM::surf_vars

inlinestaticprivate

sw0

amrex::Vector<amrex::Real> SLM::sw0

private

swemx_rad

amrex::Real SLM::swemx_rad = one

private

t00

amrex::Real SLM::t00 = 300.0

private

t_canop

amrex::MultiFab SLM::t_canop

private

t_canop_max

constexpr amrex::Real SLM::t_canop_max = 343.

staticconstexprprivate

t_cas

amrex::MultiFab SLM::t_cas

private

t_ground_skin

amrex::MultiFab SLM::t_ground_skin

private

T_opt

amrex::Real SLM::T_opt = 298.0

private

t_sfc

amrex::MultiFab SLM::t_sfc

private

t_skin

amrex::MultiFab SLM::t_skin

private

tabs_s

amrex::Real SLM::tabs_s = zero

private

tau0_rad

amrex::Real SLM::tau0_rad = 1.0e6

private

tausoil

amrex::Real SLM::tausoil = 86400.0

private

tauss_noahmp

amrex::MultiFab SLM::tauss_noahmp

private

tfriz

constexpr amrex::Real SLM::tfriz = 273.15

staticconstexprprivate

time

amrex::Real SLM::time = zero

private

Referenced by Advance().

unmapped_fields

amrex::Vector<int> SLM::unmapped_fields

private

Referenced by Lsm_Set_Source_Unmapped_Ptr(), Lsm_Unmapped_Ptr(), and Lsm_Unmapped_Size().

use_param_file

bool SLM::use_param_file = false

private

use_terrain

bool SLM::use_terrain = false

private

Referenced by Define().

use_wrf_lai

bool SLM::use_wrf_lai = false

private

use_wrfinput

bool SLM::use_wrfinput = false

private

Referenced by Advance(), Define(), and Update_Lsm_Vars().

veg_dataset

std::string SLM::veg_dataset = "modis"

private

vege_YES

amrex::MultiFab SLM::vege_YES

private

vegetype

amrex::iMultiFab SLM::vegetype

private

wet_canop

amrex::MultiFab SLM::wet_canop

private

wrfinput_initialized

bool SLM::wrfinput_initialized = false

private

Referenced by Advance(), and Update_Lsm_Vars().

wrfinput_map

std::unordered_map<std::string, std::string> SLM::wrfinput_map

inlinestaticprivate

Initial value:

= {
        {"DZS", "soil_thickness"},
        {"ZS", "node_z"},
        {"TSLB", "tsoil"},
        {"SMOIS", "wsoil"},
        {"LAI", "lai"},
        {"IVGTYP", "vegtype"},
        {"ISLTYP", "soiltype"},
        {"TSK", "tsurf"},
        {"VEGFRA", "veg_frac"},
        {"SHDMIN", "veg_frac_min"},
        {"SHDMAX", "veg_frac_max"},
        
    }

Referenced by Lsm_WRFInputNames().

z0_sfc

amrex::MultiFab SLM::z0_sfc

private

z0_soil

amrex::Real SLM::z0_soil = 0.01

private

z_phys_nd

amrex::MultiFab* SLM::z_phys_nd

private

zref

amrex::Real SLM::zref = myhalf

private

zrefxy

amrex::MultiFab SLM::zrefxy

private

ztop

amrex::MultiFab SLM::ztop

private

---

The documentation for this class was generated from the following files:

• Source/LandSurfaceModel/SLM/ERF_SLM.H
• Source/LandSurfaceModel/SLM/ERF_SLM.cpp
• Source/LandSurfaceModel/SLM/ERF_SLM_IO.cpp